Wikipedia:WikiProject Pharmacology/Log/2010-02-18

Standard header for logs from CheMoBot

01:00:40 (2, 4, 5) (EDIT) User:98.122.162.2 (contribs, talk) edited Cetirizine (diff, hist)
Changed: 'metabolism' ('[[CYP3A4]] (Cytochrome P450 3A4)' -> 'Probable major agent: [[CYP3A43]] (Cytochrome P450 3A43); Minor agent: [[CYP3A4]] (Cytochrome P450 3A4)', SET '[[CYP3A4]] (Cytochrome P450 3A4)')
01:03:51 (3, 2, 4) (EDIT) User:209.91.23.152 (contribs, talk) edited Famotidine (diff, hist)
Added links: http://answers.yahoo.com/question/index?qid=20080126021135AAFrhF0, http://cat.inist.fr/?aModele=afficheN&cpsidt=1800310
01:34:18 (3, 2, 4) (EDIT) User:Crossmr (contribs, talk) edited JWH-018 (diff, hist)
Added links: http://www.hkn24.com/news/articleView.html?idxno=28611
02:18:17 (3, 2, 4) (EDIT) User:Ipatrol (contribs, talk) edited Dehydroepiandrosterone (diff, hist)
Added links: http://www.nlm.nih.gov/medlineplus/druginfo/natural/patient-dhea.html#Safety, http://www.medscape.com/druginfo/dosage?cid=med&drugid=3512&drugname=DHEA+Oral&monotype=default, http://www.raysahelian.com/dhea.html
04:25:24 (2, 4, 5) (EDIT) User:Thricecube (contribs, talk) edited Etomidate (diff, hist)
Added: 'routes_of_administration' ('' -> '[[Intravenous therapy|Intravenous]]', SET '')
04:47:08 (2, 4, 5) (EDIT) User:85.179.18.95 (contribs, talk) edited Atenolol (diff, hist)
Added: 'drug_name' ('' -> 'Atenolol', SET '')
04:47:08 (2, 4, 5) (EDIT) User:85.179.18.95 (contribs, talk) edited Atenolol (diff, hist)
Added: 'width2' ('' -> '200', SET '')
04:47:08 (2, 4, 5) (EDIT) User:85.179.18.95 (contribs, talk) edited Atenolol (diff, hist)
Added: 'imagename' ('1 : 1 mixture (racemate) ' -> '1 : 1 mixture (racemate) ', SET '')
05:11:50 (2, 3, 4) (EDIT) User:Boghog2 (contribs, talk) edited Azapropazone (diff, hist)
Changed: 'elimination_half-life' ('' -> '20 hours')
05:43:09 (3, 2, 4) (EDIT) User:C6541 (contribs, talk) edited JWH-018 (diff, hist)
Added links: http://www.fr-online.de/frankfurt_und_hessen/nachrichten/frankfurt/1646010_Gefaehrlicher-Kick-mit-Spice.html, http://www.haz.de/newsroom/wissen/zentral/wissen/art680,757107#, http://www.badische-zeitung.de/nachrichten/panorama/spice-enthaelt-chemischen-wirkstoff--9211606.html, http://www.mindfully.org/JWH/JWH-018/JWH-018-Toxicity-Results.htm, http://www.emcdda.europa.eu/publications/drug-profiles/synthetic-cannabinoids#control, http://www.bgblportal.de/BGBL/bgbl1f/bgbl109s0049.pdf, http://www.emcdda.europa.eu/publications/drug-profiles/synthetic-cannabinoids#control, http://www.emcdda.europa.eu/publications/drug-profiles/synthetic-cannabinoids#control, http://www.emcdda.europa.eu/publications/drug-profiles/synthetic-cannabinoids#control, http://www.hkn24.com/news/articleView.html?idxno=28611, http://www.regeringen.se/sb/d/12102/a/130038, http://business.timesonline.co.uk/tol/business/law/article6965663.ece, http://www.phoenixnewtimes.com/2010-02-04/news/up-in-smoke-valley-smokers-buy-steal-and-inhale-jwh-018-
06:07:20 (3, 2, 4) (EDIT) User:124.120.237.157 (contribs, talk) edited Galantamine (diff, hist)
Added links: http://www.sopharma.com/
06:29:11 (2, 3, 5) (EDIT) User:DocWatson42 (contribs, talk) edited MDMA (diff, hist)
Changed: 'elimination_half-life' ('6â10 (though duration of effects is typically actually 3-5 hours)' -> '6â10 (though duration of effects is typically actually 3â5 hours)')
06:40:26 (2, 3, 5) (EDIT) User:DocWatson42 (contribs, talk) edited 3,4-Methylenedioxyamphetamine (diff, hist)
Changed: 'elimination_half-life' ('dose dependent 6-10 hours' -> 'dose dependent 6â10 hours')
06:46:20 (3, 2, 4) (EDIT) User:154.5.208.134 (contribs, talk) edited Dehydroepiandrosterone (diff, hist)
Added links: http://www.example.com
08:31:57 (2, 4, 5) (EDIT) User:71.205.186.225 (contribs, talk) edited Verapamil (diff, hist)
Added: 'imagename' ('1 : 1 mixture (racemate) ' -> '1 : 1 mixture (racemic mixture) ', SET '')
09:28:18 (2, 3, 4) (EDIT) User:JÃ¼ (contribs, talk) edited Etilefrine (diff, hist)
Changed: 'imagename' ('' -> '1 : 1 mixture (racemate) ')
09:28:19 (2, 3, 4) (EDIT) User:JÃ¼ (contribs, talk) edited Etilefrine (diff, hist)
Changed: 'width' ('' -> '270px')
12:32:49 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Methylenedioxyhydroxyamphetamine (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
12:36:55 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Norfluoxetine (diff, hist)
Changed: 'F' ('' -> '3')
12:36:56 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Norfluoxetine (diff, hist)
Changed: 'chemical_formula' ('C16H16F3NO' -> '')
12:36:56 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Norfluoxetine (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
12:36:56 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Norfluoxetine (diff, hist)
Changed: 'C' ('' -> '16')
12:36:57 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Norfluoxetine (diff, hist)
Changed: 'H' ('' -> '16')
12:36:57 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Norfluoxetine (diff, hist)
Changed: 'N' ('' -> '1')
12:36:57 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Norfluoxetine (diff, hist)
Changed: 'O' ('' -> '1')
12:42:14 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Desmethylcitalopram (diff, hist)
Changed: 'F' ('' -> '1')
12:42:14 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Desmethylcitalopram (diff, hist)
Changed: 'chemical_formula' ('C19H19F1N2O1' -> '')
12:42:14 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Desmethylcitalopram (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
12:42:14 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Desmethylcitalopram (diff, hist)
Changed: 'C' ('' -> '19')
12:42:14 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Desmethylcitalopram (diff, hist)
Changed: 'H' ('' -> '19')
12:42:15 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Desmethylcitalopram (diff, hist)
Changed: 'N' ('' -> '2')
12:42:15 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Desmethylcitalopram (diff, hist)
Changed: 'O' ('' -> '1')
12:44:46 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Didesmethylcitalopram (diff, hist)
Changed: 'F' ('' -> '1')
12:44:47 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Didesmethylcitalopram (diff, hist)
Changed: 'chemical_formula' ('C18H17F1N2O1' -> '')
12:44:47 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Didesmethylcitalopram (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
12:44:47 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Didesmethylcitalopram (diff, hist)
Changed: 'C' ('' -> '18')
12:44:47 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Didesmethylcitalopram (diff, hist)
Changed: 'H' ('' -> '17')
12:44:48 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Didesmethylcitalopram (diff, hist)
Changed: 'N' ('' -> '2')
12:44:48 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Didesmethylcitalopram (diff, hist)
Changed: 'O' ('' -> '1')
12:46:43 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Profadol (diff, hist)
Changed: 'chemical_formula' ('C14H21NO' -> '')
12:46:43 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Profadol (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
12:46:43 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Profadol (diff, hist)
Changed: 'C' ('' -> '14')
12:46:44 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Profadol (diff, hist)
Changed: 'H' ('' -> '21')
12:46:44 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Profadol (diff, hist)
Changed: 'N' ('' -> '1')
12:46:44 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Profadol (diff, hist)
Changed: 'O' ('' -> '1')
12:48:02 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Alvameline (diff, hist)
Changed: 'chemical_formula' ('C9H15N5' -> '')
12:48:02 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Alvameline (diff, hist)
Changed: 'molecular_weight' ('193.25' -> '193.25 g/mol')
12:48:03 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Alvameline (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
12:48:03 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Alvameline (diff, hist)
Changed: 'C' ('' -> '9')
12:48:03 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Alvameline (diff, hist)
Changed: 'H' ('' -> '15')
12:48:03 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Alvameline (diff, hist)
Changed: 'N' ('' -> '5')
12:49:54 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Milameline (diff, hist)
Changed: 'width' ('200px' -> '100px')
12:49:54 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Milameline (diff, hist)
Changed: 'chemical_formula' ('C8H14N2O' -> '')
12:49:54 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Milameline (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
12:49:55 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Milameline (diff, hist)
Changed: 'C' ('' -> '8')
12:49:55 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Milameline (diff, hist)
Changed: 'H' ('' -> '14')
12:49:55 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Milameline (diff, hist)
Changed: 'N' ('' -> '2')
12:49:55 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Milameline (diff, hist)
Changed: 'O' ('' -> '1')
12:52:44 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Xanomeline (diff, hist)
Changed: 'image' ('Xanomeline.png' -> 'Xanomeline.svg')
12:52:44 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Xanomeline (diff, hist)
Changed: 'S' ('' -> '1')
12:52:44 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Xanomeline (diff, hist)
Changed: 'chemical_formula' ('C14H23N3OS' -> '')
12:52:45 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Xanomeline (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
12:52:45 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Xanomeline (diff, hist)
Changed: 'C' ('' -> '14')
12:52:45 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Xanomeline (diff, hist)
Changed: 'H' ('' -> '23')
12:52:45 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Xanomeline (diff, hist)
Changed: 'N' ('' -> '3')
12:52:46 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Xanomeline (diff, hist)
Changed: 'O' ('' -> '1')
12:55:36 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Fengabine (diff, hist)
Changed: 'width' ('200px' -> '')
12:55:36 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Fengabine (diff, hist)
Changed: 'chemical_formula' ('C17H17Cl2NO' -> '')
12:55:36 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Fengabine (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
12:55:37 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Fengabine (diff, hist)
Changed: 'C' ('' -> '17')
12:55:37 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Fengabine (diff, hist)
Changed: 'H' ('' -> '17')
12:55:37 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Fengabine (diff, hist)
Changed: 'N' ('' -> '1')
12:55:38 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Fengabine (diff, hist)
Changed: 'O' ('' -> '1')
12:55:38 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Fengabine (diff, hist)
Changed: 'Cl' ('' -> '2')
12:58:39 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Phenylethylidenehydrazine (diff, hist)
Changed: 'chemical_formula' ('C8H10N2' -> '')
12:58:39 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Phenylethylidenehydrazine (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
12:58:40 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Phenylethylidenehydrazine (diff, hist)
Changed: 'C' ('' -> '8')
12:58:40 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Phenylethylidenehydrazine (diff, hist)
Changed: 'H' ('' -> '10')
12:58:40 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Phenylethylidenehydrazine (diff, hist)
Changed: 'N' ('' -> '2')
13:00:33 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Desmethylsertraline (diff, hist)
Changed: 'chemical_formula' ('C16H15Cl2N' -> '')
13:00:33 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Desmethylsertraline (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
13:00:33 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Desmethylsertraline (diff, hist)
Changed: 'C' ('' -> '16')
13:00:33 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Desmethylsertraline (diff, hist)
Changed: 'H' ('' -> '15')
13:00:34 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Desmethylsertraline (diff, hist)
Changed: 'N' ('' -> '1')
13:00:34 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Desmethylsertraline (diff, hist)
Changed: 'Cl' ('' -> '2')
13:19:31 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sabcomeline (diff, hist)
Changed: 'image' ('Sabcomeline.png' -> 'Sabcomeline skeletal.svg')
13:19:31 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sabcomeline (diff, hist)
Changed: 'width' ('200px' -> '150px')
13:19:31 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sabcomeline (diff, hist)
Changed: 'chemical_formula' ('C10H16ClN3O' -> '')
13:19:32 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sabcomeline (diff, hist)
Changed: 'molecular_weight' ('229.71 g/mol' -> '193.12 g/mol')
13:19:32 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sabcomeline (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
13:19:32 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sabcomeline (diff, hist)
Changed: 'smiles' ('' -> 'C2CC1CCN2CC1\C(\C#N)=N\OC')
13:19:32 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sabcomeline (diff, hist)
Changed: 'C' ('' -> '10')
13:19:32 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sabcomeline (diff, hist)
Changed: 'H' ('' -> '15')
13:19:33 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sabcomeline (diff, hist)
Changed: 'N' ('' -> '3')
13:19:33 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sabcomeline (diff, hist)
Changed: 'O' ('' -> '1')
13:19:33 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sabcomeline (diff, hist)
Changed: 'PubChem' ('9577994' -> '9577995')
13:19:33 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sabcomeline (diff, hist)
Changed: 'ChemSpiderID' ('7852358' -> '7852359')
15:04:01 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Amfepramone (diff, hist)
Changed: 'InChI' ('' -> '1/C13H19NO/c1-4-14(5-2)11(3)13(15)12-9-7-6-8-10-12/h6-11H,4-5H2,1-3H3')
15:04:01 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Amfepramone (diff, hist)
Changed: 'InChIKey' ('' -> 'XXEPPPIWZFICOJ-UHFFFAOYAJ')
15:04:01 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Amfepramone (diff, hist)
Changed: 'smiles' ('' -> 'O=C(c1ccccc1)C(N(CC)CC)C')
15:04:03 (2, 3, 4) (EDIT) User:JÃ¼ (contribs, talk) edited Ambroxol (diff, hist)
Changed: 'image' ('Ambroxol.svg' -> 'Ambroxol structural formulae.png')
15:06:18 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Clopimozide (diff, hist)
Changed: 'InChI' ('' -> '1/C28H28ClF2N3O/c29-21-7-12-27-26(18-21)32-28(35)34(27)24-13-16-33(17-14-24)15-1-2-25(19-3-8-22(30)9-4-19)20-5-10-23(31)11-6-20/h3-12,18,24-25H,1-2,13-17H2,(H,32,35)')
15:06:18 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Clopimozide (diff, hist)
Changed: 'InChIKey' ('' -> 'JCZYXTVBWHAWLL-UHFFFAOYAU')
15:06:18 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Clopimozide (diff, hist)
Changed: 'smiles' ('' -> 'Fc1ccc(cc1)C(c2ccc(F)cc2)CCCN5CCC(N4c3ccc(Cl)cc3NC4=O)CC5')
15:11:18 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Cyamemazine (diff, hist)
Changed: 'InChI' ('' -> '1/C19H21N3S/c1-14(12-21(2)3)13-22-16-6-4-5-7-18(16)23-19-9-8-15(11-20)10-17(19)22/h4-10,14H,12-13H2,1-3H3')
15:11:18 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Cyamemazine (diff, hist)
Changed: 'InChIKey' ('' -> 'SLFGIOIONGJGRT-UHFFFAOYAN')
15:11:18 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Cyamemazine (diff, hist)
Changed: 'smiles' ('' -> 'N#Cc2cc1N(c3c(Sc1cc2)cccc3)CC(C)CN(C)C')
15:14:50 (3, 2, 4) (EDIT) User:Kayau (contribs, talk) edited Phencyclidine (diff, hist)
Added links: http://www.erowid.org/archive/rhodium/chemistry/pcp/pcp_index.html, http://www.emedicine.com/med/TOPIC1813.HTM, http://books.google.com/books?id=HVYyRsuUEc0C&pg=PA1041, http://jcp.sagepub.com/cgi/pmidlookup?view=long&pmid=6725621
15:28:33 (3, 2, 4) (EDIT) User:Pjacobi (contribs, talk) edited Phenylpropanolamine (diff, hist)
Added links: http://www.fda.gov/Drugs/DrugSafety/PublicHealthAdvisories/ucm052239.htm
15:54:20 (3, 2, 4) (EDIT) User:Pontificalibus (contribs, talk) edited Domiphen (diff, hist)
Added links: http://books.google.co.uk/books?id=tWJLUWT06BEC
17:06:24 (3, 2, 4) (EDIT) User:Gene Hobbs (contribs, talk) edited Norpholedrine (diff, hist)
Added links: http://archive.rubicon-foundation.org/8242
17:43:36 (2, 4, 5) (EDIT) User:Perspeculum (contribs, talk) edited Tadalafil (diff, hist)
Changed: 'legal_status' ('prescription only' -> 'rx-only', SET 'prescription only')
18:04:40 (3, 2, 4) (EDIT) User:Pdcook (contribs, talk) edited Fosfomycin (diff, hist)
Added links: http://aac.asm.org/cgi/pmidlookup?view=long&pmid=7492106
18:54:52 (2, 3, 4) (EDIT) User:JÃ¼ (contribs, talk) edited Cathinone (diff, hist)
Changed: 'image' ('Cathinone.svg' -> 'S-Cathinone.svg')
19:16:38 (4, 4, 5) (EDIT) User:173.160.77.245 (contribs, talk) edited Tolmetin (diff, hist)
Changed: 'N' ('0' -> '1', SET '0')
19:29:56 (2, 3, 5) (EDIT) User:Rjwilmsi (contribs, talk) edited Agomelatine (diff, hist)
Changed: 'elimination_half-life' ('< 2 h <ref> hit and run drug</ref>' -> '< 2 h <ref>hit and run drug</ref>')
19:32:20 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tolmetin (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
19:45:57 (2, 4, 5) (EDIT) User:Pdcook (contribs, talk) edited Fosfomycin (diff, hist)
Changed: 'image' ('Fosfomycin skeletal.svg' -> 'FosfomycinImage.svg', SET 'Fosfomycin skeletal.svg')
20:01:23 (3, 2, 4) (EDIT) User:Edgar181 (contribs, talk) edited Mephedrone (diff, hist)
Added links: http://news.bbc.co.uk/1/hi/health/8023451.stm
23:45:33 (3, 2, 4) (EDIT) User:COP2012G05 (contribs, talk) edited Naftifine (diff, hist)
Added links: http://www.accesspharmacy.com/content.aspx?aID=4517208., http://www.thomsonhc.com/hcs/librarian/ND_T/HCS/ND_PR/Main/CS/7ED8A6/DUPLICATIONSHIELDSYNC/89971B/ND_PG/PRIH/ND_B/HCS/SBK/2/ND_P/Main/PFActionId/hcs.common.RetrieveDocumentCommon/DocId/390170/ContentSetId/100/SearchTerm/naftifine/SearchOption/BeginWith#secN10184,, http://www.utdol.com/online/content/topic.do?topicKey=drug_l_z/174337&selectedTitle=1
23:48:29 (3, 2, 4) (EDIT) User:COP2012G05 (contribs, talk) edited Naftifine (diff, hist)
Added links: http://www.accesspharmacy.com/content.aspx?aID=4517257.
23:57:35 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Naftifine (diff, hist)
Added: 'verifiedrevid' ('' -> '276973784', SET '')
23:57:35 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Naftifine (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')
23:59:49 (3, 2, 4) (EDIT) User:COP2012G05 (contribs, talk) edited Naftifine (diff, hist)
Added links: http://www.accesspharmacy.com/drugContentPopup.aspx?mid=6620&section=10,
00:00:25 (3, 2, 4) (EDIT) User:COP2012G06 (contribs, talk) edited Amphotericin_B (diff, hist)
Added links: http://www.utdol.com/online/content/topic.do?topicKey=antibiot/4619&selectedTitle=2
00:00:42 (2, 4, 5) (EDIT) User:Abby 96 (contribs, talk) edited Amitriptyline (diff, hist)
Changed: 'metabolism' ('[[Hepatic]] [[CYP2C19]], [[CYP1A2]], [[CYP2D6]]' -> '[[Hepatic]] [[CYP2C19]], [[CYP1A2]], [[CYP2D6]]', SET '[[Hepatic]] [[CYP2C19]], [[CYP1A2]], [[CYP2D6]]')
00:06:43 (3, 2, 4) (EDIT) User:COP2012G09 (contribs, talk) edited Ravuconazole (diff, hist)
Added links: http://clinicaltrials.gov/ct2/show/NCT00064311?term=ravuconazole&spons_ex=Y&rank=1, http://www.aspergillus.org.uk.
00:06:50 (3, 2, 4) (EDIT) User:90.206.67.7 (contribs, talk) edited Mephedrone (diff, hist)
Added links: http://www.meowrightnow.com
00:16:49 (3, 2, 4) (EDIT) User:COP2012G06 (contribs, talk) edited Amphotericin_B (diff, hist)
Added links: http://www.pfizer.com/files/products/uspi_amphocin.pdf