Wikipedia:WikiProject Pharmacology/Log/2010-03-17

Standard header for logs from CheMoBot

00:35:46 (3, 2, 4) (EDIT) User:Jytdog (contribs, talk) edited Alpidem (diff, hist)
Added links: http://whqlibdoc.who.int/druginfo/DRUG_INFO_8_2_1994.pdf
01:24:04 (3, 2, 4) (EDIT) User:HazyM (contribs, talk) edited Cilostazol (diff, hist)
Added links: http://druginfo.nlm.nih.gov/drugportal/dpdirect.jsp?name=Cilostazol
02:43:17 (3, 2, 4) (EDIT) User:187.37.201.194 (contribs, talk) edited Dimethyltryptamine (diff, hist)
Added links: http://rickstrassman.com/dmt/chaptersummaries.html
02:58:36 (3, 2, 4) (EDIT) User:Literaturegeek (contribs, talk) edited Progesterone (diff, hist)
Added links: http://www.prometrium.com/pdf/Patient_PatientInformation/Prometrium_Patient_Information.pdf
03:02:11 (2, 3, 5) (EDIT) User:Harbinary (contribs, talk) edited Litoxetine (diff, hist)
Changed: 'image' ('Litoxetine.png' -> 'Litoxetine-2D-skeletal.png')
03:14:27 (3, 2, 4) (EDIT) User:76.28.6.10 (contribs, talk) edited HU-210 (diff, hist)
Added links: http://www.kogged.com/2010/02/hu-210-cannabinoid/
04:21:34 (3, 2, 4) (EDIT) User:Drugevaluation (contribs, talk) edited Eltrombopag (diff, hist)
Added links: http://adisonline.com/drugs/abstract/2009/69050/Eltrombopag.5.aspx
04:26:15 (3, 2, 4) (EDIT) User:Drugevaluation (contribs, talk) edited Tocilizumab (diff, hist)
Added links: http://adisonline.com/drugs/abstract/2009/69050/Tocilizumab__A_Review_of_its_Use_in_the_Management.7.aspx
04:46:29 (3, 2, 4) (EDIT) User:Drugevaluation (contribs, talk) edited Golimumab (diff, hist)
Added links: http://adisonline.com/biodrugs/abstract/2009/23020/Golimumab__In_the_Treatment_of_Rheumatoid.5.aspx
04:47:26 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ritodrine (diff, hist)
Added: 'verifiedrevid' ('' -> '291735536', SET '')
04:47:27 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ritodrine (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')
04:56:50 (3, 2, 4) (EDIT) User:85.177.95.175 (contribs, talk) edited Cotinine (diff, hist)
Added links: http://www.scienceblog.com/community/older/2002/G/20021531.html
05:33:39 (4, 4, 5) (EDIT) User:70.53.151.49 (contribs, talk) edited Diazepam (diff, hist)
Changed: 'IUPAC_name' ('7-chloro-1,3-dihydro- 1-methyl-5-phenyl- 1,4-benzodiazepin-2(3''H'')-one' -> '7-chloro-1,3-dihydro- 1-methyl-5-phenyl- 1,4-benzodiazepin-2(2''H'')-one', SET '7-chloro-1,3dihydro-1-methyl- 5-phenyl-2''H''- 1,4-benzodiazepin-2-one')
05:36:41 (3, 2, 4) (EDIT) User:Wisdom89 (contribs, talk) edited Diazepam (diff, hist)
Added links: http://books.google.co.uk/books?id=Xx7iNGdV25IC&pg=PA470., http://druginfo.nlm.nih.gov/drugportal/dpdirect.jsp?name=Diazepam
05:36:41 (4, 4, 5) (EDIT) User:Wisdom89 (contribs, talk) edited Diazepam (diff, hist)
Changed: 'IUPAC_name' ('7-chloro-1,3-dihydro- 1-methyl-5-phenyl- 1,4-benzodiazepin-2(2''H'')-one' -> '7-chloro-1,3-dihydro- 1-methyl-5-phenyl- 1,4-benzodiazepin-2(3''H'')-one', SET '7-chloro-1,3dihydro-1-methyl- 5-phenyl-2''H''- 1,4-benzodiazepin-2-one')
05:44:53 (3, 2, 4) (EDIT) User:85.177.95.175 (contribs, talk) edited Cotinine (diff, hist)
Added links: http://www.webcitation.org/5oHyEmtc2
05:49:45 (3, 2, 4) (EDIT) User:Ssp37097 (contribs, talk) edited Atracurium (diff, hist)
Added links: http://www.fda.gov/downloads/Safety/MedWatch/SafetyInformation/SafetyAlertsforHumanMedicalProducts/UCM173891.pdf, http://www.nytimes.com/2001/03/31/us/anesthesia-drug-is-removed-from-market-after-the-deaths-of-5-patients.html?pagewanted=1, http://www.nytimes.com/2001/03/31/us/anesthesia-drug-is-removed-from-market-after-the-deaths-of-5-patients.html?pagewanted=1, http://www.fda.gov/downloads/Safety/MedWatch/SafetyInformation/SafetyAlertsforHumanMedicalProducts/UCM173891.pdf
05:52:05 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Anisodine (diff, hist)
Changed: 'image' ('Anisodine.png' -> '')
05:52:15 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Amitriptylinoxide (diff, hist)
Changed: 'image' ('Amitriptylinoxide.png' -> '')
05:52:31 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Amiflamine (diff, hist)
Changed: 'image' ('Amiflamine.png' -> '')
05:52:41 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Amfecloral (diff, hist)
Changed: 'image' ('Amfechloral.png' -> '')
05:52:48 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Alvameline (diff, hist)
Changed: 'image' ('Alvameline.png' -> '')
05:52:53 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Alpha-Ethylphenethylamine (diff, hist)
Changed: 'image' ('Alpha-Ethylphenethylamine.png' -> '')
05:52:58 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Acefylline (diff, hist)
Changed: 'image' ('Acefylline.png' -> '')
05:53:01 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited 6-Nitroquipazine (diff, hist)
Changed: 'image' ('6-Nitroquipazine.png' -> '')
05:53:10 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited 2-Methyl-MDA (diff, hist)
Changed: 'image' ('2-Methyl-MDA.png' -> '')
05:54:43 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Xipranolol (diff, hist)
Changed: 'image' ('Xipranolol.png' -> '')
05:54:48 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Xibenolol (diff, hist)
Changed: 'image' ('Xibenolol.png' -> '')
05:55:36 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Revospirone (diff, hist)
Changed: 'image' ('Revospirone.png' -> '')
05:57:54 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Esreboxetine (diff, hist)
Changed: 'image' ('Esreboxetine.png' -> '')
05:58:03 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Enilospirone (diff, hist)
Changed: 'image' ('Enilospirone.png' -> '')
05:58:18 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Diacetolol (diff, hist)
Changed: 'image' ('Diacetolol.png' -> '')
05:58:38 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Corynanthine (diff, hist)
Changed: 'image' ('Corynanthine.png' -> '')
05:59:13 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Alprenoxime (diff, hist)
Changed: 'image' ('Alprenoxime.png' -> '')
05:59:23 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Ajmalicine (diff, hist)
Changed: 'image' ('Ajmalicine.png' -> '')
05:59:28 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Afurolol (diff, hist)
Changed: 'image' ('Afurolol.png' -> '')
05:59:41 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Adaprolol (diff, hist)
Changed: 'image' ('Adaprolol.png' -> '')
06:03:03 (3, 2, 4) (EDIT) User:90.208.171.162 (contribs, talk) edited Mephedrone (diff, hist)
Added links: http://news.bbc.co.uk/1/hi/uk/8571599.stm
06:23:15 (3, 2, 4) (EDIT) User:Trusilver (contribs, talk) edited Vitamin_C (diff, hist)
Added links: http://www.nature.com/nm/journal/v8/n5/full/nm0502-445.html
06:25:26 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Toxiferine (diff, hist)
Changed: 'image' ('Toxiferine.png' -> '')
06:25:51 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Tiospirone (diff, hist)
Changed: 'image' ('Tiospirone.png' -> '')
06:27:24 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Tandamine (diff, hist)
Changed: 'image' ('Tandamine-structure.png' -> '')
06:28:30 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Psychotridine (diff, hist)
Changed: 'image' ('Psychotridine.png' -> '')
06:28:49 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Propizepine (diff, hist)
Changed: 'image' ('Propizepine.png' -> '')
06:29:04 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Profadol (diff, hist)
Changed: 'image' ('Profadol.png' -> '')
06:30:00 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Pirlindole (diff, hist)
Changed: 'image' ('Pirlindole-structure.png' -> '')
06:30:24 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Pirandamine (diff, hist)
Changed: 'image' ('Pirandamine.png' -> '')
06:30:52 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Pipofezine (diff, hist)
Changed: 'image' ('Pipofezine.png' -> '')
06:31:09 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Phenylethylidenehydrazine (diff, hist)
Changed: 'image' ('Phenylethylidenehydrazine.png' -> '')
06:31:34 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Phenoxypropazine (diff, hist)
Changed: 'image' ('Phenoxypropazine.png' -> '')
06:32:17 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Pheniprazine (diff, hist)
Changed: 'image' ('Pheniprazine-structure.png' -> '')
06:32:44 (2, 5, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Phenelzine (diff, hist)
Deleted: 'image' ('Phenelzine.png' -> '', SET 'Phenelzine.svg')
06:33:37 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Pentolinium (diff, hist)
Changed: 'image' ('Pentolinium.png' -> '')
06:33:55 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Morphanol (diff, hist)
Changed: 'image' ('Morphanol.png' -> '')
06:34:47 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Milameline (diff, hist)
Changed: 'image' ('Milameline.png' -> '')
06:35:11 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Metralindole (diff, hist)
Changed: 'image' ('Metralindole.png' -> '')
06:35:34 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Methorphan (diff, hist)
Changed: 'image' ('Methorphan.png' -> '')
06:35:57 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Metapramine (diff, hist)
Changed: 'image' ('Metapramine.png' -> '')
06:37:18 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Umespirone (diff, hist)
Changed: 'image' ('Umespirone.png' -> '')
06:37:50 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Rauwolscine (diff, hist)
Changed: 'image' ('Rauwolscine.png' -> '')
06:38:12 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Octriptyline (diff, hist)
Changed: 'image' ('Octriptyline.png' -> '')
06:38:31 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Octamoxin (diff, hist)
Changed: 'image' ('Octamoxin.png' -> '')
06:38:58 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Noxiptiline (diff, hist)
Changed: 'image' ('Noxiptiline.png' -> '')
06:40:34 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Levomilnacipran (diff, hist)
Changed: 'image' ('Levomilnacipran.png' -> '')
06:40:55 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Lenperone (diff, hist)
Changed: 'image' ('Lenperone.png' -> '')
06:41:11 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Lazabemide (diff, hist)
Changed: 'image' ('Lazabemide.png' -> '')
06:41:46 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Ladostigil (diff, hist)
Changed: 'image' ('Ladostigil.png' -> '')
06:43:09 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Isoguvacine (diff, hist)
Changed: 'image' ('Isoguvacine.png' -> '')
06:43:44 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Intriptyline (diff, hist)
Changed: 'image' ('Intriptyline.png' -> '')
06:44:11 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Imipraminoxide (diff, hist)
Changed: 'image' ('Imipraminoxide.png' -> '')
06:45:32 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Fengabine (diff, hist)
Changed: 'image' ('Fengabine.png' -> '')
06:45:53 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Ezlopitant (diff, hist)
Changed: 'image' ('Ezlopitant.png' -> '')
06:46:19 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Esmirtazapine (diff, hist)
Changed: 'image' ('Esmirtazapine.png' -> '')
06:46:43 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Echinopsidine (diff, hist)
Changed: 'image' ('Echinopsidine.png' -> '')
06:46:58 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Dyspropterin (diff, hist)
Changed: 'image' ('Dyspropterin.png' -> '')
06:47:48 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Amfepramone (diff, hist)
Changed: 'image' ('Diethylpropion.png' -> '')
06:48:19 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Desmethylsertraline (diff, hist)
Changed: 'image' ('Desmethylsertraline.png' -> '')
06:48:43 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Demexiptiline (diff, hist)
Changed: 'image' ('Demexiptiline.png' -> '')
06:49:37 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Clopimozide (diff, hist)
Changed: 'image' ('Clopimozide.png' -> '')
06:49:58 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Cinitapride (diff, hist)
Changed: 'image' ('Cinitapride.png' -> '')
06:51:34 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Caroxazone (diff, hist)
Changed: 'image' ('Caroxazone.png' -> '')
06:51:59 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Benmoxin (diff, hist)
Changed: 'image' ('Benmoxin.png' -> '')
06:53:00 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Azepindole (diff, hist)
Changed: 'image' ('Azepindole.png' -> '')
06:53:14 (2, 3, 4) (EDIT) User:ImageRemovalBot (contribs, talk) edited Avitriptan (diff, hist)
Changed: 'image' ('Avitriptan.png' -> '')
11:26:29 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Mapatumumab (diff, hist)
Changed: 'mab_type' ('' -> 'mab')
11:26:29 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Mapatumumab (diff, hist)
Changed: 'source' ('Human' -> 'u')
11:26:30 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Mapatumumab (diff, hist)
Changed: 'target' ('[[TRAIL]]-Receptor ([[death receptor]] 4)' -> '[[TRAIL]]-receptor ([[death receptor]] 4)')
11:38:15 (3, 2, 4) (EDIT) User:139.166.244.163 (contribs, talk) edited Mephedrone (diff, hist)
Added links: http://news.bbc.co.uk/1/hi/england/humber/8570582.stm
12:04:58 (3, 2, 4) (EDIT) User:Smartse (contribs, talk) edited Mephedrone (diff, hist)
Added links: http://news.bbc.co.uk/1/hi/uk/8571935.stm
12:11:36 (3, 2, 4) (EDIT) User:Smartse (contribs, talk) edited Mephedrone (diff, hist)
Added links: http://www.lifelineproject.co.uk/docs/M-cat%20report%20small.pdf
12:25:02 (3, 2, 4) (EDIT) User:Smartse (contribs, talk) edited Mephedrone (diff, hist)
Added links: http://www.eapcct.org/publicfile.php?folder=congress&file=Abstracts_SanAntonio.pdf
12:36:51 (3, 2, 4) (EDIT) User:Smartse (contribs, talk) edited Mephedrone (diff, hist)
Added links: http://www.lifeline.org.uk/docs/Meph%20faq.pdf
12:44:32 (3, 2, 4) (EDIT) User:94.193.221.242 (contribs, talk) edited Mephedrone (diff, hist)
Added links: http://www.yorkpress.co.uk/news/4860334.Press_launches_campaign_for_mephedrone_to_be_made_illegal/?action=complain&cid=8246272
12:48:41 (3, 2, 4) (EDIT) User:Smartse (contribs, talk) edited Mephedrone (diff, hist)
Added links: http://news.bbc.co.uk/newsbeat/hi/health/newsid_10050000/newsid_10059100/10059133.stm
13:20:31 (3, 2, 4) (EDIT) User:Ghostiewm (contribs, talk) edited Guanfacine (diff, hist)
Added links: http://www.freepatentsonline.com/20090221610.pdf
13:22:00 (3, 2, 4) (EDIT) User:Ghostiewm (contribs, talk) edited Guanfacine (diff, hist)
Added links: http://www.freepatentsonline.com/y2009/0221610.html
13:39:19 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Maslimomab (diff, hist)
Changed: 'source' ('[[Mouse]]' -> 'o')
14:40:11 (3, 2, 4) (EDIT) User:Rockhyrax (contribs, talk) edited Mephedrone (diff, hist)
Added links: http://news.bbc.co.uk/1/hi/uk/8571935.stm
14:44:42 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Matuzumab (diff, hist)
Changed: 'mab_type' ('' -> 'mab')
14:44:42 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Matuzumab (diff, hist)
Changed: 'source' ('[[Humanized]]' -> 'zu')
14:50:58 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Mepolizumab (diff, hist)
Changed: 'mab_type' ('' -> 'mab')
14:50:59 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Mepolizumab (diff, hist)
Changed: 'source' ('[[Human]]' -> 'zu/o')
15:00:38 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Metelimumab (diff, hist)
Changed: 'mab_type' ('' -> 'mab')
15:00:38 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Metelimumab (diff, hist)
Changed: 'source' ('[[Human]]' -> 'u')
15:51:50 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Milatuzumab (diff, hist)
Changed: 'mab_type' ('' -> 'mab')
15:51:50 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Milatuzumab (diff, hist)
Changed: 'source' ('Humanized' -> 'zu/o')
15:59:00 (3, 2, 4) (EDIT) User:Excirial (contribs, talk) edited Mephedrone (diff, hist)
Added links: http://news.bbc.co.uk/1/hi/england/tees/8370130.stm
16:27:00 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'bioavailability' ('49â73%' -> '', SET '49â73%')
16:27:00 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'protein_bound' ('99%' -> '', SET '99%')
16:27:00 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'metabolism' ('Hepatic ([[CYP2C9]])' -> '', SET 'Hepatic ([[CYP2C9]])')
16:27:01 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'elimination_half-life' ('1.8â2 hours' -> '', SET '1.8â2 hours')
16:27:01 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'excretion' ('Renal' -> '', SET 'Renal')
16:27:01 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'molecular_weight' ('206.28' -> '', SET '206.28')
16:27:01 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'DrugBank' ('APRD00372' -> '', SET 'APRD00372')
16:27:02 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'smiles' ('CC(C(=O)O)c1ccc(CC(C)C)cc1' -> '', SET 'CC(C(=O)O)c1ccc(CC(C)C)cc1')
16:27:02 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'C' ('13' -> '', SET '13')
16:27:02 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'H' ('18' -> '', SET '18')
16:27:02 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'O' ('2' -> '', SET '2')
16:27:03 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'PubChem' ('3672' -> '', SET '3672')
16:27:03 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'melting_point' ('76' -> '', SET '76')
16:27:12 (3, 3, 4) (EDIT) User:ClueBot (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'bioavailability' ('' -> '49â73%', SET '49â73%')
16:27:13 (3, 3, 4) (EDIT) User:ClueBot (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'protein_bound' ('' -> '99%', SET '99%')
16:27:13 (3, 3, 4) (EDIT) User:ClueBot (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'metabolism' ('' -> 'Hepatic ([[CYP2C9]])', SET 'Hepatic ([[CYP2C9]])')
16:27:13 (3, 3, 4) (EDIT) User:ClueBot (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'elimination_half-life' ('' -> '1.8â2 hours', SET '1.8â2 hours')
16:27:14 (3, 3, 4) (EDIT) User:ClueBot (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'excretion' ('' -> 'Renal', SET 'Renal')
16:27:14 (4, 3, 4) (EDIT) User:ClueBot (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'molecular_weight' ('' -> '206.28', SET '206.28')
16:27:14 (4, 3, 4) (EDIT) User:ClueBot (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'DrugBank' ('' -> 'APRD00372', SET 'APRD00372')
16:27:14 (4, 3, 4) (EDIT) User:ClueBot (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'smiles' ('' -> 'CC(C(=O)O)c1ccc(CC(C)C)cc1', SET 'CC(C(=O)O)c1ccc(CC(C)C)cc1')
16:27:15 (4, 3, 4) (EDIT) User:ClueBot (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'C' ('' -> '13', SET '13')
16:27:15 (4, 3, 4) (EDIT) User:ClueBot (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'H' ('' -> '18', SET '18')
16:27:15 (4, 3, 4) (EDIT) User:ClueBot (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'O' ('' -> '2', SET '2')
16:27:15 (4, 3, 4) (EDIT) User:ClueBot (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'PubChem' ('' -> '3672', SET '3672')
16:27:16 (3, 2, 4) (EDIT) User:ClueBot (contribs, talk) edited Ibuprofen (diff, hist)
Added links: http://whqlibdoc.who.int/hq/2005/a87017_eng.pdf, http://jcp.sagepub.com/cgi/reprint/32/4/317, http://www.telegraph.co.uk/health/main.jhtml?xml=/health/2007/10/08/hadams108.xml, http://www.medicine.ox.ac.uk/bandolier/booth/painpag/topical/topkin.html, http://www.ncbi.nlm.nih.gov/pubmed/6239884?ordinalpos=1&itool=EntrezSystem2.PEntrez.Pubmed.Pubmed_ResultsPanel.Pubmed_RVBrief, http://www.ingentaconnect.com/content/adis/inp/2006/00000001/00001530/art00048;jsessionid=1ghdlu0vup2pl.alice, http://www.fasebj.org/cgi/content/full/19/12/1592, http://ovationpharma.com/pdfs/products/product_9.pdf, http://www.medic8.com/medicines/Ibuprofen.html, http://www.experiencefestival.com/a/Ibuprofen_-_Adverse_effects/id/1494737, http://www.nlm.nih.gov/medlineplus/druginfo/uspdi/202743.html, http://bmj.bmjjournals.com/cgi/content/full/330/7504/1366, http://www.rxlist.com/cgi/generic/ibup.htm, http://molpharm.aspetjournals.org/cgi/content/full/51/4/576, http://www.rsc.org/education/teachers/learnnet/green/ibuprofen/, http://www.epa
16:27:16 (4, 3, 4) (EDIT) User:ClueBot (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'melting_point' ('' -> '76', SET '76')
16:28:16 (2, 4, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Added: 'pages' ('' -> '223â230', SET '')
16:28:16 (2, 4, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Added: 'year' ('' -> '1982', SET '')
16:28:16 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'bioavailability' ('49â73%' -> '', SET '49â73%')
16:28:17 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'protein_bound' ('99%' -> '', SET '99%')
16:28:17 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'metabolism' ('Hepatic ([[CYP2C9]])' -> '', SET 'Hepatic ([[CYP2C9]])')
16:28:17 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'elimination_half-life' ('1.8â2 hours' -> '', SET '1.8â2 hours')
16:28:17 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'excretion' ('Renal' -> '', SET 'Renal')
16:28:18 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'pregnancy_AU' ('C' -> '', SET 'C')
16:28:18 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'pregnancy_US' ('D' -> '', SET 'D')
16:28:18 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'licence_US' ('Ibuprofen' -> '', SET 'Ibuprofen')
16:28:18 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'legal_AU' ('unscheduled' -> '', SET 'unscheduled')
16:28:19 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'legal_UK' ('GSL' -> '', SET 'GSL')
16:28:19 (2, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'legal_US' ('OTC' -> '', SET 'OTC')
16:28:19 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'molecular_weight' ('206.28' -> '', SET '206.28')
16:28:19 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'DrugBank' ('APRD00372' -> '', SET 'APRD00372')
16:28:20 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'ATC_suffix' ('AE01' -> '5', SET 'AE01')
16:28:23 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'smiles' ('CC(C(=O)O)c1ccc(CC(C)C)cc1' -> '', SET 'CC(C(=O)O)c1ccc(CC(C)C)cc1')
16:28:23 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'C' ('13' -> '', SET '13')
16:28:23 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'H' ('18' -> '', SET '18')
16:28:24 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'O' ('2' -> '', SET '2')
16:28:24 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'PubChem' ('3672' -> '', SET '3672')
16:28:24 (4, 5, 5) (EDIT) User:206.219.133.133 (contribs, talk) edited Ibuprofen (diff, hist)
Deleted: 'melting_point' ('76' -> '', SET '76')
16:28:29 (3, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'bioavailability' ('' -> '49â73%', SET '49â73%')
16:28:30 (3, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'protein_bound' ('' -> '99%', SET '99%')
16:28:30 (3, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'metabolism' ('' -> 'Hepatic ([[CYP2C9]])', SET 'Hepatic ([[CYP2C9]])')
16:28:30 (3, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'elimination_half-life' ('' -> '1.8â2 hours', SET '1.8â2 hours')
16:28:31 (3, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'excretion' ('' -> 'Renal', SET 'Renal')
16:28:31 (3, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'pregnancy_AU' ('' -> 'C', SET 'C')
16:28:31 (3, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'pregnancy_US' ('' -> 'D', SET 'D')
16:28:31 (3, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'licence_US' ('' -> 'Ibuprofen', SET 'Ibuprofen')
16:28:31 (3, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'legal_AU' ('' -> 'unscheduled', SET 'unscheduled')
16:28:32 (3, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'legal_UK' ('' -> 'GSL', SET 'GSL')
16:28:32 (3, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'legal_US' ('' -> 'OTC', SET 'OTC')
16:28:32 (3, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'pages' ('223â230' -> '', SET '')
16:28:32 (3, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'year' ('1982' -> '', SET '')
16:28:33 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'molecular_weight' ('' -> '206.28', SET '206.28')
16:28:33 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'DrugBank' ('' -> 'APRD00372', SET 'APRD00372')
16:28:33 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'ATC_suffix' ('5' -> 'AE01', SET 'AE01')
16:28:33 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'smiles' ('' -> 'CC(C(=O)O)c1ccc(CC(C)C)cc1', SET 'CC(C(=O)O)c1ccc(CC(C)C)cc1')
16:28:34 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'C' ('' -> '13', SET '13')
16:28:34 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'H' ('' -> '18', SET '18')
16:28:34 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'O' ('' -> '2', SET '2')
16:28:35 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'PubChem' ('' -> '3672', SET '3672')
16:28:35 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Changed: 'melting_point' ('' -> '76', SET '76')
16:28:36 (3, 2, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ibuprofen (diff, hist)
Added links: http://whqlibdoc.who.int/hq/2005/a87017_eng.pdf, http://jcp.sagepub.com/cgi/reprint/32/4/317, http://www.telegraph.co.uk/health/main.jhtml?xml=/health/2007/10/08/hadams108.xml, http://www.medicine.ox.ac.uk/bandolier/booth/painpag/topical/topkin.html, http://www.ncbi.nlm.nih.gov/pubmed/6239884?ordinalpos=1&itool=EntrezSystem2.PEntrez.Pubmed.Pubmed_ResultsPanel.Pubmed_RVBrief, http://www.ingentaconnect.com/content/adis/inp/2006/00000001/00001530/art00048;jsessionid=1ghdlu0vup2pl.alice, http://ovationpharma.com/pdfs/products/product_9.pdf, http://www.nlm.nih.gov/medlineplus/druginfo/uspdi/202743.html, http://www.rsc.org/education/teachers/learnnet/green/ibuprofen/, http://www.drugs.com/newdrugs/cumberland-pharmaceuticals-announces-fda-approval-caldolor-1447.html, http://www.nytimes.com/2010/01/18/business/18drug.html, http://arthritis.webmd.com/news/20091229/tylenol-recall-expands, http://www.nlm.nih.gov/medlineplus/druginfo/meds/a682159.html, http://www.chm.bris.ac.uk/motm/ibuprofen/homepage.htm, http://www.nur
16:29:57 (3, 2, 4) (EDIT) User:Excirial (contribs, talk) edited Ibuprofen (diff, hist)
Added links: http://jcp.sagepub.com/cgi/reprint/32/4/317, http://www.telegraph.co.uk/health/main.jhtml?xml=/health/2007/10/08/hadams108.xml
16:30:26 (3, 2, 4) (EDIT) User:Excirial (contribs, talk) edited Ibuprofen (diff, hist)
Added links: http://www.medicine.ox.ac.uk/bandolier/booth/painpag/topical/topkin.html, http://www.ncbi.nlm.nih.gov/pubmed/6239884?ordinalpos=1&itool=EntrezSystem2.PEntrez.Pubmed.Pubmed_ResultsPanel.Pubmed_RVBrief, http://www.ingentaconnect.com/content/adis/inp/2006/00000001/00001530/art00048;jsessionid=1ghdlu0vup2pl.alice, http://www.fasebj.org/cgi/content/full/19/12/1592, http://ovationpharma.com/pdfs/products/product_9.pdf
16:32:10 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'realboxname' ('' -> 'drugbox')
16:32:10 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'boxname' ('' -> 'drugbox')
16:32:11 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'drug_name' ('' -> 'MDMA')
16:32:11 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'imagename' ('' -> '1 : 1 mixture (racemate) ')
16:32:11 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'CASNo_Ref' ('' -> '{{cascite}}')
16:32:12 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'image' ('' -> 'MDMA (simple).svg')
16:32:12 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'image2' ('' -> 'MDMA_animation.gif')
16:32:12 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'synonyms' ('' -> '(Â±)-1,3-benzodioxolyl-''N''-methyl-2-propanamine; (Â±)-3,4-methylenedioxy-''N''-methyl-Î±-methyl-2-phenethylamine; DL-3,4-methylenedioxy-''N''-methylamphetamine; methylenedioxymethamphetamine')
16:32:12 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'elimination_half-life' ('' -> '6â10 (though duration of effects is typically actually 3â5 hours)')
16:32:13 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'metabolism' ('' -> '[[Liver|Hepatic]], [[Cytochrome P450 oxidase|CYP450]] extensively involved, especially [[CYP2D6]]')
16:32:13 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'excretion' ('' -> '[[Kidney|Renal]]')
16:32:13 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_AU' ('' -> 'S9')
16:32:13 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_US' ('' -> 'Schedule I')
16:32:14 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_UK' ('' -> 'CD Lic')
16:32:14 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_CA' ('' -> 'Schedule III')
16:32:14 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'routes_of_administration' ('' -> '[[Oral]], [[sublingual]], [[insufflation (medicine)|insufflation]], [[inhalation]] ([[vaporization]]), [[injection]],<ref>{{cite web | title= Methylenedioxymethamphetamine (MDMA, Ecstasy) | url = http://www.nhtsa.dot.gov/people/injury/research/job185drugs/methylenedioxymethamphetamine.htm | work = Drugs and Human Performance Fact Sheets. | publisher = [[National Highway Traffic Safety Administration]] }}</ref> [[rectal (medicine)|rectal]]')
16:32:14 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'error' ('empty' -> '')
16:32:15 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'IUPAC_name' ('' -> '(''RS'')-1-(benzo[''d''][1,3]dioxol-5-yl)-''N''-methylpropan-2-amine')
16:32:15 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'molecular_weight' ('' -> '193.25 g/mol')
16:32:15 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
16:32:15 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'smiles' ('' -> 'CC(NC)CC1=CC=C(OCO2)C2=C1')
16:32:16 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'C' ('' -> '11')
16:32:16 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'H' ('' -> '15')
16:32:16 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'N' ('' -> '1')
16:32:16 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'O' ('' -> '2')
16:32:17 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'PubChem' ('' -> '1615')
16:32:17 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'ChemSpiderID' ('' -> '1556')
16:32:17 (6, 6, 6) (EDIT) User:83.28.191.125 (contribs, talk) edited MDMA (diff, hist)
Changed: 'CAS_number' ('' -> '69610-10-2')
17:26:05 (3, 2, 4) (EDIT) User:Draeco (contribs, talk) edited Meloxicam (diff, hist)
Added links: http://www.drugs.com/pro/meloxicam.html
17:29:35 (3, 2, 4) (EDIT) User:71.229.37.60 (contribs, talk) edited Naproxen (diff, hist)
Added links: http://www.nlm.nih.gov/medlineplus/druginfo/meds/a681029.html, http://druginfo.nlm.nih.gov/drugportal/dpdirect.jsp?name=Naproxen
17:38:13 (3, 2, 4) (EDIT) User:HazyM (contribs, talk) edited Diltiazem (diff, hist)
Added links: http://druginfo.nlm.nih.gov/drugportal/dpdirect.jsp?name=Diltiazem
17:43:06 (3, 2, 4) (EDIT) User:HazyM (contribs, talk) edited Risperidone (diff, hist)
Added links: http://druginfo.nlm.nih.gov/drugportal/dpdirect.jsp?name=Risperidone
17:43:20 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Norethisterone (diff, hist)
Added: 'verifiedrevid' ('' -> '309939386', SET '')
17:43:20 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Norethisterone (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')
17:48:48 (3, 2, 4) (EDIT) User:HazyM (contribs, talk) edited Ondansetron (diff, hist)
Added links: http://druginfo.nlm.nih.gov/drugportal/dpdirect.jsp?name=Ondansetron
18:01:43 (3, 2, 4) (EDIT) User:HazyM (contribs, talk) edited Epinephrine (diff, hist)
Added links: http://druginfo.nlm.nih.gov/drugportal/dpdirect.jsp?name=Epinephrine
18:13:57 (2, 4, 5) (EDIT) User:Harbinary (contribs, talk) edited Bambuterol (diff, hist)
Changed: 'image' ('Bambuterol.svg' -> 'Bambuterol-2D-skeletal.png', SET 'Bambuterol.svg')
20:43:54 (3, 2, 4) (EDIT) User:Draeco (contribs, talk) edited Meloxicam (diff, hist)
Added links: http://www.nlm.nih.gov/medlineplus/druginfo/meds/a601242.html
21:09:26 (3, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Lumiliximab (diff, hist)
Changed: 'mab_type' ('' -> 'mab')
21:09:27 (3, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Lumiliximab (diff, hist)
Changed: 'source' ('[[Fusion protein|Chimeric]]' -> 'xi')
21:09:27 (3, 2, 4) (EDIT) User:Anypodetos (contribs, talk) edited Lumiliximab (diff, hist)
Added links: http://whqlibdoc.who.int/druginfo/INN_2004_list52.pdf
21:09:30 (2, 3, 4) (EDIT) User:Citation bot (contribs, talk) edited Paclitaxel (diff, hist)
Changed: 'bioavailability' ('6.5% (oral)<ref name="bioavail">{{cite journal |journal=Pharmaceutical Research |volume=23 |issue=6 |month=June |year=2006 |doi=10.1007/s11095-006-0022-2 |pages=1243â1250 |title=Enhanced Oral Paclitaxel Bioavailability After Administration of Paclitaxel-Loaded Lipid Nanocapsules |author=Sandra Peltier, S.; Oger, J.-M., Lagarce, F.; Couet, W.; BenoÃ®t, J.-P. }}</ref>' -> '6.5% (oral)<ref name="bioavail">{{cite journal |journal=Pharmaceutical Research |volume=23 |issue=6 |month=June |year=2006 |doi=10.1007/s11095-006-0022-2 |pages=1243â1250 |title=Enhanced Oral Paclitaxel Bioavailability After Administration of Paclitaxel-Loaded Lipid Nanocapsules |author=Sandra Peltier, S.; Oger, J.-M., Lagarce, F.; Couet, W.; BenoÃ®t, J.-P. |pmid=16715372 }}</ref>')
21:43:06 (2, 3, 5) (EDIT) User:Nutsterrt (contribs, talk) edited Atomoxetine (diff, hist)
Changed: 'legal_status' ('Unscheduled (U.S.)' -> 'Rx-only')
21:43:39 (2, 3, 5) (EDIT) User:Nutsterrt (contribs, talk) edited Atomoxetine (diff, hist)
Changed: 'legal_US' ('' -> 'Rx-only')
21:43:39 (2, 3, 5) (EDIT) User:Nutsterrt (contribs, talk) edited Atomoxetine (diff, hist)
Changed: 'legal_status' ('Rx-only' -> '')
21:56:22 (2, 3, 5) (EDIT) User:89.240.175.61 (contribs, talk) edited Mephedrone (diff, hist)
Changed: 'drug_name' ('Mephedrone' -> 'Mephedrone/meow meow. MCAT')
21:59:39 (2, 3, 4) (EDIT) User:Trusilver (contribs, talk) edited Mephedrone (diff, hist)
Changed: 'drug_name' ('Mephedrone/meow meow. MCAT' -> 'Mephedrone')
22:19:18 (2, 3, 4) (EDIT) User:JÃ¼ (contribs, talk) edited Esmirtazapine (diff, hist)
Changed: 'image' ('' -> '(S)-Mirtazapin Structural Formulae.png')