<- User:Beetstra/listing13 - User:Beetstra/Validation - User:Beetstra/listing15 ->

Data

3251 to 3300

Cyclic_di-GMP (3253)
```
Botcommand: addindex 330947521 Cyclic_di-GMP
```
```
For index : Cyclic_di-GMP=330947521
```
* 61093-23-0 -> 61093-23-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclic+di+GMP not found on commonchemistry - Cyclic+di+GMP

* No ChemSpiderID

* PubChem: 6323195

* No InChI

* SMILES: C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C3NC(=NC4=O)N)O)OP(=O)(OC[C@@H]5[C@H]([C@H]([C@@H](O5)N6C=NC7=C6NC(=NC7=O)N)O)OP(=O)(O1)O)O
Cyclic_pyranopterin_monophosphate (3255)
```
Botcommand: addindex 358644832 Cyclic_pyranopterin_monophosphate
```
```
For index : Cyclic_pyranopterin_monophosphate=358644832
```
* 150829-29-1 -> 150829-29-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclic+pyranopterin+monophosphate not found on commonchemistry - Cyclic+pyranopterin+monophosphate

* No ChemSpiderID

* PubChem: 25202908

* No InChI

* SMILES: O=C(N=C(N)N1)C(N2)=C1NC(O3)C2C(O)(O)C(O4)C3COP4(O)=O
Cycloartenol (3257)
```
Botcommand: addindex 355644800 Cycloartenol
```
```
For index : Cycloartenol=355644800
```
* 469-38-5 -> 469-38-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Cycloartenol not found on commonchemistry - Cycloartenol

* No ChemSpiderID (correct: 16788581)

* PubChem: 92110

* No InChI

* SMILES: CC(CCC=C(C)C)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)O)C)C
Cyclobarbital (3258)
```
Botcommand: addindex 340335703 Cyclobarbital
```
```
For index : Cyclobarbital=340335703
```
* 143-76-0 -> 143-76-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclobarbital not found on commonchemistry - Cyclobarbital

* ChemSpiderID: 5632 (correct: 5632) - CORRECT - Retrieved data from ChemSpider

* PubChem: 5838

* No InChI - (ChemSpider: | InChI=InChI=1/C12H16N2O3/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h6H,2-5,7H2,1H3,(H2,13,14,15,16,17) )

* No SMILES - (ChemSpider: | smiles=O=C1NC(=O)NC(=O)C1(/C2=C/CCCC2)CC )
Cyclobutadiene (3260)
```
Botcommand: addindex 364363172 Cyclobutadiene
```
```
For index : Cyclobutadiene=364363172
```
* 1120-53-2 -> 1120-53-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclobutadiene not found on commonchemistry - Cyclobutadiene

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C1=CC=C1
Cyclobutane (3261)
```
Botcommand: addindex 349664927 Cyclobutane
```
```
For index : Cyclobutane=349664927
```
* 00287-23-0 -> 00287-23-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclobutane found on commonchemistry - Cyclobutane
* 287-23-0 (Formula: C4H8; Name: Cyclobutane)

* 115-25-3 (Formula: C4F8; Name: Cyclobutane, octafluoro-)

* 503-29-7 (Formula: C3H7N; Name: Azetidine)

* 503-30-0 (Formula: C3H6O; Name: Oxetane)

* 41575-94-4 (Formula: C6H12N2O4Pt; Name: Platinum, diammine[1,1-cyclobutanedi(carboxylato-ÎºO)(2-)]-, (SP-4-2)-)

* 106650-56-0 (Formula: C17H26ClN; Name: Cyclobutanemethanamine, 1-(4-chlorophenyl)-N,N-dimethyl-Î±-(2-methylpropyl)-)

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C1CCC1
Cyclobutanetetrone (3262)
```
Botcommand: addindex 353522001 Cyclobutanetetrone
```
```
For index : Cyclobutanetetrone=353522001
```
* 3617-57-0 -> 3617-57-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclobutanetetrone not found on commonchemistry - Cyclobutanetetrone

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cyclobutene (3263)
```
Botcommand: addindex 361043378 Cyclobutene
```
```
For index : Cyclobutene=361043378
```
* 822-35-5 -> 822-35-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclobutene found on commonchemistry - Cyclobutene
* 2892-51-5 (Formula: C4H2O4; Name: 3-Cyclobutene-1,2-dione, 3,4-dihydroxy-)

* 124221-30-3 (Formula: (C24H30OSi2)x; Name: Disiloxane, 1,3-bis(2-bicyclo[4.2.0]octa-1,3,5-trien-3-ylethenyl)-1,1,3,3-tetramethyl-, homopolymer)

* ChemSpiderID: 63164 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 69972

* InChI: 1/C4H6/c1-2-4-3-1/h1-2H,3-4H2 - (ChemSpider: | InChI=InChI=1/C4H6/c1-2-4-3-1/h1-2H,3-4H2 )

* SMILES: C\1=C\CC/1 - (ChemSpider: | SMILES=C\1=C\CC/1 )
Cyclobutyrol (3264)
```
Botcommand: addindex 261897382 Cyclobutyrol
```
```
For index : Cyclobutyrol=261897382
```
* 512-16-3 -> 512-16-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclobutyrol not found on commonchemistry - Cyclobutyrol

* No ChemSpiderID

* PubChem: 72065

* No InChI

* No SMILES
Cyclochlorotine (3265)
```
Botcommand: addindex 356041161 Cyclochlorotine
```
```
For index : Cyclochlorotine=356041161
```
* 12663-46-6 -> 12663-46-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclochlorotine not found on commonchemistry - Cyclochlorotine

* No ChemSpiderID

* PubChem: 25565

* No InChI

* SMILES: O=C([C@H](CO)NC1=O)N[C@@H](C2=CC=CC=C2)CC(N[C@H](C(N3[C@H](C(N[C@H]1CC)=O)[C@H](Cl)[C@H](Cl)C3)=O)CO)=O
Cyclodecane (3266)
```
Botcommand: addindex 340335990 Cyclodecane
```
```
For index : Cyclodecane=340335990
```
* 293-96-9 -> 293-96-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclodecane found on commonchemistry - Cyclodecane
* 2385-85-5 (Formula: C10Cl12; Name: 1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro-)

* 3194-55-6 (Formula: C12H18Br6; Name: Cyclododecane, 1,2,5,6,9,10-hexabromo-)

* ChemSpiderID: 8910 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 9267

* InChI: 1/C10H20/c1-2-4-6-8-10-9-7-5-3-1/h1-10H2 - (ChemSpider: | InChI=InChI=1/C10H20/c1-2-4-6-8-10-9-7-5-3-1/h1-10H2 )

* SMILES: C1CCCCCCCCC1 - (ChemSpider: | SMILES=C1CCCCCCCCC1 )
Cyclodextrin (3267)
```
Botcommand: addindex 351688070 Cyclodextrin
```
```
For index : Cyclodextrin=351688070
```
* 17465-86-0 -> 17465-86-0 - NOT VERIFIED

* CAS found on commonchemistry - 17465-86-0 - name in list
All names: Cavamax 8 Food, Cavamax W 8, Cavamax W 8 Food, Celdex C 100, Celdex G 100, ciclooctapentilosa, Cyclomaltooctaose, Cyclooctaamylose, cyclooctapentylose, Dexy Pearl Î³-100, Rindex C, Ringdex C, [[Stereoisomer of 5,10,15,20,25,30,35,40-octakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29,32,34,37,39-hexadecaoxanonacyclo[36.2.2.23,6.28,11.213,16.218,21.223,26.228,31.233,36]hexapentacontane-41,42,43,44,45,46,47,48,49,50,51,52,53,54,55,56-hexadecol]], Î³-Cyclodextrin, Î³-Cyclodextrine, Î³-Dextrin

* Cyclodextrin found on commonchemistry - Cyclodextrin
* 12619-70-4 (Formula: W99; Name: Cyclodextrin)

* 7585-39-9 (Formula: C42H70O35; Name: Î²-Cyclodextrin)

* 9030-09-5 (Formula: Unspecified; Name: Glycosyltransferase, cyclodextrin)

* 9035-74-9 (Formula: Unspecified; Name: Phosphorylase, glycogen)

* 10016-20-3 (Formula: C36H60O30; Name: Î±-Cyclodextrin)

* 17465-86-0 (Formula: C48H80O40; Name: Î³-Cyclodextrin) Matches CAS (17465-86-0) on page

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cyclododecane (3268)

* No CASNo

* Cyclododecane found on commonchemistry - Cyclododecane
* 294-93-9 (Formula: C8H16O4; Name: 1,4,7,10-Tetraoxacyclododecane)

* 3194-55-6 (Formula: C12H18Br6; Name: Cyclododecane, 1,2,5,6,9,10-hexabromo-)

* 50327-22-5 (Formula: (C10H18N2O2)n; Name: Poly[imino-1,4-butanediylimino(1,6-dioxo-1,6-hexanediyl)])

* 120066-54-8 (Formula: C17H29GdN4O7; Name: Gadolinium, [10-[2-(hydroxy-ÎºO)propyl]-1,4,7,10-tetraazacyclododecane-1,4,7-triacetato(3-)-ÎºN1,ÎºN4,ÎºN7,ÎºN10,ÎºO1,ÎºO4,ÎºO7]-)

* ChemSpiderID: 8911 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C12H24/c1-2-4-6-8-10-12-11-9-7-5-3-1/h1-12H2 - (ChemSpider: | InChI=InChI=1/C12H24/c1-2-4-6-8-10-12-11-9-7-5-3-1/h1-12H2 )

* SMILES: C1CCCCCCCCCCC1 - (ChemSpider: | SMILES=C1CCCCCCCCCCC1 )
Cyclofenil (3269)
```
Botcommand: addindex 356327534 Cyclofenil
```
```
For index : Cyclofenil=356327534
```
* 5189-40-2 -> 5189-40-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclofenil not found on commonchemistry - Cyclofenil

* ChemSpiderID: 2795 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2898

* No InChI - (ChemSpider: | InChI=InChI=1/C23H24O4/c1-16(24)26-21-12-8-19(9-13-21)23(18-6-4-3-5-7-18)20-10-14-22(15-11-20)27-17(2)25/h8-15H,3-7H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=O=C(Oc3ccc(C(/c1ccc(OC(=O)C)cc1)=C2\CCCCC2)cc3)C )
Cycloguanil (3270)
```
Botcommand: addindex 340343514 Cycloguanil
```
```
For index : Cycloguanil=340343514
```
* 516-21-2 -> 516-21-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Cycloguanil not found on commonchemistry - Cycloguanil

* ChemSpiderID: 8697 (correct: 8697) - CORRECT - Retrieved data from ChemSpider

* PubChem: 9049

* No InChI - (ChemSpider: | InChI=InChI=1/C11H14ClN5/c1-11(2)16-9(13)15-10(14)17(11)8-5-3-7(12)4-6-8/h3-6H,1-2H3,(H4,13,14,15,16) )

* No SMILES - (ChemSpider: | smiles=Clc1ccc(cc1)N2C(=N/C(=N\C2(C)C)N)\N )
Cyclohexanehexone (3275)
```
Botcommand: addindex 347501540 Cyclohexanehexone
```
```
For index : Cyclohexanehexone=347501540
```
* 527-31-1 -> 527-31-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclohexanehexone not found on commonchemistry - Cyclohexanehexone

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cyclohexyl_nitrite (3281)
```
Botcommand: addindex 337441674 Cyclohexyl_nitrite
```
```
For index : Cyclohexyl_nitrite=337441674
```
* 5156-40-1 -> 5156-40-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclohexyl+nitrite not found on commonchemistry - Cyclohexyl+nitrite

* No ChemSpiderID

* PubChem: 545140

* No InChI

* No SMILES
Cycloleucine (3283)
```
Botcommand: addindex 359839987 Cycloleucine
```
```
For index : Cycloleucine=359839987
```
* 52-52-8 -> 52-52-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Cycloleucine not found on commonchemistry - Cycloleucine

* No ChemSpiderID

* PubChem: 2901

* No InChI

* SMILES: C1CCC(C1)(C(=O)O)N
Cyclomethycaine (3284)
```
Botcommand: addindex 340343848 Cyclomethycaine
```
```
For index : Cyclomethycaine=340343848
```
* 139-62-8 -> 139-62-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclomethycaine not found on commonchemistry - Cyclomethycaine

* ChemSpiderID: 10382 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 10839

* InChI: 1/C22H33NO3/c1-18-8-5-6-15-23(18)16-7-17-25-22(24)19-11-13-21(14-12-19)26-20-9-3-2-4-10-20/h11-14,18,20H,2-10,15-17H2,1H3 - (ChemSpider: | InChI=InChI=1/C22H33NO3/c1-18-8-5-6-15-23(18)16-7-17-25-22(24)19-11-13-21(14-12-19)26-20-9-3-2-4-10-20/h11-14,18,20H,2-10,15-17H2,1H3 )

* SMILES: O=C(OCCCN1C(CCCC1)C)c3ccc(OC2CCCCC2)cc3 - (ChemSpider: | SMILES=O=C(OCCCN1C(CCCC1)C)c3ccc(OC2CCCCC2)cc3 )
Cyclononane (3285)
```
Botcommand: addindex 354362187 Cyclononane
```
```
For index : Cyclononane=354362187
```
* 293-55-0 -> 293-55-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclononane not found on commonchemistry - Cyclononane

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cyclooctadecanonaene (3286)
```
Botcommand: addindex 363719075 Cyclooctadecanonaene
```
```
For index : Cyclooctadecanonaene=363719075
```
* 2040-73-5 -> 2040-73-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclooctadecanonaene not found on commonchemistry - Cyclooctadecanonaene

* No ChemSpiderID

* No PubChem

* InChI: 1S/C18H18/c1-2-4-6-8-10-12-14-16-18-17-15-13-11-9-7-5-3-1/h1-18H/b2-1-,3-1+,4-2+,5-3+,6-4+,7-5-,8-6-,9-7+,10-8+,11-9+,12-10+,13-11-,14-12-,15-13+,16-14+,17-15+,18-16+,18-17-

* No SMILES
Cyclooctene (3290)
```
Botcommand: addindex 346400592 Cyclooctene
```
```
For index : Cyclooctene=346400592
```
* 931-87-3 -> 931-87-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclooctene found on commonchemistry - Cyclooctene
* 931-88-4 (Formula: C8H14; Name: Cyclooctene)

* 286-62-4 (Formula: C8H14O; Name: 9-Oxabicyclo[6.1.0]nonane)

* ChemSpiderID: 553642 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 638079

* InChI: 1/C8H14/c1-2-4-6-8-7-5-3-1/h1-2H,3-8H2/b2-1- - (ChemSpider: | InChI=InChI=1/C8H14/c1-2-4-6-8-7-5-3-1/h1-2H,3-8H2/b2-1- )

* SMILES: C\1=C\CCCCCC/1 - (ChemSpider: | SMILES=C\1=C\CCCCCC/1 )
Cyclopal (3291)
```
Botcommand: addindex 340344201 Cyclopal
```
```
For index : Cyclopal=340344201
```
* 76-68-6 -> 76-68-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclopal not found on commonchemistry - Cyclopal

* ChemSpiderID: 6212 (correct: 6212) - CORRECT - Retrieved data from ChemSpider

* PubChem: 6454

* No InChI - (ChemSpider: | InChI=InChI=1/C12H14N2O3/c1-2-7-12(8-5-3-4-6-8)9(15)13-11(17)14-10(12)16/h2-3,5,8H,1,4,6-7H2,(H2,13,14,15,16,17) )

* No SMILES - (ChemSpider: | smiles=O=C1NC(=O)NC(=O)C1(C2/C=C\CC2)C\C=C )
Cyclopamine (3292)
```
Botcommand: addindex 359020143 Cyclopamine
```
```
For index : Cyclopamine=359020143
```
* 4449-51-8 -> 4449-51-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclopamine not found on commonchemistry - Cyclopamine

* No ChemSpiderID

* PubChem: 442972

* No InChI

* SMILES: C[C@H]1C[C@@H]2[C@H]([C@H]([C@]3(O2)CC[C@H]4[C@@H]5CC=C6C[C@H](CC[C@@]6([C@H]5CC4=C3C)C)O)C)NC1
Cyclopentadienyl_allyl_palladium (3294)

* No CASNo

* Cyclopentadienyl+allyl+palladium not found on commonchemistry - Cyclopentadienyl+allyl+palladium

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cyclopentadienyl_thallium (3295)
```
Botcommand: addindex 340344384 Cyclopentadienyl_thallium
```
```
For index : Cyclopentadienyl_thallium=340344384
```
* 34822-90-7 -> 34822-90-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclopentadienyl+thallium not found on commonchemistry - Cyclopentadienyl+thallium

* ChemSpiderID: 11271029 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C5H5.Tl/c1-2-4-5-3-1;/h1-3H,4H2;/rC5H5Tl/c6-5-3-1-2-4-5/h1-3H,4H2 - (ChemSpider: | InChI=InChI=1/C5H5.Tl/c1-2-4-5-3-1;/h1-3H,4H2;/rC5H5Tl/c6-5-3-1-2-4-5/h1-3H,4H2 )

* SMILES: [Tl]C=1C\C=C/C=1 - (ChemSpider: | SMILES=[Tl]C=1C\C=C/C=1 )
Cyclopentadienylcobalt_dicarbonyl (3296)

* No CASNo

* Cyclopentadienylcobalt+dicarbonyl not found on commonchemistry - Cyclopentadienylcobalt+dicarbonyl

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cyclopentadienylindium(I) (3297)
```
Botcommand: addindex 297422788 Cyclopentadienylindium(I)
```
```
For index : Cyclopentadienylindium(I)=297422788
```
* 34822-89-4 -> 34822-89-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclopentadienylindium+I not found on commonchemistry - Cyclopentadienylindium+I

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cyclopentadienyliron_dicarbonyl_dimer (3298)
```
Botcommand: addindex 364440907 Cyclopentadienyliron_dicarbonyl_dimer
```
```
For index : Cyclopentadienyliron_dicarbonyl_dimer=364440907
```
* 38117-54-3 -> 38117-54-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclopentadienyliron+dicarbonyl+dimer found on commonchemistry - Cyclopentadienyliron+dicarbonyl+dimer
* 12154-95-9 (exact match)
Name in list

All names: Bis(cyclopentadienyldicarbonyliron), Bis(cyclopentadienyliron dicarbonyl), Bis(dicarbonyl(Î·5-cyclopentadienyl)iron), Bis(dicarbonyl-Ï€-cyclopentadienyliron), Bis(Ï€-cyclopentadienyldicarbonyliron), Bis(Ï€-cyclopentadienylirondicarbonyl), [[Bis[dicarbonyl(Ï€-cyclopentadienyl)iron(II)]]], Cyclopentadienyldicarbonyliron dimer, Cyclopentadienylirondicarbonyl dimer, Dicarbonylcyclopentadienyliron dimer, Dicarbonyl-Ï€-cyclopentadienyliron dimer, Dicyclopentadienyldiiron tetracarbonyl, [[Dicyclopentadienyliron dicarbonyl dimer]], Dicyclopentadienyltetracarbonyldiiron, di-Î¼-carbonildicarbonilbis(Î·5-ciclopenta-2,4-dien-1-il)dihierro, Di-Î¼-carbonyldicarbonylbis(Î·5-cyclopenta-2,4-dien-1-yl)dieisen, di-Î¼-carbonyldicarbonylbis(Î·5-cyclopenta-2,4-dien-1-yl)diiron, di-Î¼-carbonyldicarbonylbis(Î·5-cyclopenta-2,4-diene-1-yl)difer, [[Di-Î¼-carbonyldicarbonylbis[(1,2,3,4,5-Î·)-2,4-cyclopentadien-1-yl]diiron]], Di-Î¼-carbonyldicarbonyldi-Ï€-cyclopentadienyldiiron, Iron, di-Î¼-carbonyldicarbonylbis(Î·5-2,4-cyclopentadien-1-yl)di-, (Fe-Fe), Iron, di-Î¼-carbonyldicarbonyldi-Ï€-cyclopentadienyldi-, (Fe-Fe), Tetracarbonylbis(cyclopentadienyl)diiron, Tetracarbonylbis(Î·5-cyclopentadienyl)diiron

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cyclopentadienylmolybdenum_tricarbonyl_dimer (3299)
```
Botcommand: addindex 284108268 Cyclopentadienylmolybdenum_tricarbonyl_dimer
```
```
For index : Cyclopentadienylmolybdenum_tricarbonyl_dimer=284108268
```
* 12091-64-4 -> 12091-64-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclopentadienylmolybdenum+tricarbonyl+dimer not found on commonchemistry - Cyclopentadienylmolybdenum+tricarbonyl+dimer

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cyclopentamine (3300)
```
Botcommand: addindex 362230181 Cyclopentamine
```
```
For index : Cyclopentamine=362230181
```
* 102-45-4 -> 102-45-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclopentamine not found on commonchemistry - Cyclopentamine

* ChemSpiderID: 7326 (correct: 7326) - CORRECT - Retrieved data from ChemSpider

* PubChem: 7608

* No InChI - (ChemSpider: | InChI=InChI=1/C9H19N/c1-8(10-2)7-9-5-3-4-6-9/h8-10H,3-7H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=N(C)C(CC1CCCC1)C )

3301 to 3350

Cyclopentanepentone (3302)
```
Botcommand: addindex 360048079 Cyclopentanepentone
```
```
For index : Cyclopentanepentone=360048079
```
* 3617-57-0 -> 3617-57-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclopentanepentone not found on commonchemistry - Cyclopentanepentone

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cyclopenthiazide (3307)
```
Botcommand: addindex 344104592 Cyclopenthiazide
```
```
For index : Cyclopenthiazide=344104592
```
* 742-20-1 -> 742-20-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclopenthiazide not found on commonchemistry - Cyclopenthiazide

* No ChemSpiderID

* PubChem: 2904

* No InChI

* No SMILES
Cyclopiazonic_acid (3310)
```
Botcommand: addindex 343681061 Cyclopiazonic_acid
```
```
For index : Cyclopiazonic_acid=343681061
```
* 18172-33-3 -> 18172-33-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclopiazonic+acid not found on commonchemistry - Cyclopiazonic+acid

* ChemSpiderID: 21106432 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 65261

* InChI: 1/C20H20N2O3/c1-9(23)14-18(24)17-16-11-8-21-13-6-4-5-10(15(11)13)7-12(16)20(2,3)22(17)19(14)25/h4-6,8,12,16-17,21,24H,7H2,1-3H3/t12-,16+,17+/m1/s1 - (ChemSpider: | InChI=InChI=1/C20H20N2O3/c1-9(23)14-18(24)17-16-11-8-21-13-6-4-5-10(15(11)13)7-12(16)20(2,3)22(17)19(14)25/h4-6,8,12,16-17,21,24H,7H2,1-3H3/t12-,16+,17+/m1/s1 )

* SMILES: CC(=O)/C1=C(\O)[C@H]5N(C1=O)[C@@](C)(C)[C@@H]4Cc2cccc3ncc(c23)[C@@H]45 - (ChemSpider: | SMILES=CC(=O)/C1=C(\O)[C@H]5N(C1=O)[C@@](C)(C)[C@@H]4Cc2cccc3ncc(c23)[C@@H]45 )
Cycloprop-2-ene_carboxylic_acid (3311)

* No CASNo

* Cycloprop+ene+carboxylic+acid not found on commonchemistry - Cycloprop+ene+carboxylic+acid

* ChemSpiderID: 21782462 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 25241629

* InChI: 1/C4H4O2/c5-4(6)3-1-2-3/h1-3H,(H,5,6) - (ChemSpider: | InChI=InChI=1/C4H4O2/c5-4(6)3-1-2-3/h1-3H,(H,5,6) )

* SMILES: C1=CC1C(=O)O - (ChemSpider: | SMILES=C1=CC1C(=O)O )
Cyclopropanone (3313)
```
Botcommand: addindex 265839781 Cyclopropanone
```
```
For index : Cyclopropanone=265839781
```
* 5009-27-8 -> 5009-27-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclopropanone not found on commonchemistry - Cyclopropanone

* No ChemSpiderID

* PubChem: 138404

* No InChI

* SMILES: C1CC1=O
Cyclopropene (3314)
```
Botcommand: addindex 364960798 Cyclopropene
```
```
For index : Cyclopropene=364960798
```
* 2781-85-3 -> 2781-85-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclopropene not found on commonchemistry - Cyclopropene

* No ChemSpiderID

* PubChem: 123173

* No InChI

* No SMILES
Cyclopropenylidene (3315)
```
Botcommand: addindex 337639585 Cyclopropenylidene
```
```
For index : Cyclopropenylidene=337639585
```
* 16165-40-5 -> 16165-40-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclopropenylidene not found on commonchemistry - Cyclopropenylidene

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C1=C[C]1
Cyclopropylmescaline (3316)
```
Botcommand: addindex 357359836 Cyclopropylmescaline
```
```
For index : Cyclopropylmescaline=357359836
```
* 207740-23-6 -> 207740-23-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclopropylmescaline not found on commonchemistry - Cyclopropylmescaline

* ChemSpiderID: 21106288 (correct: 21106288) - CORRECT - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C14H21NO3/c1-16-12-7-11(5-6-15)8-13(17-2)14(12)18-9-10-3-4-10/h7-8,10H,3-6,9,15H2,1-2H3 - (ChemSpider: | InChI=InChI=1/C14H21NO3/c1-16-12-7-11(5-6-15)8-13(17-2)14(12)18-9-10-3-4-10/h7-8,10H,3-6,9,15H2,1-2H3 )

* SMILES: COc2cc(cc(OC)c2OCC1CC1)CCN - (ChemSpider: | SMILES=COc2cc(cc(OC)c2OCC1CC1)CCN )
Cyclorphan (3317)
```
Botcommand: addindex 343848164 Cyclorphan
```
```
For index : Cyclorphan=343848164
```
* 4163-15-9 -> 4163-15-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyclorphan not found on commonchemistry - Cyclorphan

* ChemSpiderID: 4514407 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 5359966

* No InChI - (ChemSpider: | InChI=InChI=1/C20H27NO/c22-16-7-6-15-11-19-17-3-1-2-8-20(17,18(15)12-16)9-10-21(19)13-14-4-5-14/h6-7,12,14,17,19,22H,1-5,8-11,13H2/t17-,19-,20-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=Oc1ccc4c(c1)[C@@]25[C@H]([C@H](N(CC2)CC3CC3)C4)CCCC5 )
Cyclosarin (3318)

* No CASNo

* Cyclosarin not found on commonchemistry - Cyclosarin

* ChemSpiderID: 58069 (correct: 58069) - CORRECT - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C7H14FO2P/c1-11(8,9)10-7-5-3-2-4-6-7/h7H,2-6H2,1H3 - (ChemSpider: | InChI=InChI=1/C7H14FO2P/c1-11(8,9)10-7-5-3-2-4-6-7/h7H,2-6H2,1H3 )

* SMILES: O=P(F)(OC1CCCCC1)C - (ChemSpider: | SMILES=O=P(F)(OC1CCCCC1)C )
Cycloundecane (3321)
```
Botcommand: addindex 275436582 Cycloundecane
```
```
For index : Cycloundecane=275436582
```
* 294-41-7 -> 294-41-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Cycloundecane not found on commonchemistry - Cycloundecane

* No ChemSpiderID

* PubChem: 136144

* No InChI

* SMILES: C1CCCCCCCCCC1
Cyhalothrin (3323)
```
Botcommand: addindex 352971257 Cyhalothrin
```
```
For index : Cyhalothrin=352971257
```
* 68085-85-8 -> 68085-85-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyhalothrin found on commonchemistry - Cyhalothrin
* 91465-08-6 (exact match)
Name in list

All names: A 1:1 mixture of (S)-Î±-cyano-3-phenoxybenzyl; (Z)-(1R)-cis-3-(2-chloro-3,3,3-trifluoropropenyl)-2,2-dimethylcyclopropanecarboxylate; (R)-Î±-cyano-3-phenoxybenzyl (Z)-(1S)-cis-3-(2-chloro-3,3,3-trifluoropropenyl)-2,2-dimethylcyclopropanecarboxylate, [[Cyclopropanecarboxylic acid, 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethyl-, cyano(3-phenoxyphenyl)methyl ester, [1Î±(S*),3Î±(Z)]-(.+-.)-]], [[Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propen-1-yl]-2,2-dimethyl-, (R)-cyano(3-phenoxyphenyl)methyl ester, (1S,3S)-rel-]], [[Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (1R)-cyano(3-phenoxyphenyl)methyl ester, (1S,3S)-]], [[Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (R)-cyano(3-phenoxyphenyl)methyl ester, (1S,3S)-rel-]], [[cyhalothrin K]], [[cyhalothrin, Î»-]], Demand, Hallmark, ICI-A 0321, Icon, Karate, Karate 1E, Karate K, Karate King, Karate Z, Karate Zeon, Kung Fu, Lambda cialotrina, [[LAMBDA-cyhalothrin]], [[lambda-cyhalothrin]], [[Lambda-cyhalothrin (ISO)]], Matador, Matador (insecticide), NUP 05077, PP 321, Scimitar, Spectracide Trazicide, Spectracide Triazicide Soil & Turf Insect Killer, Taiga Z, UN 2588, Warrior, Warrior T, Warrior Zeon, Warrior-T, [[Î»-cyhalothrin]]

* ChemSpiderID: 4445166 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 5281873

* InChI: 1/C23H19ClF3NO3/c1-22(2)17(12-19(24)23(25,26)27)20(22)21(29)31-18(13-28)14-7-6-10-16(11-14)30-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3/b19-12- - (ChemSpider: | InChI=InChI=1/C23H19ClF3NO3/c1-22(2)17(12-19(24)23(25,26)27)20(22)21(29)31-18(13-28)14-7-6-10-16(11-14)30-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3/b19-12- )

* SMILES: Cl\C(=C/C3C(C(=O)OC(C#N)c2cccc(Oc1ccccc1)c2)C3(C)C)C(F)(F)F - (ChemSpider: | SMILES=Cl\C(=C/C3C(C(=O)OC(C#N)c2cccc(Oc1ccccc1)c2)C3(C)C)C(F)(F)F )
Cylindrospermopsin (3324)
```
Botcommand: addindex 353410433 Cylindrospermopsin
```
```
For index : Cylindrospermopsin=353410433
```
* 143545-90-8 -> 143545-90-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Cylindrospermopsin not found on commonchemistry - Cylindrospermopsin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cymarin (3325)
```
Botcommand: addindex 353057867 Cymarin
```
```
For index : Cymarin=353057867
```
* 508-77-0 -> 508-77-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Cymarin not found on commonchemistry - Cymarin

* No ChemSpiderID

* PubChem: 10504

* No InChI

* No SMILES
Cymarine (3326)
```
Botcommand: addindex 353056871 Cymarine
```
```
For index : Cymarine=353056871
```
* 508-77-0 -> 508-77-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Cymarine not found on commonchemistry - Cymarine

* No ChemSpiderID

* PubChem: 6474106

* No InChI

* SMILES: C[C@@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2CC[C@@]3([C@H]4CC[C@@]5([C@H](CC[C@@]5([C@H]4CC[C@@]3(C2)O)O)C6=CC(=O)OC6)C)C=O)OC)O
Cynaroside (3328)
```
Botcommand: addindex 345931471 Cynaroside
```
```
For index : Cynaroside=345931471
```
* 68321-11-9 -> 68321-11-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Cynaroside found on commonchemistry - Cynaroside
* 5373-11-5 (exact match)
Name in list

All names: 2-(3,4-dihidroxifenil)-7-(Î²-D-glucopiranosiloxi)-5-hidroxi-4H-1-benzopirano-4-ona, 2-(3,4-dihydroxyphenyl)-7-(Î²-D-glucopyrannosyloxy)-5-hydroxy-4H-1-benzopyranne-4-one, 2-(3,4-Dihydroxyphenyl)-7-(Î²-D-glucopyranosyloxy)-5-hydroxy-4H-1-benzopyran-4-on, 2-(3,4-dihydroxyphenyl)-7-(Î²-D-glucopyranosyloxy)-5-hydroxy-4H-1-benzopyran-4-one, 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-7-(Î²-D-glucopyranosyloxy)-5-hydroxy-, 7-Glucoluteolin, 7-Î²-D-Glucosylluteolin, 7-Î²-Glucosylluteolin, Cinaroside, [[cynaroside]], Glucoluteolin, Luteolin 7-glucoside, Luteolin 7-monoglucoside, Luteolin 7-O-glucopyranoside, Luteolin 7-O-glucoside, Luteolin 7-O-monoglucoside, Luteolin 7-O-Î²-D-glucopyranoside, Luteolin 7-O-Î²-D-glucoside, Luteolin 7-O-Î²-glucopyranoside, Luteolin 7-O-Î²-glucoside, Luteolin 7-Î²-D-glucoside, Luteolin 7-Î²-glucoside, Luteolin 7-Î²-monoglucoside, Luteolin, 7-Î²-D-glucopyranoside, Luteolin-7-D-glucopyranoside, Luteoloside, Nephrocizin, Nephrocizine

* No ChemSpiderID

* PubChem: 5280637

* No InChI

* SMILES: C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O)O)O
Cypenamine (3329)
File:Trans-(Â±)-Cypenamine Enantiomers Structural Formulae.png
```
Botcommand: addindex 351528101 Cypenamine
```
```
For index : Cypenamine=351528101
```
* 15301-54-9 -> 15301-54-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Cypenamine not found on commonchemistry - Cypenamine

* ChemSpiderID: 20476 (correct: 20476) - CORRECT - Retrieved data from ChemSpider

* PubChem: 21786

* No InChI - (ChemSpider: | InChI=InChI=1/C11H15N/c12-11-8-4-7-10(11)9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8,12H2 )

* No SMILES - (ChemSpider: | smiles=c1cc(ccc1)C2CCCC2N )
Cyprazepam (3331)
```
Botcommand: addindex 347701391 Cyprazepam
```
```
For index : Cyprazepam=347701391
```
* 15687-07-7 -> 15687-07-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyprazepam not found on commonchemistry - Cyprazepam

* ChemSpiderID: 16736916 (correct: 16736916) - CORRECT - Retrieved data from ChemSpider

* PubChem: 27452

* No InChI - (ChemSpider: | InChI=InChI=1/C19H18ClN3O/c20-15-8-9-17-16(10-15)19(14-4-2-1-3-5-14)23(24)12-18(22-17)21-11-13-6-7-13/h1-5,8-10,13H,6-7,11-12H2,(H,21,22) )

* No SMILES - (ChemSpider: | smiles=Clc1ccc2\N=C(/C[N+](/[O-])=C(\c2c1)c3ccccc3)NCC4CC4 )
Cyprenorphine (3332)
```
Botcommand: addindex 359433092 Cyprenorphine
```
```
For index : Cyprenorphine=359433092
```
* 4406-22-8 -> 4406-22-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyprenorphine not found on commonchemistry - Cyprenorphine

* ChemSpiderID: 16735758 (correct: 16735758) - CORRECT - Retrieved data from ChemSpider

* PubChem: 544534

* No InChI - (ChemSpider: | InChI=InChI=1/C26H33NO4/c1-23(2,29)18-13-24-8-9-26(18,30-3)22-25(24)10-11-27(14-15-4-5-15)19(24)12-16-6-7-17(28)21(31-22)20(16)25/h6-9,15,18-19,22,28-29H,4-5,10-14H2,1-3H3/t18-,19-,22-,24-,25+,26-/m1/s1 )

* No SMILES - (ChemSpider: | smiles=CC(C)(O)[C@H]7C[C@]53/C=C/[C@]7(OC)[C@@H]1Oc6c2c(C[C@H]5N(CC[C@@]123)CC4CC4)ccc6O )
Cyprodenate (3333)
```
Botcommand: addindex 352683397 Cyprodenate
```
```
For index : Cyprodenate=352683397
```
* 15585-86-1 -> 15585-86-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyprodenate not found on commonchemistry - Cyprodenate

* ChemSpiderID: 64892 (correct: 64892) - CORRECT - Retrieved data from ChemSpider

* PubChem: 71875

* No InChI - (ChemSpider: | InChI=InChI=1/C13H25NO2/c1-14(2)10-11-16-13(15)9-8-12-6-4-3-5-7-12/h12H,3-11H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=O=C(OCCN(C)C)CCC1CCCCC1 )
Cyprodime (3334)
```
Botcommand: addindex 343553997 Cyprodime
```
```
For index : Cyprodime=343553997
```
* 118111-54-9 -> 118111-54-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyprodime not found on commonchemistry - Cyprodime

* No ChemSpiderID

* PubChem: 5748293

* No InChI

* No SMILES
Cyromazine (3337)
```
Botcommand: addindex 316301480 Cyromazine
```
```
For index : Cyromazine=316301480
```
* 66215-27-8 -> 66215-27-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Cyromazine not found on commonchemistry - Cyromazine

* No ChemSpiderID

* PubChem: 47866

* No InChI

* SMILES: C1CC1NC2=NC(=NC(=N2)N)N
Cystathionine (3339)
```
Botcommand: addindex 362648464 Cystathionine
```
```
For index : Cystathionine=362648464
```
* 56-88-2 -> 56-88-2 - NOT VERIFIED

* CAS found on commonchemistry - 56-88-2 - name in list
All names: (R)-S-(2-amino-2-carboxietil)-L-homocisteina, (R)-S-(2-Amino-2-carboxyethyl)-L-homocystein, (R)-S-(2-amino-2-carboxyethyl)-L-homocysteine, [[Butanoic acid, 2-amino-4-[(2-amino-2-carboxyethyl)thio]-, [R-(R*,S*)]-]], Cystathionine, Cystathionine, L-, L-(+)-Cystathionine, L-Cystathionine, L-Homocysteine, S-(2-amino-2-carboxyethyl)-, (R)-, [[L-Homocysteine, S-[(2R)-2-amino-2-carboxyethyl]-]]

* Cystathionine found on commonchemistry - Cystathionine
* 56-88-2 (exact match) Matches CAS (56-88-2) on page
Name in list

All names: (R)-S-(2-amino-2-carboxietil)-L-homocisteina, (R)-S-(2-Amino-2-carboxyethyl)-L-homocystein, (R)-S-(2-amino-2-carboxyethyl)-L-homocysteine, [[Butanoic acid, 2-amino-4-[(2-amino-2-carboxyethyl)thio]-, [R-(R*,S*)]-]], [[cystathionine]], [[cystathionine, L-]], [[L-(+)-cystathionine]], [[L-cystathionine]], L-Homocysteine, S-(2-amino-2-carboxyethyl)-, (R)-, [[L-Homocysteine, S-[(2R)-2-amino-2-carboxyethyl]-]]

* ChemSpiderID: 811 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 834

* InChI: 1/C7H14N2O4S/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13) - (ChemSpider: | InChI=InChI=1/C7H14N2O4S/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13) )

* SMILES: OC([C@@H](N)CCSC[C@H](N)C(O)=O)=O - (ChemSpider: | SMILES=O=C(O)C(N)CSCCC(C(=O)O)N )
Cysteine_sulfinic_acid (3343)
```
Botcommand: addindex 364162628 Cysteine_sulfinic_acid
```
```
For index : Cysteine_sulfinic_acid=364162628
```
* 2381-08-0 -> 2381-08-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Cysteine+sulfinic+acid not found on commonchemistry - Cysteine+sulfinic+acid

* No ChemSpiderID

* PubChem: 109

* No InChI

* SMILES: C(C(C(=O)O)N)S(=O)O
Cysteinyldopa (3344)
```
Botcommand: addindex 362092599 Cysteinyldopa
```
```
For index : Cysteinyldopa=362092599
```
* 19641-92-0 -> 19641-92-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Cysteinyldopa not found on commonchemistry - Cysteinyldopa

* ChemSpiderID: 27618 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 29719

* InChI: 1/C12H16N2O6S/c13-6(11(17)18)1-5-2-8(15)10(16)9(3-5)21-4-7(14)12(19)20/h2-3,6-7,15-16H,1,4,13-14H2,(H,17,18)(H,19,20) - (ChemSpider: | InChI=InChI=1/C12H16N2O6S/c13-6(11(17)18)1-5-2-8(15)10(16)9(3-5)21-4-7(14)12(19)20/h2-3,6-7,15-16H,1,4,13-14H2,(H,17,18)(H,19,20) )

* SMILES: O=C(O)C(N)Cc1cc(SCC(C(=O)O)N)c(O)c(O)c1 - (ChemSpider: | SMILES=O=C(O)C(N)Cc1cc(SCC(C(=O)O)N)c(O)c(O)c1 )
Cythioate (3347)
```
Botcommand: addindex 313236646 Cythioate
```
```
For index : Cythioate=313236646
```
* 115-93-5 -> 115-93-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Cythioate not found on commonchemistry - Cythioate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cytidine_diphosphate_glucose (3350)

* No CASNo

* Cytidine+diphosphate+glucose not found on commonchemistry - Cytidine+diphosphate+glucose

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES

3351 to 3400

Cytochalasin_D (3355)
```
Botcommand: addindex 357415516 Cytochalasin_D
```
```
For index : Cytochalasin_D=357415516
```
* 22144-77-0 -> 22144-77-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Cytochalasin+D not found on commonchemistry - Cytochalasin+D

* No ChemSpiderID

* PubChem: 5458428

* No InChI

* SMILES: C[C@H]1C/C=C/[C@H]2[C@@H](C(=C)[C@H]([C@@H]3[C@@]2([C@@H](/C=C/[C@@](C1=O)(C)O)OC(=O)C)C(=O)N[C@H]3CC4=CC=CC=C4)C)O
Cytochalasin_E (3356)
```
Botcommand: addindex 363722351 Cytochalasin_E
```
```
For index : Cytochalasin_E=363722351
```
* 36011-19-5 -> 36011-19-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Cytochalasin+E not found on commonchemistry - Cytochalasin+E

* No ChemSpiderID

* PubChem: 5458385

* No InChI

* SMILES: C[C@H]1C/C=C/[C@H]2[C@H]3[C@](O3)([C@H]([C@@H]4[C@]2(C(=O)N[C@H]4CC5=CC=CC=C5)OC(=O)O/C=C/[C@@](C1=O)(C)O)C)C
D-DOPA (3359)
```
Botcommand: addindex 340533890 D-DOPA
```
```
For index : D-DOPA=340533890
```
* 5796-17-8 -> 5796-17-8 - NOT VERIFIED

* CAS not found on commonchemistry

* D+DOPA not found on commonchemistry - D+DOPA

* ChemSpiderID: 83260 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 92222

* InChI: 1/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/t6-/m1/s1 - (ChemSpider: | InChI=InChI=1/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/t6-/m1/s1 )

* SMILES: O=C(O)[C@H](N)Cc1cc(O)c(O)cc1 - (ChemSpider: | SMILES=O=C(O)[C@H](N)Cc1cc(O)c(O)cc1 )
D-Deprenyl (3360)

* No CASNo

* D+Deprenyl not found on commonchemistry - D+Deprenyl

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
D-Galacturonic_acid (3361)
```
Botcommand: addindex 346551811 D-Galacturonic_acid
```
```
For index : D-Galacturonic_acid=346551811
```
* 685-73-4 -> 685-73-4 - NOT VERIFIED

* CAS found on commonchemistry - 685-73-4 - name in list
All names: acide D-galactopyrannuronique, Acide D-galactopyranuronique, acido D-galactopiranuronico, D-galactopyranuronic acid, D-Galacturonic acid, D-Galaktopyranuronsaure, D-Mannose, O-D-galactopyranuronosyl-, Galacturonic acid, Galacturonic acid, D-, NSC 212542

* D+Galacturonic+acid not found on commonchemistry - D+Galacturonic+acid

* ChemSpiderID: 388354 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 84740

* InChI: 1/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2+,3+,4-,6?/m0/s1 - (ChemSpider: | InChI=InChI=1/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2+,3+,4-,6?/m0/s1 )

* SMILES: O=C(O)[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O - (ChemSpider: | SMILES=O=C(O)[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O )
D-Glucosamine_sulfate_potassium_chloride (3362)
* No CASNo

* D+Glucosamine+sulfate+potassium+chloride not found on commonchemistry - D+Glucosamine+sulfate+potassium+chloride

* ChemSpiderID: 23089056 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* No InChI - (ChemSpider: | InChI=InChI=1/C6H13NO5.ClH.K.H2O4S/c7-3-5(10)4(9)2(1-8)12-6(3)11;;;1-5(2,3)4/h2-6,8-11H,1,7H2;1H;;(H2,1,2,3,4)/q;;+1;/p-1/t2?,3-,4+,5?,6-;;;/m0.../s1 )

* No SMILES - (ChemSpider: | smiles=C(C1C(C(C(C(O1)O)N)O)O)O.OS(=O)(=O)O.Cl[K] )
D-chiro-inositol (3364)
```
Botcommand: addindex 341393638 D-chiro-inositol
```
```
For index : D-chiro-inositol=341393638
```
* 643-12-9 -> 643-12-9 - NOT VERIFIED

* CAS not found on commonchemistry

* D+chiro+inositol not found on commonchemistry - D+chiro+inositol

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
DAA-1097 (3365)
```
Botcommand: addindex 345622789 DAA-1097
```
```
For index : DAA-1097=345622789
```
* 220551-79-1 -> 220551-79-1 - NOT VERIFIED

* CAS not found on commonchemistry

* DAA found on commonchemistry - DAA
* 623-73-4 (Formula: C4H6N2O2; Name: Acetic acid, diazo-, ethyl ester)

* 7631-86-9 (Formula: O2Si; Name: Silica)

* 9000-88-8 (Formula: Unspecified; Name: Oxidase, D-amino acid)

* 26062-79-3 (Formula: (C8H16N.Cl)x; Name: 2-Propen-1-aminium, N,N-dimethyl-N-2-propenyl-, chloride, homopolymer)

* 26590-05-6 (Formula: (C8H16N.C3H5NO.Cl)x; Name: 2-Propen-1-aminium, N,N-dimethyl-N-2-propenyl-, chloride, polymer with 2-propenamide)

* No ChemSpiderID

* PubChem: 9844410

* No InChI

* No SMILES
DAA-1106 (3366)
```
Botcommand: addindex 359774272 DAA-1106
```
```
For index : DAA-1106=359774272
```
* 220551-92-8 -> 220551-92-8 - NOT VERIFIED

* CAS not found on commonchemistry

* DAA found on commonchemistry - DAA
* 623-73-4 (Formula: C4H6N2O2; Name: Acetic acid, diazo-, ethyl ester)

* 7631-86-9 (Formula: O2Si; Name: Silica)

* 9000-88-8 (Formula: Unspecified; Name: Oxidase, D-amino acid)

* 26062-79-3 (Formula: (C8H16N.Cl)x; Name: 2-Propen-1-aminium, N,N-dimethyl-N-2-propenyl-, chloride, homopolymer)

* 26590-05-6 (Formula: (C8H16N.C3H5NO.Cl)x; Name: 2-Propen-1-aminium, N,N-dimethyl-N-2-propenyl-, chloride, polymer with 2-propenamide)

* No ChemSpiderID

* PubChem: 10430788

* No InChI

* No SMILES
DADLE (3368)

* No CASNo

* DADLE not found on commonchemistry - DADLE

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
DALT (3369)
```
Botcommand: addindex 357597934 DALT
```
```
For index : DALT=357597934
```
* ? -> ? - NOT VERIFIED

* The CAS number '?' is not formatted correctly, please repair the contents of the field CASNo or CAS_number

* DALT found on commonchemistry - DALT
* 9003-05-8 (Formula: (C3H5NO)x; Name: 2-Propenamide, homopolymer)

* 102-71-6 (Formula: C6H15NO3; Name: Ethanol, 2,2',2-nitrilotris-)

* 147-14-8 (Formula: C32H16CuN8; Name: Copper, [29H,31H-phthalocyaninato(2-)-ÎºN29,ÎºN30,ÎºN31,ÎºN32]-, (SP-4-1)-)

* 1328-53-6 (Formula: Unspecified; Name: C.I. Pigment Green 7)

* 2379-74-0 (Formula: C18H10Cl2O2S2; Name: Benzo[b]thiophen-3(2H)-one, 6-chloro-2-(6-chloro-4-methyl-3-oxobenzo[b]thien-2(3H)-ylidene)-4-methyl-)

* 7631-86-9 (Formula: O2Si; Name: Silica)

* 9005-49-6 (Formula: W99; Name: Heparin)

* 9041-08-1 (Formula: Unspecified; Name: Heparin, sodium salt)

* 9082-00-2 (Formula: C3H8O3.3(C3H6O.C2H4O)x; Name: Oxirane, methyl-, polymer with oxirane, ether with 1,2,3-propanetriol (3:1))

* 31694-55-0 (Formula: (C2H4O)n(C2H4O)n(C2H4O)nC3H8O3; Name: Poly(oxy-1,2-ethanediyl), Î±,Î±',Î±-1,2,3-propanetriyltris[Ï‰-hydroxy-)

* ChemSpiderID: 21250454 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 24839550

* No InChI - (ChemSpider: | InChI=InChI=1/C16H20N2/c1-3-10-18(11-4-2)12-9-14-13-17-16-8-6-5-7-15(14)16/h3-8,13,17H,1-2,9-12H2 )

* No SMILES - (ChemSpider: | smiles=C=CCN(CC=C)CCc2cnc1ccccc12 )
DAM-57 (3370)

* No CASNo

* DAM found on commonchemistry - DAM
* 57-71-6 (Formula: C4H7NO2; Name: 2,3-Butanedione, monooxime)

* 101-77-9 (Formula: C13H14N2; Name: Benzenamine, 4,4'-methylenebis-)

* 50-48-6 (Formula: C20H23N; Name: 1-Propanamine, 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethyl-)

* 55-56-1 (Formula: C22H30Cl2N10; Name: 2,4,11,13-Tetraazatetradecanediimidamide, N,N-bis(4-chlorophenyl)-3,12-diimino-)

* 55-63-0 (Formula: C3H5N3O9; Name: 1,2,3-Propanetriol, trinitrate)

* 58-32-2 (Formula: C24H40N8O4; Name: Ethanol, 2,2',2,2'-[(4,8-di-1-piperidinylpyrimido[5,4-d]pyrimidine-2,6-diyl)dinitrilo]tetrakis-)

* 59-26-7 (Formula: C10H14N2O; Name: 3-Pyridinecarboxamide, N,N-diethyl-)

* 59-33-6 (Formula: C17H23N3O.C4H4O4; Name: 1,2-Ethanediamine, N-[(4-methoxyphenyl)methyl]-N',N'-dimethyl-N-2-pyridinyl-, (2Z)-2-butenedioate (1:1))

* 59-51-8 (Formula: C5H11NO2S; Name: Methionine)

* 59-66-5 (Formula: C4H6N4O3S2; Name: Acetamide, N-[5-(aminosulfonyl)-1,3,4-thiadiazol-2-yl]-)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
DAMGO (3371)

* No CASNo

* DAMGO not found on commonchemistry - DAMGO

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
DAPI (3372)
```
Botcommand: addindex 361679279 DAPI
```
```
For index : DAPI=361679279
```
* 28718-90-3 -> 28718-90-3 - NOT VERIFIED

* CAS not found on commonchemistry

* DAPI found on commonchemistry - DAPI
* 21829-25-4 (exact match)
Name in list

All names: 1,4-Dihydro-2,6-dimethyl-4-(2-nitrophenyl)-3,5-pyridinedicarboxylic acid dimethyl ester, 2,6-Dimethyl-3,5-dicarbomethoxy-4-(2-nitrophenyl)-1,4-dihydropyridine, 2,6-Dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid dimethyl ester, 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(2-nitrophenyl)-, 3,5-dimethyl ester, 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(2-nitrophenyl)-, dimethyl ester, 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(o-nitrophenyl)-, dimethyl ester, 4-(2'-Nitrophenyl)-2,6-dimethyl-3,5-dicarbomethoxy-1,4-dihydropyridine, 4-(2-Nitrophenyl)-2,6-dimethyl-3,5-dicarbomethoxy-1,4-dihydropyridine, Adalat, Adalat 10, Adalat 20, Adalat 5, Adalat CC, Adalat CR, Adalat Crono, Adalat FT, Adalat GITS, Adalat GITS 30, Adalat LA, Adalat LP, Adalat Oros, Adalat PA, Adalat retard, Adalate, [[Adapine]], Adapress, Alat, Aldipin, Alfadat, Alonix, Alonix S, Alpha-Nifedipine Retard, Angipec, Anifed, Anpine, Apo-Nifed, Aprical, BAY 1040, BAY-a 1040, Bonacid, Calcibloc, Calcigard, Calciguard, Calcilat, Camont, Cardifen, Cardilat, Cardilate, Cardionorm, Chronadalate, Chronadalate LP, Citilat, Coracten, Coral, Cordafen, Cordaflex, Cordalat, Cordicant, Cordilan, Cordipin, Corinfar, Corotrend, Corynphar, Depin, Dignokonstant, Dilafed, Dilcor, Dimethyl 1,4-dihydro-2,6-dimethyl-4-(2-nitrophenyl)-3,5-pyridinedicarboxylate, Dimethyl 4-(o-Nitrophenyl)-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarboxylate, Dipinkor, Duranifin, Ecodipi, Ecodipin, Ecodipin E, Fedcor, Fedcor Retard, Fedipin, Fenamon, Fenamon SR, Fenihidine, Glopir, Hadipine, Hexadilat, Introcar, Kordafen, Macorel, Megalat, Myogard, Nedipin, Nicardia, Nicardia retard, Nifangin, Nifar, Nifdemin, Nifebene, Nifecard, Nifecor, Nifedate, Nifedepat, Nifedicor, NIfedilat, Nifedin, Nifedine, Nifedipin, Nifedipine, Nifedipine retard, nifedipino, Nifedipres, Nifedirex LP, Nifelan, Nifelantern, Nifelat, Nifelat Q, Nifelate, Nifensar XL, Nificard, Nifidine, Nifipen, Niphedipine, Normadil, Novo Nifedin, Nyefax, Nyefax Retard, Orix, Osmo-Adalat, Oxcord, Pidilat, Procardia, Procardia XL, Sepamit, Sepamit R, Slofedipine XL, Tensopin, Tibricol, TN 873R, UV-ENP 349PINA, Vasdalat, Vasdalat Retard, Vasofed, Xinran, Zenusin

* ChemSpiderID: 2848 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2954

* InChI: 1/C16H15N5/c17-15(18)10-3-1-9(2-4-10)13-7-11-5-6-12(16(19)20)8-14(11)21-13/h1-8,21H,(H3,17,18)(H3,19,20) - (ChemSpider: | InChI=InChI=1/C16H15N5/c17-15(18)10-3-1-9(2-4-10)13-7-11-5-6-12(16(19)20)8-14(11)21-13/h1-8,21H,(H3,17,18)(H3,19,20) )

* SMILES: [N@H]=C(N)c3ccc(c2cc1ccc(cc1n2)C(=[N@H])N)cc3 - (ChemSpider: | SMILES=[N@H]=C(N)c3ccc(c2cc1ccc(cc1n2)C(=[N@H])N)cc3 )
DASB (3373)

* No CASNo

* DASB not found on commonchemistry - DASB

* No ChemSpiderID

* PubChem: 656408

* No InChI

* No SMILES
DBDMH (3374)
```
Botcommand: addindex 364580368 DBDMH
```
```
For index : DBDMH=364580368
```
* 77-48-5 -> 77-48-5 - NOT VERIFIED

* CAS not found on commonchemistry

* DBDMH not found on commonchemistry - DBDMH

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
DBL-583 (3375)
File:DBL-583.png

* No CASNo

* DBL not found on commonchemistry - DBL

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
DBNPA (3376)
```
Botcommand: addindex 345020144 DBNPA
```
```
For index : DBNPA=345020144
```
* 10222-01-2 -> 10222-01-2 - NOT VERIFIED

* CAS not found on commonchemistry

* DBNPA not found on commonchemistry - DBNPA

* ChemSpiderID: 23422 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 25059

* InChI: 1/C3H2Br2N2O/c4-3(5,1-6)2(7)8/h(H2,7,8) - (ChemSpider: | InChI=InChI=1/C3H2Br2N2O/c4-3(5,1-6)2(7)8/h(H2,7,8) )

* SMILES: BrC(Br)(C#N)C(=O)N - (ChemSpider: | SMILES=BrC(Br)(C#N)C(=O)N )
DCG-IV (3377)
```
Botcommand: addindex 305730484 DCG-IV
```
```
For index : DCG-IV=305730484
```
* 147782-19-2 -> 147782-19-2 - NOT VERIFIED

* CAS not found on commonchemistry

* DCG+IV not found on commonchemistry - DCG+IV

* No ChemSpiderID

* PubChem: 5310979

* No InChI

* No SMILES
DCKA (3378)
```
Botcommand: addindex 360229372 DCKA
```
```
For index : DCKA=360229372
```
* 131123-76-7 -> 131123-76-7 - NOT VERIFIED

* CAS not found on commonchemistry

* DCKA not found on commonchemistry - DCKA

* No ChemSpiderID

* PubChem: 1779

* No InChI

* SMILES: C1=C(C=C2C(=C1Cl)C(=O)C=C(N2)C(=O)O)Cl
DCPG (3380)

* No CASNo

* DCPG not found on commonchemistry - DCPG

* No ChemSpiderID

* PubChem: 16062593

* No InChI

* No SMILES
DESOXY (3383)
```
Botcommand: addindex 355288576 DESOXY
```
```
For index : DESOXY=355288576
```
* 63037-49-0 -> 63037-49-0 - NOT VERIFIED

* CAS not found on commonchemistry

* DESOXY found on commonchemistry - DESOXY
* 50-89-5 (Formula: C10H14N2O5; Name: Thymidine)

* 54-42-2 (Formula: C9H11IN2O5; Name: Uridine, 2'-deoxy-5-iodo-)

* 56-47-3 (Formula: C23H32O4; Name: Pregn-4-ene-3,20-dione, 21-(acetyloxy)-)

* 59-14-3 (Formula: C9H11BrN2O5; Name: Uridine, 5-bromo-2'-deoxy-)

* 64-85-7 (Formula: C21H30O3; Name: Pregn-4-ene-3,20-dione, 21-hydroxy-)

* 83-44-3 (Formula: C24H40O4; Name: Cholan-24-oic acid, 3,12-dihydroxy-, (3Î±,5Î²,12Î±)-)

* 125-33-7 (Formula: C12H14N2O2; Name: 4,6(1H,5H)-Pyrimidinedione, 5-ethyldihydro-5-phenyl-)

* 128-13-2 (Formula: C24H40O4; Name: Cholan-24-oic acid, 3,7-dihydroxy-, (3Î±,5Î²,7Î²)-)

* 152-58-9 (Formula: C21H30O4; Name: Pregn-4-ene-3,20-dione, 17,21-dihydroxy-)

* 154-17-6 (Formula: C6H12O5; Name: D-arabino-Hexose, 2-deoxy-)

* ChemSpiderID: 21106289 (correct: 21106289) - CORRECT - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C11H17NO2/c1-8-10(13-2)6-9(4-5-12)7-11(8)14-3/h6-7H,4-5,12H2,1-3H3 - (ChemSpider: | InChI=InChI=1/C11H17NO2/c1-8-10(13-2)6-9(4-5-12)7-11(8)14-3/h6-7H,4-5,12H2,1-3H3 )

* SMILES: Cc1c(cc(cc1OC)CCN)OC - (ChemSpider: | SMILES=Cc1c(cc(cc1OC)CCN)OC )
DIMBOA (3384)
* No CASNo

* DIMBOA not found on commonchemistry - DIMBOA

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
DINCH (3385)
```
Botcommand: addindex 337627922 DINCH
```
```
For index : DINCH=337627922
```
* 166412-78-8 -> 166412-78-8 - NOT VERIFIED

* CAS not found on commonchemistry

* DINCH not found on commonchemistry - DINCH

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES:
DIPAMP (3386)
```
Botcommand: addindex 340536987 DIPAMP
```
```
For index : DIPAMP=340536987
```
* 55739-58-7 -> 55739-58-7 - NOT VERIFIED

* CAS not found on commonchemistry

* DIPAMP not found on commonchemistry - DIPAMP

* ChemSpiderID: 9060243 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 10884975

* InChI: 1/C28H28O2P2/c1-29-25-17-9-11-19-27(25)31(23-13-5-3-6-14-23)21-22-32(24-15-7-4-8-16-24)28-20-12-10-18-26(28)30-2/h3-20H,21-22H2,1-2H3/t31-,32-/m1/s1 - (ChemSpider: | InChI=InChI=1/C28H28O2P2/c1-29-25-17-9-11-19-27(25)31(23-13-5-3-6-14-23)21-22-32(24-15-7-4-8-16-24)28-20-12-10-18-26(28)30-2/h3-20H,21-22H2,1-2H3/t31-,32-/m1/s1 )

* SMILES: O(c1ccccc1[P@@](c2ccccc2)CC[P@](c3ccccc3)c4ccccc4OC)C - (ChemSpider: | SMILES=O(c1ccccc1[P@@](c2ccccc2)CC[P@](c3ccccc3)c4ccccc4OC)C )
DL-Phosphinothricin (3387)

* No CASNo

* DL+Phosphinothricin not found on commonchemistry - DL+Phosphinothricin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
DMACA_reagent (3388)
```
Botcommand: addindex 355323054 DMACA_reagent
```
```
For index : DMACA_reagent=355323054
```
* 6203-18-5 -> 6203-18-5 - NOT VERIFIED

* CAS not found on commonchemistry

* DMACA+reagent not found on commonchemistry - DMACA+reagent

* No ChemSpiderID

* PubChem: 5284506

* No InChI

* SMILES: CN(C)C1=CC=C(C=C1)C=CC=O
DMAZ (3389)
```
Botcommand: addindex 271672001 DMAZ
```
```
For index : DMAZ=271672001
```
* 86147-04-8 -> 86147-04-8 - NOT VERIFIED

* CAS not found on commonchemistry

* DMAZ not found on commonchemistry - DMAZ

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CN(C)CCN=[N+]=[N-]
DMCM (3390)
```
Botcommand: addindex 364323812 DMCM
```
```
For index : DMCM=364323812
```
* 82499-00-1 -> 82499-00-1 - NOT VERIFIED

* CAS not found on commonchemistry

* DMCM not found on commonchemistry - DMCM

* No ChemSpiderID

* PubChem: 104999

* No InChI

* SMILES: CCC1=C2C3=CC(=C(C=C3NC2=CN=C1C(=O)OC)OC)OC
DMDM_hydantoin (3391)
```
Botcommand: addindex 352506720 DMDM_hydantoin
```
```
For index : DMDM_hydantoin=352506720
```
* 6440-58-0 -> 6440-58-0 - NOT VERIFIED

* CAS found on commonchemistry - 6440-58-0 - name in list
All names: 1,3-bis(hidroximetil)-5,5-dimetilimidazolidina-2,4-diona, 1,3-Bis(hydroxymethyl)-5,5-dimethyl-2,4-imidazolidinedione, 1,3-Bis(hydroxymethyl)-5,5-dimethylhydantoin, 1,3-Bis(hydroxymethyl)-5,5-dimethylimidazolidin-2,4-dion, 1,3-Bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione, 1,3-DI-(HYDROXYMETHYL)-5,5-DIMETHYLHYDANTOIN, 1,3-Di(hydroxymethyl)-5,5-dimethylhydantoin, 1,3-Dihydroxymethyl-5,5-dimethyl hydantoin, 1,3-Dihydroxymethyl-5,5-dimethylhydantoin, 1,3-Dimethylol-5,5-dimethylhydantoin, 2,4-Imidazolidinedione, 1,3-bis(hydroxymethyl)-5,5-dimethyl-, Dantogard, Dantogard 2000, Dantoin DMDMH 55, Dimethylol-5,5-dimethylhydantoin, DMDM Hydantoin, DMDMH, DMDMH 55, Gidol, Glydant, Glydant XL 1000, Hydantoin, 1,3-bis(hydroxymethyl)-5,5-dimethyl-, HYDANTOIN, 1,3-DIMETHYLOL-5,5-DIMETHYL-, Mackstat DM, N,N'-Dimethylol-5,5-dimethylhydantoin, Nipaguard DMDMH, Surcide DMH

* DMDM+hydantoin found on commonchemistry - DMDM+hydantoin
* 6440-58-0 (exact match) Matches CAS (6440-58-0) on page
Name in list

All names: 1,3-bis(hidroximetil)-5,5-dimetilimidazolidina-2,4-diona, 1,3-Bis(hydroxymethyl)-5,5-dimethyl-2,4-imidazolidinedione, 1,3-Bis(hydroxymethyl)-5,5-dimethylhydantoin, 1,3-Bis(hydroxymethyl)-5,5-dimethylimidazolidin-2,4-dion, 1,3-Bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione, 1,3-DI-(HYDROXYMETHYL)-5,5-DIMETHYLHYDANTOIN, 1,3-Di(hydroxymethyl)-5,5-dimethylhydantoin, 1,3-Dihydroxymethyl-5,5-dimethyl hydantoin, 1,3-Dihydroxymethyl-5,5-dimethylhydantoin, 1,3-Dimethylol-5,5-dimethylhydantoin, 2,4-Imidazolidinedione, 1,3-bis(hydroxymethyl)-5,5-dimethyl-, Dantogard, Dantogard 2000, Dantoin DMDMH 55, Dimethylol-5,5-dimethylhydantoin, [[dmdm hydantoin]], DMDMH, DMDMH 55, Gidol, Glydant, Glydant XL 1000, Hydantoin, 1,3-bis(hydroxymethyl)-5,5-dimethyl-, HYDANTOIN, 1,3-DIMETHYLOL-5,5-DIMETHYL-, Mackstat DM, N,N'-Dimethylol-5,5-dimethylhydantoin, Nipaguard DMDMH, Surcide DMH

* ChemSpiderID: 21482 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 22947

* InChI: 1/C7H12N2O4/c1-7(2)5(12)8(3-10)6(13)9(7)4-11/h10-11H,3-4H2,1-2H3 - (ChemSpider: | InChI=InChI=1/C7H12N2O4/c1-7(2)5(12)8(3-10)6(13)9(7)4-11/h10-11H,3-4H2,1-2H3 )

* SMILES: O=C1N(C(=O)C(N1CO)(C)C)CO - (ChemSpider: | SMILES=O=C1N(C(=O)C(N1CO)(C)C)CO )
DMDNB (3392)
```
Botcommand: addindex 347606874 DMDNB
```
```
For index : DMDNB=347606874
```
* 3964-18-9 -> 3964-18-9 - NOT VERIFIED

* CAS not found on commonchemistry

* DMDNB not found on commonchemistry - DMDNB

* ChemSpiderID: 69982 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 77577

* InChI: 1/C6H12N2O4/c1-5(2,7(9)10)6(3,4)8(11)12/h1-4H3 - (ChemSpider: | InChI=InChI=1/C6H12N2O4/c1-5(2,7(9)10)6(3,4)8(11)12/h1-4H3 )

* SMILES: CC(C)(C(C)(C)[N+](=O)[O-])[N+](=O)[O-] - (ChemSpider: | SMILES=CC(C)(C(C)(C)[N+](=O)[O-])[N+](=O)[O-] )
DME_(psychedelic) (3393)
```
Botcommand: addindex 356425726 DME_(psychedelic)
```
```
For index : DME_(psychedelic)=356425726
```
* 6924-15-8 -> 6924-15-8 - NOT VERIFIED

* CAS not found on commonchemistry

* DME+psychedelic not found on commonchemistry - DME+psychedelic

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: COc1cc(ccc1OC)C(O)CN
DMMDA (3394)
```
Botcommand: addindex 346970958 DMMDA
```
```
For index : DMMDA=346970958
```
* 15183-13-8 -> 15183-13-8 - NOT VERIFIED

* CAS not found on commonchemistry

* DMMDA not found on commonchemistry - DMMDA

* ChemSpiderID: 21106291 (correct: 21106291) - CORRECT - Retrieved data from ChemSpider

* No PubChem

* No InChI - (ChemSpider: | InChI=InChI=1/C12H17NO4/c1-7(13)4-8-5-9(14-2)11-12(10(8)15-3)17-6-16-11/h5,7H,4,6,13H2,1-3H3 )

* No SMILES - (ChemSpider: | smiles=CC(N)Cc1cc(OC)c2OCOc2c1OC )
DMPU (3395)
```
Botcommand: addindex 265858321 DMPU
```
```
For index : DMPU=265858321
```
* 7226-23-5 -> 7226-23-5 - NOT VERIFIED

* CAS not found on commonchemistry

* DMPU not found on commonchemistry - DMPU

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C1N(C)CCCN1C
DMeOB (3396)
```
Botcommand: addindex 288009226 DMeOB
```
```
For index : DMeOB=288009226
```
* 40252-74-2 -> 40252-74-2 - NOT VERIFIED

* CAS not found on commonchemistry

* DMeOB not found on commonchemistry - DMeOB

* No ChemSpiderID

* PubChem: 6891506

* No InChI

* No SMILES
DNQX (3397)
```
Botcommand: addindex 346850097 DNQX
```
```
For index : DNQX=346850097
```
* 2379-57-9 -> 2379-57-9 - NOT VERIFIED

* CAS not found on commonchemistry

* DNQX not found on commonchemistry - DNQX

* ChemSpiderID: 3028 (correct: 3028) - CORRECT - Retrieved data from ChemSpider

* PubChem: 3140

* InChI: 1/C8H2N4O6/c13-7-8(14)10-4-2-6(12(17)18)5(11(15)16)1-3(4)9-7/h1-2H - (ChemSpider: | InChI=InChI=1/C8H2N4O6/c13-7-8(14)10-4-2-6(12(17)18)5(11(15)16)1-3(4)9-7/h1-2H )

* SMILES: [O-][N+](=O)C=2\C(=C/C1=N/C(=O)C(=O)/N=C1C=2)[N+]([O-])=O - (ChemSpider: | SMILES=[O-][N+](=O)C=2\C(=C/C1=N/C(=O)C(=O)/N=C1C=2)[N+]([O-])=O )
DOTA_(chelate) (3398)

* No CASNo

* DOTA+chelate not found on commonchemistry - DOTA+chelate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
DOV-102,677 (3399)

* No CASNo

* DOV found on commonchemistry - DOV
* 50-35-1 (Formula: C13H10N2O4; Name: 1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)-)

* 61-25-6 (Formula: C20H21NO4.ClH; Name: Isoquinoline, 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-, hydrochloride)

* 101-02-0 (Formula: C18H15O3P; Name: Phosphorous acid, triphenyl ester)

* 372-75-8 (Formula: C6H13N3O3; Name: L-Ornithine, N5-(aminocarbonyl)-)

* 439-14-5 (Formula: C16H13ClN2O; Name: 2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-1-methyl-5-phenyl-)

* 6683-19-8 (Formula: C73H108O12; Name: Benzenepropanoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, 2,2-bis[[3-[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]-1-oxopropoxy]methyl]-1,3-propanediyl ester)

* 9002-86-2 (Formula: (C2H3Cl)x; Name: Ethene, chloro-, homopolymer)

* 9002-89-5 (Formula: (C2H4O)x; Name: Ethenol, homopolymer)

* 25655-41-8 (Formula: (C6H9NO)x.xI2; Name: 2-Pyrrolidinone, 1-ethenyl-, homopolymer, compd. with iodine)

* 26523-78-4 (Formula: C45H69O3P; Name: Phenol, nonyl-, phosphite (3:1))

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
DOV-21,947 (3400)

* No CASNo

* DOV found on commonchemistry - DOV
* 50-35-1 (Formula: C13H10N2O4; Name: 1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)-)

* 61-25-6 (Formula: C20H21NO4.ClH; Name: Isoquinoline, 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-, hydrochloride)

* 101-02-0 (Formula: C18H15O3P; Name: Phosphorous acid, triphenyl ester)

* 372-75-8 (Formula: C6H13N3O3; Name: L-Ornithine, N5-(aminocarbonyl)-)

* 439-14-5 (Formula: C16H13ClN2O; Name: 2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-1-methyl-5-phenyl-)

* 6683-19-8 (Formula: C73H108O12; Name: Benzenepropanoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, 2,2-bis[[3-[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]-1-oxopropoxy]methyl]-1,3-propanediyl ester)

* 9002-86-2 (Formula: (C2H3Cl)x; Name: Ethene, chloro-, homopolymer)

* 9002-89-5 (Formula: (C2H4O)x; Name: Ethenol, homopolymer)

* 25655-41-8 (Formula: (C6H9NO)x.xI2; Name: 2-Pyrrolidinone, 1-ethenyl-, homopolymer, compd. with iodine)

* 26523-78-4 (Formula: C45H69O3P; Name: Phenol, nonyl-, phosphite (3:1))

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES

3401 to 3450

DOV-216,303 (3401)

* No CASNo

* DOV found on commonchemistry - DOV
* 50-35-1 (Formula: C13H10N2O4; Name: 1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)-)

* 61-25-6 (Formula: C20H21NO4.ClH; Name: Isoquinoline, 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-, hydrochloride)

* 101-02-0 (Formula: C18H15O3P; Name: Phosphorous acid, triphenyl ester)

* 372-75-8 (Formula: C6H13N3O3; Name: L-Ornithine, N5-(aminocarbonyl)-)

* 439-14-5 (Formula: C16H13ClN2O; Name: 2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-1-methyl-5-phenyl-)

* 6683-19-8 (Formula: C73H108O12; Name: Benzenepropanoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, 2,2-bis[[3-[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]-1-oxopropoxy]methyl]-1,3-propanediyl ester)

* 9002-86-2 (Formula: (C2H3Cl)x; Name: Ethene, chloro-, homopolymer)

* 9002-89-5 (Formula: (C2H4O)x; Name: Ethenol, homopolymer)

* 25655-41-8 (Formula: (C6H9NO)x.xI2; Name: 2-Pyrrolidinone, 1-ethenyl-, homopolymer, compd. with iodine)

* 26523-78-4 (Formula: C45H69O3P; Name: Phenol, nonyl-, phosphite (3:1))

* No ChemSpiderID

* PubChem: 9795276

* No InChI

* No SMILES
DPI-221 (3402)

* No CASNo

* DPI found on commonchemistry - DPI
* 956-48-9 (Formula: C12H7Cl2NO2; Name: 2,5-Cyclohexadien-1-one, 2,6-dichloro-4-[(4-hydroxyphenyl)imino]-)

* 12173-47-6 (Formula: Unspecified; Name: Hectorite, ((Mg2.67Li0.33)Si4Na0.33[F0.5-1(OH)0-0.5]2O10))

* No ChemSpiderID

* PubChem: 9891642

* No InChI

* No SMILES
DPI-287 (3403)

* No CASNo

* DPI found on commonchemistry - DPI
* 956-48-9 (Formula: C12H7Cl2NO2; Name: 2,5-Cyclohexadien-1-one, 2,6-dichloro-4-[(4-hydroxyphenyl)imino]-)

* 12173-47-6 (Formula: Unspecified; Name: Hectorite, ((Mg2.67Li0.33)Si4Na0.33[F0.5-1(OH)0-0.5]2O10))

* No ChemSpiderID

* PubChem: 21025820

* No InChI

* No SMILES
DPI-3290 (3404)

* No CASNo

* DPI found on commonchemistry - DPI
* 956-48-9 (Formula: C12H7Cl2NO2; Name: 2,5-Cyclohexadien-1-one, 2,6-dichloro-4-[(4-hydroxyphenyl)imino]-)

* 12173-47-6 (Formula: Unspecified; Name: Hectorite, ((Mg2.67Li0.33)Si4Na0.33[F0.5-1(OH)0-0.5]2O10))

* No ChemSpiderID

* PubChem: 5242141

* No InChI

* No SMILES
DPPH (3405)
```
Botcommand: addindex 362420043 DPPH
```
```
For index : DPPH=362420043
```
* 1898-66-4 -> 1898-66-4 - NOT VERIFIED

* CAS found on commonchemistry - 1898-66-4 - name in list
All names: 1,1-Diphenyl-2-picrylhydrazyl radical, 2,2-difenil-1-picrilhidrazil, 2,2-diphenyl-1-picrylhydrazyl, 2,2-Diphenyl-1-picrylhydrazyle, 2,2-Diphenylpicrylhydrazyl, Diphenylpicrylhydrazyl, DPPH, Hydrazinyl, 2,2-diphenyl-1-(2,4,6-trinitrophenyl)-, Hydrazyl, 2,2-diphenyl-1-(2,4,6-trinitrophenyl)-, Hydrazyl, 2,2-diphenyl-1-picryl-, N,N-Diphenyl-N'-picrylhydrazyl

* DPPH found on commonchemistry - DPPH
* 1898-66-4 (exact match) Matches CAS (1898-66-4) on page
Name in list

All names: 1,1-Diphenyl-2-picrylhydrazyl radical, 2,2-difenil-1-picrilhidrazil, 2,2-diphenyl-1-picrylhydrazyl, 2,2-Diphenyl-1-picrylhydrazyle, 2,2-Diphenylpicrylhydrazyl, Diphenylpicrylhydrazyl, [[dpph]], Hydrazinyl, 2,2-diphenyl-1-(2,4,6-trinitrophenyl)-, Hydrazyl, 2,2-diphenyl-1-(2,4,6-trinitrophenyl)-, Hydrazyl, 2,2-diphenyl-1-picryl-, N,N-Diphenyl-N'-picrylhydrazyl

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
DS-1_(drug) (3406)
```
Botcommand: addindex 309963594 DS-1_(drug)
```
```
For index : DS-1_(drug)=309963594
```
* 372497-52-4 -> 372497-52-4 - NOT VERIFIED

* CAS not found on commonchemistry

* DS+drug not found on commonchemistry - DS+drug

* No ChemSpiderID

* PubChem: 979735

* No InChI

* No SMILES
DSS_(NMR_standard) (3407)
```
Botcommand: addindex 359863813 DSS_(NMR_standard)
```
```
For index : DSS_(NMR_standard)=359863813
```
* 18173-90-5 -> 18173-90-5 - NOT VERIFIED

* CAS not found on commonchemistry

* DSS+NMR+standard not found on commonchemistry - DSS+NMR+standard

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C[Si](C)(C)CCCS(=O)(=O)O
DUAC (3409)
* No CASNo

* DUAC not found on commonchemistry - DUAC

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dabigatran (3410)
```
Botcommand: addindex 363063595 Dabigatran
```
```
For index : Dabigatran=363063595
```
* 211915-06-9 -> 211915-06-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dabigatran not found on commonchemistry - Dabigatran

* ChemSpiderID: 4948999 (correct: 4948999) - CORRECT - Retrieved data from ChemSpider

* PubChem: 6445226

* No InChI - (ChemSpider: | InChI=InChI=1/C34H41N7O5/c1-4-6-7-10-21-46-34(44)39-32(35)24-12-15-26(16-13-24)37-23-30-38-27-22-25(14-17-28(27)40(30)3)33(43)41(20-18-31(42)45-5-2)29-11-8-9-19-36-29/h8-9,11-17,19,22,37H,4-7,10,18,20-21,23H2,1-3H3,(H2,35,39,44) )

* No SMILES - (ChemSpider: | smiles=O=C(OCC)CCN(c1ncccc1)C(=O)c4ccc2c(nc(n2C)CNc3ccc(C(=N\C(=O)OCCCCCC)\N)cc3)c4 )
Dacemazine (3412)
```
Botcommand: addindex 347453816 Dacemazine
```
```
For index : Dacemazine=347453816
```
* 518-61-6 -> 518-61-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dacemazine not found on commonchemistry - Dacemazine

* ChemSpiderID: 62079 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 68846

* No InChI - (ChemSpider: | InChI=InChI=1/C16H16N2OS/c1-17(2)11-16(19)18-12-7-3-5-9-14(12)20-15-10-6-4-8-13(15)18/h3-10H,11H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=O=C(N1c3c(Sc2c1cccc2)cccc3)CN(C)C )
Dacetuzumab (3413)
```
Botcommand: addindex 349288819 Dacetuzumab
```
```
For index : Dacetuzumab=349288819
```
* 880486-59-9 -> 880486-59-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dacetuzumab not found on commonchemistry - Dacetuzumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Daclizumab (3414)
```
Botcommand: addindex 349292395 Daclizumab
```
```
For index : Daclizumab=349292395
```
* 152923-56-3 -> 152923-56-3 - NOT VERIFIED

* CAS found on commonchemistry - 152923-56-3 - name not in list
All names: Immunoglobulin G1, anti-(human interleukin 2 receptor) (human-mouse monoclonal clone 1H4 Î³1-chain), disulfide with human-mouse monoclonal clone 1H4 light chain, dimer

* Daclizumab not found on commonchemistry - Daclizumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Daigremontianin (3417)
```
Botcommand: addindex 364255679 Daigremontianin
```
```
For index : Daigremontianin=364255679
```
* 98205-50-6 -> 98205-50-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Daigremontianin not found on commonchemistry - Daigremontianin

* No ChemSpiderID (correct: 112839)

* No PubChem

* No InChI

* SMILES: C[C@@]12[C@@](CC[C@@H]2C(C=C3)=COC3=O)(O)[C@]4([H])CC[C@]5(OC6(C)O7)C[C@@H]7C[C@@H](O6)[C@]5(C=O)[C@@]4([H])[C@H](O)C1=O
Dalbavancin (3418)
```
Botcommand: addindex 334307020 Dalbavancin
```
```
For index : Dalbavancin=334307020
```
* 171500-79-1 -> 171500-79-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Dalbavancin not found on commonchemistry - Dalbavancin

* No ChemSpiderID

* PubChem: 16134410

* No InChI

* No SMILES
Dalbergichromene (3419)
```
Botcommand: addindex 350749973 Dalbergichromene
```
```
For index : Dalbergichromene=350749973
```
* 32066-31-2 -> 32066-31-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dalbergichromene not found on commonchemistry - Dalbergichromene

* No ChemSpiderID

* PubChem: 5316291

* No InChI

* SMILES: COC1=C(C=C2C(=CCOC2=C1)C3=CC=CC=C3)O
Dalfopristin (3420)
* No CASNo

* Dalfopristin not found on commonchemistry - Dalfopristin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Damascone (3422)
```
Botcommand: addindex 361977902 Damascone
```
```
For index : Damascone=361977902
```
* 23726-91-2 -> 23726-91-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Damascone found on commonchemistry - Damascone
* 23726-93-4 (exact match)
Name in list

All names: (E)-1-(2,6,6-Trimethyl-1,3-cyclohexadien-1-yl)-2-buten-1-on, (E)-1-(2,6,6-Trimethyl-1,3-cyclohexadien-1-yl)-2-buten-1-one, (E)-1-(2,6,6-trimethyl-1,3-cyclohexadiene-1-yl)-2-butene-1-one, (E)-1-(2,6,6-Trimethyl-1,3-cyclohexandien-1-yl)-2-buten-1-one, (E)-1-(2,6,6-trimetil-1,3-ciclohexadien-1-il)-2-buten-1-ona, (E)-Damascenone, (E)-Î²-Damascenone, 2,6,6-Trimethyl-1-trans-crotonoyl-1,3-cyclohexadiene, 2-Buten-1-one, 1-(2,6,6-trimethyl-1,3-cyclohexadien-1-yl)-, (2E)-, 2-Buten-1-one, 1-(2,6,6-trimethyl-1,3-cyclohexadien-1-yl)-, (E), 2-Buten-1-one, 1-(2,6,6-trimethyl-1,3-cyclohexadien-1-yl)-, (E)-, 2-Butene-1-one,1-(2,6,6,-trimethyl-1,3-cyclohexadien-1-yl)-,(E)- Î²-Damascenone, DAMASCENONE, Damascenone, trans-, trans-2,6,6-Trimethyl-1-(2-butenoyl)cyclohexa-1,3-diene, trans-2,6,6-Trimethyl-1-crotonylcyclohexa-1,3-diene, trans-Damascenone, trans-Î²-Damascenone, Î²-Damascenone, [[Î²-damascone]]

* No ChemSpiderID

* PubChem: 5374527

* No InChI

* SMILES: CC=CC(=O)C1=C(CCCC1(C)C)C
Dammarane (3424)

* No CASNo

* Dammarane not found on commonchemistry - Dammarane

* No ChemSpiderID

* PubChem: 9548714

* No InChI

* SMILES: C[C@H](CCCC(C)C)[C@H]1CC[C@@]2([C@@H]1CC[C@H]3[C@]2(CC[C@@H]4[C@@]3(CCCC4(C)C)C)C)C
Danaparoid (3425)
* No CASNo

* Danaparoid not found on commonchemistry - Danaparoid

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Danofloxacin (3428)
```
Botcommand: addindex 355717333 Danofloxacin
```
```
For index : Danofloxacin=355717333
```
* 112398-08-0 -> 112398-08-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Danofloxacin not found on commonchemistry - Danofloxacin

* No ChemSpiderID

* PubChem: 71335

* No InChI

* No SMILES
Dansyl_amide (3429)

* No CASNo

* Dansyl+amide not found on commonchemistry - Dansyl+amide

* No ChemSpiderID

* PubChem: 65077

* No InChI

* SMILES: CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)N
Dapagliflozin (3432)
```
Botcommand: addindex 349443335 Dapagliflozin
```
```
For index : Dapagliflozin=349443335
```
* 461432-26-8 -> 461432-26-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Dapagliflozin not found on commonchemistry - Dapagliflozin

* ChemSpiderID: 8063384 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 9887712

* No InChI - (ChemSpider: | InChI=InChI=1/C21H25ClO6/c1-2-27-15-6-3-12(4-7-15)9-14-10-13(5-8-16(14)22)21-20(26)19(25)18(24)17(11-23)28-21/h3-8,10,17-21,23-26H,2,9,11H2,1H3/t17-,18-,19+,20-,21+/m1/s1 )

* No SMILES - (ChemSpider: | smiles=Clc1ccc(cc1Cc2ccc(OCC)cc2)[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O )
Dapoxetine (3434)
```
Botcommand: addindex 364726604 Dapoxetine
```
```
For index : Dapoxetine=364726604
```
* 119356-77-3 -> 119356-77-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Dapoxetine not found on commonchemistry - Dapoxetine

* ChemSpiderID: 64453 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 71353

* No InChI - (ChemSpider: | InChI=InChI=1/C21H23NO/c1-22(2)20(18-10-4-3-5-11-18)15-16-23-21-14-8-12-17-9-6-7-13-19(17)21/h3-14,20H,15-16H2,1-2H3/t20-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=O(c2cccc1ccccc12)CC[C@@H](c3ccccc3)N(C)C )
Daptomycin (3436)
```
Botcommand: addindex 358488123 Daptomycin
```
```
For index : Daptomycin=358488123
```
* 103060-53-3 -> 103060-53-3 - NOT VERIFIED

* CAS found on commonchemistry - 103060-53-3 - name in list
All names: Benzenebutanoic acid, N-(1-oxodecyl)-L-tryptophyl-D-asparaginyl-L-Î±-aspartyl-L-threonylglycyl-L-ornithyl-L-Î±-aspartyl-D-alanyl-L-Î±-aspartylglycyl-D-seryl-(3R)-3-methyl-L-Î±-glutamyl-Î±,2-diamino-Î³-oxo-, (13â†’4)-lactone, (Î±S)-, Cidecin, Cubicin, Dapcin, Daptomicina, Daptomycin, Daptomycine, Daptomycinum, Deptomycin, LY 146032, N-(1-Oxodecyl)-L-tryptophyl-D-asparaginyl-L-Î±-aspartyl-L-threonylglycyl-L-ornithyl-L-Î±-aspartyl-D-alanyl-L-Î±-aspartylglycyl-D-seryl-(3R)-3-methyl-L-Î±-glutamyl-(Î±S)-Î±,2-diamino-Î³-oxobenzenebutanoic acid (13â†’4)-lactone

* Daptomycin found on commonchemistry - Daptomycin
* 103060-53-3 (exact match) Matches CAS (103060-53-3) on page
Name in list

All names: Benzenebutanoic acid, N-(1-oxodecyl)-L-tryptophyl-D-asparaginyl-L-Î±-aspartyl-L-threonylglycyl-L-ornithyl-L-Î±-aspartyl-D-alanyl-L-Î±-aspartylglycyl-D-seryl-(3R)-3-methyl-L-Î±-glutamyl-Î±,2-diamino-Î³-oxo-, (13â†’4)-lactone, (Î±S)-, Cidecin, Cubicin, Dapcin, Daptomicina, [[daptomycin]], [[daptomycine]], [[daptomycinum]], Deptomycin, LY 146032, N-(1-Oxodecyl)-L-tryptophyl-D-asparaginyl-L-Î±-aspartyl-L-threonylglycyl-L-ornithyl-L-Î±-aspartyl-D-alanyl-L-Î±-aspartylglycyl-D-seryl-(3R)-3-methyl-L-Î±-glutamyl-(Î±S)-Î±,2-diamino-Î³-oxobenzenebutanoic acid (13â†’4)-lactone

* No ChemSpiderID (correct: 10482098)

* PubChem: 16129629

* No InChI

* No SMILES
Darapladib (3437)
* No CASNo

* Darapladib not found on commonchemistry - Darapladib

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Darbepoetin_alfa (3438)
```
Botcommand: addindex 359719418 Darbepoetin_alfa
```
```
For index : Darbepoetin_alfa=359719418
```
* 11096-26-7 -> 11096-26-7 - NOT VERIFIED

* CAS found on commonchemistry - 11096-26-7 - name not in list
All names: 5: PN: WO2006126066 FIGURE: 8 claimed sequence, Ep, EPO, Epoetin, Epogis S, eritropoyetina, Erythropoietin, erythropoietine, Erytrostim, Heberitro, Hemax, Hempoietine

* Darbepoetin+alfa not found on commonchemistry - Darbepoetin+alfa

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Darglitazone (3439)
```
Botcommand: addindex 360331496 Darglitazone
```
```
For index : Darglitazone=360331496
```
* 141200-24-0 -> 141200-24-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Darglitazone not found on commonchemistry - Darglitazone

* No ChemSpiderID

* PubChem: 60870

* No InChI

* No SMILES
Darodipine (3441)
```
Botcommand: addindex 346449168 Darodipine
```
```
For index : Darodipine=346449168
```
* 72803-02-2 -> 72803-02-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Darodipine not found on commonchemistry - Darodipine

* ChemSpiderID: 46790 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 51701

* InChI: 1/C19H21N3O5/c1-5-25-18(23)14-10(3)20-11(4)15(19(24)26-6-2)16(14)12-8-7-9-13-17(12)22-27-21-13/h7-9,16,20H,5-6H2,1-4H3 - (ChemSpider: | InChI=InChI=1/C19H21N3O5/c1-5-25-18(23)14-10(3)20-11(4)15(19(24)26-6-2)16(14)12-8-7-9-13-17(12)22-27-21-13/h7-9,16,20H,5-6H2,1-4H3 )

* SMILES: O=C(OCC)\C3=C(\N\C(=C(\C(=O)OCC)C3c1cccc2nonc12)C)C - (ChemSpider: | SMILES=O=C(OCC)\C3=C(\N\C(=C(\C(=O)OCC)C3c1cccc2nonc12)C)C )
Darusentan (3443)
```
Botcommand: addindex 293518785 Darusentan
```
```
For index : Darusentan=293518785
```
* 171714-84-4 -> 171714-84-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Darusentan not found on commonchemistry - Darusentan

* No ChemSpiderID

* PubChem: 177236

* No InChI

* No SMILES
Dasatinib (3444)
* No CASNo

* Dasatinib not found on commonchemistry - Dasatinib

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Daunosamine (3446)
```
Botcommand: addindex 318058055 Daunosamine
```
```
For index : Daunosamine=318058055
```
* 26548-47-0 -> 26548-47-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Daunosamine not found on commonchemistry - Daunosamine

* No ChemSpiderID

* PubChem: 160128

* No InChI

* SMILES: C[C@@H]([C@H]([C@H](CC=O)N)O)O
Dauricine (3447)
```
Botcommand: addindex 346449219 Dauricine
```
```
For index : Dauricine=346449219
```
* 524-17-4 -> 524-17-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Dauricine not found on commonchemistry - Dauricine

* ChemSpiderID: 66117 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 73400

* InChI: 1/C38H44N2O6/c1-39-15-13-26-20-35(42-3)37(44-5)22-29(26)31(39)17-24-7-10-28(11-8-24)46-34-19-25(9-12-33(34)41)18-32-30-23-38(45-6)36(43-4)21-27(30)14-16-40(32)2/h7-12,19-23,31-32,41H,13-18H2,1-6H3/t31-,32-/m1/s1 - (ChemSpider: | InChI=InChI=1/C38H44N2O6/c1-39-15-13-26-20-35(42-3)37(44-5)22-29(26)31(39)17-24-7-10-28(11-8-24)46-34-19-25(9-12-33(34)41)18-32-30-23-38(45-6)36(43-4)21-27(30)14-16-40(32)2/h7-12,19-23,31-32,41H,13-18H2,1-6H3/t31-,32-/m1/s1 )

* SMILES: O(c1cc2c(cc1OC)[C@H](N(C)CC2)Cc6ccc(Oc3c(O)ccc(c3)C[C@@H]5c4c(cc(OC)c(OC)c4)CCN5C)cc6)C - (ChemSpider: | SMILES=O(c1cc2c(cc1OC)[C@H](N(C)CC2)Cc6ccc(Oc3c(O)ccc(c3)C[C@@H]5c4c(cc(OC)c(OC)c4)CCN5C)cc6)C )
Davicil (3448)
```
Botcommand: addindex 314942321 Davicil
```
```
For index : Davicil=314942321
```
* 13108-52-6 -> 13108-52-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Davicil not found on commonchemistry - Davicil

* No ChemSpiderID

* PubChem: 61579

* No InChI

* SMILES: CS(=O)(=O)C1=C(C(=NC(=C1Cl)Cl)Cl)Cl
Dazopride (3449)
```
Botcommand: addindex 352350933 Dazopride
```
```
For index : Dazopride=352350933
```
* 70181-03-2 -> 70181-03-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dazopride not found on commonchemistry - Dazopride

* ChemSpiderID: 49487 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 54801

* No InChI - (ChemSpider: | InChI=InChI=1/C15H23ClN4O2/c1-4-19-8-10(9-20(19)5-2)18-15(21)11-6-12(16)13(17)7-14(11)22-3/h6-7,10H,4-5,8-9,17H2,1-3H3,(H,18,21) )

* No SMILES - (ChemSpider: | smiles=Clc1cc(c(OC)cc1N)C(=O)NC2CN(N(CC)C2)CC )

3451 to 3500

Decacarbonyldihydridotriosmium (3453)
```
Botcommand: addindex 344876735 Decacarbonyldihydridotriosmium
```
```
For index : Decacarbonyldihydridotriosmium=344876735
```
* 41766-80-7 -> 41766-80-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Decacarbonyldihydridotriosmium not found on commonchemistry - Decacarbonyldihydridotriosmium

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Decahydroxycyclopentane (3454)
```
Botcommand: addindex 355497056 Decahydroxycyclopentane
```
```
For index : Decahydroxycyclopentane=355497056
```
* 595-03-9 -> 595-03-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Decahydroxycyclopentane not found on commonchemistry - Decahydroxycyclopentane

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: OC1(O)C(O)(O)C(O)(O)C(O)(O)C(O)1O
Decalin (3455)
```
Botcommand: addindex 354058712 Decalin
```
```
For index : Decalin=354058712
```
* 91-17-8 -> 91-17-8 - NOT VERIFIED

* CAS found on commonchemistry - 91-17-8 - name in list
All names: [[Bicyclo[4,4,0]decane]], [[Bicyclo[4.4.0]decane]], Dec, decahidronaftaleno, Decahydronaphtalene, decahydronaphthalene, Decahydronaphthalin, Decalin, Decaline, Dekalin, Naphthalene, decahydro-, Naphthan, NSC 406139, Perhydronaphthalene, UN 1147

* Decalin found on commonchemistry - Decalin
* 91-17-8 (Formula: C10H18; Name: Naphthalene, decahydro-) Matches CAS (91-17-8) on page

* 306-94-5 (Formula: C10F18; Name: Naphthalene, octadecafluorodecahydro-)

* 493-01-6 (Formula: C10H18; Name: Naphthalene, decahydro-, cis-)

* 493-02-7 (Formula: C10H18; Name: Naphthalene, decahydro-, trans-)

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C1CCC2CCCCC2C1
Decamethyldizincocene (3457)

* No CASNo

* Decamethyldizincocene not found on commonchemistry - Decamethyldizincocene

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dechlorane_plus (3461)
```
Botcommand: addindex 340718722 Dechlorane_plus
```
```
For index : Dechlorane_plus=340718722
```
* 13560-89-9 -> 13560-89-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dechlorane+plus not found on commonchemistry - Dechlorane+plus

* ChemSpiderID: 24323 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 26111

* InChI: 1/C18H12Cl12/c19-9-10(20)15(25)7-3-4-8-6(2-1-5(7)13(9,23)17(15,27)28)14(24)11(21)12(22)16(8,26)18(14,29)30/h5-8H,1-4H2 - (ChemSpider: | InChI=InChI=1/C18H12Cl12/c19-9-10(20)15(25)7-3-4-8-6(2-1-5(7)13(9,23)17(15,27)28)14(24)11(21)12(22)16(8,26)18(14,29)30/h5-8H,1-4H2 )

* SMILES: Cl\C2=C(/Cl)C3(Cl)C1CCC4C(CCC1C2(Cl)C3(Cl)Cl)C5(Cl)C(\Cl)=C(\Cl)C4(Cl)C5(Cl)Cl - (ChemSpider: | SMILES=Cl\C2=C(/Cl)C3(Cl)C1CCC4C(CCC1C2(Cl)C3(Cl)Cl)C5(Cl)C(\Cl)=C(\Cl)C4(Cl)C5(Cl)Cl )
Decoquinate (3463)
```
Botcommand: addindex 341850365 Decoquinate
```
```
For index : Decoquinate=341850365
```
* 18507-89-6 -> 18507-89-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Decoquinate not found on commonchemistry - Decoquinate

* No ChemSpiderID

* PubChem: 29112

* No InChI

* No SMILES
Decyl_glucoside (3464)
```
Botcommand: addindex 340718838 Decyl_glucoside
```
```
For index : Decyl_glucoside=340718838
```
* 58846-77-8 -> 58846-77-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Decyl+glucoside not found on commonchemistry - Decyl+glucoside

* ChemSpiderID: 55973 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 62142

* InChI: 1/C16H32O6/c1-2-3-4-5-6-7-8-9-10-21-16-15(20)14(19)13(18)12(11-17)22-16/h12-20H,2-11H2,1H3/t12-,13-,14+,15-,16-/m1/s1 - (ChemSpider: | InChI=InChI=1/C16H32O6/c1-2-3-4-5-6-7-8-9-10-21-16-15(20)14(19)13(18)12(11-17)22-16/h12-20H,2-11H2,1H3/t12-,13-,14+,15-,16-/m1/s1 )

* SMILES: O(CCCCCCCCCC)[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO - (ChemSpider: | SMILES=O(CCCCCCCCCC)[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO )
Deferiprone (3466)
```
Botcommand: addindex 353219184 Deferiprone
```
```
For index : Deferiprone=353219184
```
* 30652-11-0 -> 30652-11-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Deferiprone not found on commonchemistry - Deferiprone

* ChemSpiderID: 2866 (correct: 2866) - CORRECT - Retrieved data from ChemSpider

* PubChem: 2972

* No InChI - (ChemSpider: | InChI=InChI=1/C7H9NO2/c1-5-7(10)6(9)3-4-8(5)2/h3-4,10H,1-2H3 )

* No SMILES - (ChemSpider: | smiles=O=C\1C(\O)=C(/N(/C=C/1)C)C )
Defibrotide (3468)
```
Botcommand: addindex 341057256 Defibrotide
```
```
For index : Defibrotide=341057256
```
* 83712-60-1 -> 83712-60-1 - NOT VERIFIED

* CAS found on commonchemistry - 83712-60-1 - name in list
All names: Defibrotide

* Defibrotide found on commonchemistry - Defibrotide
* 83712-60-1 (exact match) Matches CAS (83712-60-1) on page
Name in list

All names: Defibrotide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Deflazacort (3469)
```
Botcommand: addindex 359252474 Deflazacort
```
```
For index : Deflazacort=359252474
```
* 14484-47-0 -> 14484-47-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Deflazacort not found on commonchemistry - Deflazacort

* No ChemSpiderID

* PubChem: 26709

* No InChI

* No SMILES
Degarelix (3470)
```
Botcommand: addindex 352955339 Degarelix
```
```
For index : Degarelix=352955339
```
* 214766-78-6 -> 214766-78-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Degarelix not found on commonchemistry - Degarelix

* No ChemSpiderID

* PubChem: 16186010

* No InChI

* No SMILES
Deguelin (3471)
```
Botcommand: addindex 355036284 Deguelin
```
```
For index : Deguelin=355036284
```
* 522-17-8 -> 522-17-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Deguelin not found on commonchemistry - Deguelin

* No ChemSpiderID

* No PubChem

* InChI: 1/C2 3H22O6/c1-23(2)8-7-12-15(29-23)6-5-13-21(24)20-14-9-17(25-3)18(26-4)10-16(14)27-11-19(20)28-22(12)13/h5-10,19-20H,11H2,1 -4H3/t19-,20+/m1/s1

* SMILES: O=C2c5c(O[C@@H]3COc1cc(OC)c(OC)<br>cc1[C@H]23)c4\C=C/C(Oc4cc5)(C)C
Dehydroalanine (3473)
```
Botcommand: addindex 357643737 Dehydroalanine
```
```
For index : Dehydroalanine=357643737
```
* 1948-56-7 -> 1948-56-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dehydroalanine not found on commonchemistry - Dehydroalanine

* No ChemSpiderID

* PubChem: 123991

* No InChI

* SMILES: C=C(C(=O)O)N
Dehydrocholic_acid (3475)
```
Botcommand: addindex 340720526 Dehydrocholic_acid
```
```
For index : Dehydrocholic_acid=340720526
```
* 81-23-2 -> 81-23-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dehydrocholic+acid found on commonchemistry - Dehydrocholic+acid
* 475-31-0 (exact match)
Name in list

All names: 3Î±,7Î±,12Î±-Trihydroxy-5Î²-cholan-24-oylglycine, 3Î±,7Î±,12Î±-Trihydroxy-5Î²-cholanic acid-24-glycine, 3Î±,7Î±,12Î±-Trihydroxy-N-(carboxymethyl)-5Î²-cholan-24-amide, Cholylglycine, Glycine cholate, [[Glycine, N-[(3Î±,5Î²,7Î±,12Î±)-3,7,12-trihydroxy-24-oxocholan-24-yl]-]], Glycine, N-choloyl-, Glycocholic acid, [[Glycoreductodehydrocholic acid]], Glycylcholic acid, N-(3-Î±,7-Î±,12-Î±-Trihydroxycholan-24-oyl)glycin, N-(3-Î±,7-Î±,12-Î±-trihydroxycholan-24-oyl)glycine, N-(3-Î±,7-Î±,12-Î±-trihydroxycholane-24-oyl)glycine, N-(3-Î±-7-Î±-12-Î±-trihidroxicolan-24-oil)glicina, N-Choloylglycine

* ChemSpiderID: 6422 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 6674

* InChI: 1/C24H34O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-14,16-18,22H,4-12H2,1-3H3,(H,28,29)/t13-,14+,16-,17+,18+,22+,23+,24-/m1/s1 - (ChemSpider: | InChI=InChI=1/C24H34O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-14,16-18,22H,4-12H2,1-3H3,(H,28,29)/t13-,14+,16-,17+,18+,22+,23+,24-/m1/s1 )

* SMILES: O=C2C[C@H]3CC(=O)[C@H]1[C@H]4[C@](C(=O)C[C@@H]1[C@@]3(C)CC2)([C@H](CC4)[C@H](C)CCC(=O)O)C - (ChemSpider: | SMILES=O=C2C[C@H]3CC(=O)[C@H]1[C@H]4[C@](C(=O)C[C@@H]1[C@@]3(C)CC2)([C@H](CC4)[C@H](C)CCC(=O)O)C )
Dehydroemetine (3476)
* No CASNo

* Dehydroemetine not found on commonchemistry - Dehydroemetine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dehydroepiandrosterone_sulfate (3478)
```
Botcommand: addindex 357884196 Dehydroepiandrosterone_sulfate
```
```
For index : Dehydroepiandrosterone_sulfate=357884196
```
* 651-48-9 -> 651-48-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dehydroepiandrosterone+sulfate not found on commonchemistry - Dehydroepiandrosterone+sulfate

* No ChemSpiderID

* PubChem: 12594

* No InChI

* SMILES: C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O) CC=C4[C@@]3(CC[C@@H](C4)OS(=O)(=O)O)C
Dehydroretinal (3479)
```
Botcommand: addindex 340720623 Dehydroretinal
```
```
For index : Dehydroretinal=340720623
```
* 472-87-7 -> 472-87-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dehydroretinal not found on commonchemistry - Dehydroretinal

* ChemSpiderID: 4444397 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 5280866

* InChI: 1/C20H26O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6-13,15H,14H2,1-5H3/b9-6+,12-11+,16-8+,17-13+ - (ChemSpider: | InChI=InChI=1/C20H26O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6-13,15H,14H2,1-5H3/b9-6+,12-11+,16-8+,17-13+ )

* SMILES: O=C\C=C(\C=C\C=C(\C=C\C1=C(\C=C/CC1(C)C)C)C)C - (ChemSpider: | SMILES=O=C\C=C(\C=C\C=C(\C=C\C1=C(\C=C/CC1(C)C)C)C)C )
Delafloxacin (3480)
```
Botcommand: addindex 340724788 Delafloxacin
```
```
For index : Delafloxacin=340724788
```
* 189279-58-1 -> 189279-58-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Delafloxacin not found on commonchemistry - Delafloxacin

* ChemSpiderID: 427049 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 487101

* No InChI - (ChemSpider: | InChI=InChI=1/C18H12ClF3N4O4/c19-12-13-7(1-9(20)14(12)25-3-6(27)4-25)15(28)8(18(29)30)5-26(13)17-11(22)2-10(21)16(23)24-17/h1-2,5-6,27H,3-4H2,(H2,23,24)(H,29,30) )

* No SMILES - (ChemSpider: | smiles=Fc4cc(F)c(nc4N1\C=C(\C(=O)O)C(=O)c2c1c(Cl)c(c(F)c2)N3CC(O)C3)N )
Delapril (3481)
```
Botcommand: addindex 336499330 Delapril
```
```
For index : Delapril=336499330
```
* 83435-66-9 -> 83435-66-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Delapril not found on commonchemistry - Delapril

* No ChemSpiderID

* PubChem: 5362116

* No InChI

* No SMILES
Delmadinone (3483)
```
Botcommand: addindex 354106759 Delmadinone
```
```
For index : Delmadinone=354106759
```
* 15262-77-8 -> 15262-77-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Delmadinone not found on commonchemistry - Delmadinone

* No ChemSpiderID

* PubChem: 10428639

* No InChI

* SMILES: CC(=O)[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C=C(C4=CC(=O)C=C[C@]34C)Cl)C)O
Delorazepam (3484)
```
Botcommand: addindex 347707293 Delorazepam
```
```
For index : Delorazepam=347707293
```
* 2894-67-9 -> 2894-67-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Delorazepam not found on commonchemistry - Delorazepam

* No ChemSpiderID

* PubChem: 17925

* No InChI

* No SMILES
Delphinidin (3485)
```
Botcommand: addindex 350494226 Delphinidin
```
```
For index : Delphinidin=350494226
```
* 13270-61-6 -> 13270-61-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Delphinidin not found on commonchemistry - Delphinidin

* No ChemSpiderID

* PubChem: 128853

* No InChI

* SMILES: Oc3cc(O)cc(c3CC2O)OC2c(cc1O)cc(O)c1O
Delphinine (3486)
```
Botcommand: addindex 343510917 Delphinine
```
```
For index : Delphinine=343510917
```
* 561-07-9 -> 561-07-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Delphinine not found on commonchemistry - Delphinine

* No ChemSpiderID

* PubChem: 441726

* No InChI

* SMILES: CC(=O)O[C@]12C[C@@H]([C@]3(C[C@H]([C@@H]1[C@H]3OC(=O)C4=CC=CC=C4)[C@]56[C@H](CC[C@@]7([C@H]5[C@H]([C@H]2C6N(C7)C)OC)COC)OC)O)OC
Deltic_acid (3490)
```
Botcommand: addindex 365232999 Deltic_acid
```
```
For index : Deltic_acid=365232999
```
* 54826-91-4 -> 54826-91-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Deltic+acid not found on commonchemistry - Deltic+acid

* ChemSpiderID: 9854518 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 11679790

* InChI: 1/C3H2O3/c4-1-2(5)3(1)6/h4-5H - (ChemSpider: | InChI=InChI=1/C3H2O3/c4-1-2(5)3(1)6/h4-5H )

* SMILES: O=C1C(/O)=C1/O - (ChemSpider: | SMILES=O=C1C(/O)=C1/O )
Delucemine (3491)
```
Botcommand: addindex 361652377 Delucemine
```
```
For index : Delucemine=361652377
```
* 186495-49-8 -> 186495-49-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Delucemine not found on commonchemistry - Delucemine

* No ChemSpiderID

* PubChem: 156421

* No InChI

* No SMILES
Demeclocycline (3493)
```
Botcommand: addindex 360120787 Demeclocycline
```
```
For index : Demeclocycline=360120787
```
* 127-33-3 -> 127-33-3 - NOT VERIFIED

* CAS found on commonchemistry - 127-33-3 - name in list
All names: 2-Naphthacenecarboxamide, 7-chloro-4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-1,11-dioxo-, 2-Naphthacenecarboxamide, 7-chloro-4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-1,11-dioxo-, (4S,4aS,5aS,6S,12aS)-, [[2-Naphthacenecarboxamide, 7-chloro-4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-1,11-dioxo-, [4S-(4Î±,4aÎ±,5aÎ±,6Î²,12aÎ±)]-]], 6-Demethyl-7-chlorotetracycline, 6-Demethyl-7-chlortetracycline, 6-Demethylchlorotetracycline, 6-Demethylchlortetracycline, 7-Chloro-4-dimethylamino-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-1,11-dioxo-2-naphthacenecarboxamide, 7-Chloro-6-demethyltetracycline, Bioterciclin, Chlortetracycline, 6-demethyl-, Deganol, demeclociclina, Demeclocyclin, demeclocycline, Demeclor, Demethylchlorotetracycline, Demethylchlortetracyclin, Demethylchlortetracycline, Demetraclin, Dimethyl-7-cholotetracycline, Diuciclin, DMCT, DMCT (antibiotic), Elkamicina, Ledermycin, Mexocine, Novotriclina, Perciclina, Periciclina, RP 10192, Sumaclina, Tri-demethylchlortetracycline

* Demeclocycline found on commonchemistry - Demeclocycline
* 127-33-3 (exact match) Matches CAS (127-33-3) on page
Name in list

All names: 2-Naphthacenecarboxamide, 7-chloro-4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-1,11-dioxo-, 2-Naphthacenecarboxamide, 7-chloro-4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-1,11-dioxo-, (4S,4aS,5aS,6S,12aS)-, [[2-Naphthacenecarboxamide, 7-chloro-4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-1,11-dioxo-, [4S-(4Î±,4aÎ±,5aÎ±,6Î²,12aÎ±)]-]], 6-Demethyl-7-chlorotetracycline, 6-Demethyl-7-chlortetracycline, 6-Demethylchlorotetracycline, 6-Demethylchlortetracycline, 7-Chloro-4-dimethylamino-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-1,11-dioxo-2-naphthacenecarboxamide, 7-Chloro-6-demethyltetracycline, Bioterciclin, Chlortetracycline, 6-demethyl-, Deganol, demeclociclina, Demeclocyclin, [[demeclocycline]], Demeclor, Demethylchlorotetracycline, Demethylchlortetracyclin, Demethylchlortetracycline, Demetraclin, Dimethyl-7-cholotetracycline, Diuciclin, DMCT, DMCT (antibiotic), Elkamicina, Ledermycin, Mexocine, Novotriclina, Perciclina, Periciclina, RP 10192, Sumaclina, Tri-demethylchlortetracycline

* ChemSpiderID: 10482117 (correct: 10482117) - CORRECT - Retrieved data from ChemSpider

* PubChem: 5311063

* No InChI - (ChemSpider: | InChI=InChI=1/C21H21ClN2O8/c1-24(2)14-7-5-6-10(16(27)12-9(25)4-3-8(22)11(12)15(6)26)18(29)21(7,32)19(30)13(17(14)28)20(23)31/h3-4,6-7,14-15,25-26,28-29,32H,5H2,1-2H3,(H2,23,31)/t6-,7-,14-,15-,21-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=CN(C)[C@@H]1C(\O)=C(\C(N)=O)C(=O)[C@@]2(O)C(/O)=C3/C(=O)c4c(O)ccc(Cl)c4[C@@H](O)[C@H]3C[C@@H]12 )
Demegestone (3495)
```
Botcommand: addindex 354099287 Demegestone
```
```
For index : Demegestone=354099287
```
* 10116-22-0 -> 10116-22-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Demegestone not found on commonchemistry - Demegestone

* No ChemSpiderID

* PubChem: 93057

* No InChI

* SMILES: CC(=O)[C@]1(CC[C@@H]2[C@@]1(CCC3=C4CCC(=O)C=C4CC[C@@H]23)C)C
Demeton (3496)

* No CASNo

* Demeton found on commonchemistry - Demeton
* 298-04-4 (Formula: C8H19O2PS3; Name: Phosphorodithioic acid, O,O-diethylS-[2-(ethylthio)ethyl] ester)

* 8022-00-2 (Formula: C6H15O3PS2.C6H15O3PS2; Name: Phosphorothioic acid, O-[2-(ethylthio)ethyl]O,O-dimethyl ester, mixt. withS-[2-(ethylthio)ethyl]O,O-dimethyl phosphorothioate)

* ChemSpiderID: 23115 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C8H19O3PS2/c1-4-10-12(9,11-5-2)14-8-7-13-6-3/h4-8H2,1-3H3 - (ChemSpider: | InChI=InChI=1/C8H19O3PS2/c1-4-10-12(9,11-5-2)14-8-7-13-6-3/h4-8H2,1-3H3 )

* SMILES: O=P(OCC)(SCCSCC)OCC - (ChemSpider: | SMILES=O=P(OCC)(SCCSCC)OCC )
Demeton-S-methyl (3497)
```
Botcommand: addindex 363420402 Demeton-S-methyl
```
```
For index : Demeton-S-methyl=363420402
```
* 919-86-8 -> 919-86-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Demeton+S+methyl not found on commonchemistry - Demeton+S+methyl

* ChemSpiderID: 12938 (correct: 12938) - CORRECT - Retrieved data from ChemSpider

* PubChem: 13526

* InChI: 1/C6H15O3PS2/c1-4-11-5-6-12-10(7,8-2)9-3/h4-6H2,1-3H3 - (ChemSpider: | InChI=InChI=1/C6H15O3PS2/c1-4-11-5-6-12-10(7,8-2)9-3/h4-6H2,1-3H3 )

* SMILES: O=P(OC)(SCCSCC)OC - (ChemSpider: | SMILES=O=P(OC)(SCCSCC)OC )
Demexiptiline (3498)
```
Botcommand: addindex 351952961 Demexiptiline
```
```
For index : Demexiptiline=351952961
```
* 18059-99-9 -> 18059-99-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Demexiptiline not found on commonchemistry - Demexiptiline

* ChemSpiderID: 26858 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 28876

* No InChI - (ChemSpider: | InChI=InChI=1/C18H18N2O/c1-19-12-13-21-20-18-16-8-4-2-6-14(16)10-11-15-7-3-5-9-17(15)18/h2-11,19H,12-13H2,1H3 )

* No SMILES - (ChemSpider: | smiles=O(\N=C3/c1ccccc1\C=C/c2c3cccc2)CCNC )
Demoxepam (3499)
```
Botcommand: addindex 347707346 Demoxepam
```
```
For index : Demoxepam=347707346
```
* 963-39-3 -> 963-39-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Demoxepam found on commonchemistry - Demoxepam
* 1088-11-5 (exact match)
Name in list

All names: 1-Demethyldiazepam, 2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-5-phenyl-, 7-Chloro-1,3-dihydro-1H-5-phenyl-2H-1,4-benzodiazepin-2-one, 7-Chloro-1,3-dihydro-5-phenyl-1,4-benzodiazepin-2-one, 7-Chloro-1,3-dihydro-5-phenyl-2H-1,4-benzodiazapin-2-one, 7-Chloro-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepin-2-one, 7-Chloro-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepine-2-one, 7-Chloro-5-phenyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one, [[7-Chloro-5-phenyl-1,3-dihydrobenzo[e][1,4]diazepin-2-one]], 7-Chloro-5-phenyl-2-oxo-1,2-dihydro-1,4-benzodiazepine, 7-Chloro-5-phenyl-3H-1,4-benzodiazepin-2(1H)-one, A 101, Calmday, Dealkylprazepam, Demethyldiazepam, Demoxazepam, Desalkylprazepam, Desmethyldiazepam, DMDZ, Madar, N1-Desmethyldiazepam, N-Demethyldiazepam, [[N-Deoxydemoxepam]], N-Descyclopropylmethylprazepam, N-Desmethyldiazepam, Nordaz, nordazepam, Nordiazepam, Norprazepam, NSC 46078, NSC 631619, Praxadium, Ro 5-2180, Stilny

* ChemSpiderID: 10441314 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 13756

* No InChI - (ChemSpider: | InChI=InChI=1/C15H11ClN2O2/c16-11-6-7-13-12(8-11)15(10-4-2-1-3-5-10)18(20)9-14(19)17-13/h1-8H,9H2,(H,17,19) )

* No SMILES - (ChemSpider: | smiles=Clc1ccc2NC(=O)C[N+](/[O-])=C(\c2c1)c3ccccc3 )
Demoxytocin (3500)
```
Botcommand: addindex 308045556 Demoxytocin
```
```
For index : Demoxytocin=308045556
```
* 113-78-0 -> 113-78-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Demoxytocin not found on commonchemistry - Demoxytocin

* No ChemSpiderID

* PubChem: 8229

* No InChI

* SMILES: CCC(C)C1C(=O)NC(C(=O)NC(C(=O)NC(CSSCCC(=O)NC(C(=O)N1)CC2=CC=C(C=C2)O)C(=O)N3CCCC3C(=O)NC(CC(C)C)C(=O)NCC(=O)N)CC(=O)N)CCC(=O)N