Wikipedia:WikiProject Pharmacology/Log/2010-04-22

Standard header for logs from CheMoBot

00:08:01 (3, 2, 4) (EDIT) User:Ohnoitsjamie (contribs, talk) edited Dextromethorphan (diff, hist)
Added links: http://dmd.aspetjournals.org/cgi/content/full/29/11/1514, http://www.nature.com/clpt/journal/v60/n3/abs/clpt1996482a.html, http://jcp.sagepub.com/cgi/content/abstract/27/2/139
01:20:14 (2, 3, 5) (EDIT) User:Davidcx (contribs, talk) edited Agomelatine (diff, hist)
Changed: 'elimination_half-life' ('< 2 h <ref>hit and run drug</ref>' -> '< 2 h')
01:53:04 (2, 4, 5) (EDIT) User:Mleonard85032 (contribs, talk) edited Methamphetamine (diff, hist)
Added: 'dependenceliability' ('' -> 'High', SET '')
02:01:17 (2, 5, 5) (EDIT) User:Mleonard85032 (contribs, talk) edited Methamphetamine (diff, hist)
Changed: 'dependenceliability' ('High' -> '', SET '')
02:54:38 (2, 3, 5) (EDIT) User:72.178.133.248 (contribs, talk) edited Metenolone_enanthate (diff, hist)
Changed: 'legal_US' ('' -> '[[Schedule I]]')
02:55:31 (2, 3, 5) (EDIT) User:72.178.133.248 (contribs, talk) edited Metenolone_enanthate (diff, hist)
Changed: 'legal_US' ('[[Schedule I]]' -> 'Schedule I')
02:55:44 (2, 3, 5) (EDIT) User:72.178.133.248 (contribs, talk) edited Metenolone_enanthate (diff, hist)
Changed: 'legal_US' ('Schedule I' -> 'Schedule III')
02:59:52 (2, 3, 5) (EDIT) User:72.178.133.248 (contribs, talk) edited Oxymetholone (diff, hist)
Changed: 'legal_status' ('Prescription only ([[United States|US]])' -> 'Schedule III ([[United States|US]])')
05:40:31 (3, 2, 4) (EDIT) User:Chhandama (contribs, talk) edited Artemether (diff, hist)
Added links: http://www.malariajournal.com/content/8%20Suppl%201//S8, http://www.malariajournal.com/content/8%20Suppl%201//S5, http://ukpmc.ac.uk/articlerender.cgi?artid=1785774, http://dx.doi.org/10.1002/14651858.CD007483.pub2, http://www.scielosp.org/scielo.php?script=sci_arttext&pid=S0042-96862008001000015&lng=en&nrm=iso&tlng=en, http://ict.sagepub.com/cgi/pmidlookup?view=long&pmid=19174507, http://www.chinaphar.com/1671-4083/28/1045.htm
05:51:32 (3, 2, 4) (EDIT) User:Chhandama (contribs, talk) edited Artemisinin (diff, hist)
Added links: http://clincancerres.aacrjournals.org/cgi/pmidlookup?view=long&pmid=18765544
06:30:11 (2, 3, 5) (EDIT) User:90.146.115.9 (contribs, talk) edited Indacaterol (diff, hist)
Changed: 'width' ('300px' -> '200px')
07:35:59 (4, 3, 5) (EDIT) User:59.93.54.99 (contribs, talk) edited Technetium_(99mTc)_sestamibi (diff, hist)
Changed: 'IUPAC_name' ('Hexakis(2-methoxy-2-methylpropylisonitrile) technetium (99mTc)' -> 'Hxakis(2-methoxy-2-methylpropylisonitrile) technetium (99mTc)')
08:30:20 (3, 2, 4) (EDIT) User:Drpvfx (contribs, talk) edited Pregabalin (diff, hist)
Added links: http://www.fda.gov/bbs/topics/NEWS/2007/NEW01656.html
08:33:30 (3, 2, 4) (EDIT) User:Drpvfx (contribs, talk) edited Pregabalin (diff, hist)
Added links: http://www.livestrong.com/article/71990-side-effects-lyrica/
10:30:07 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited DALT (diff, hist)
Changed: 'image' ('' -> 'DALT-structure.png')
10:48:14 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Naphthylpiperazine (diff, hist)
Changed: 'image' ('1-(naphthalen-1-yl)piperazine.png' -> 'Naphthylpiperazine.png')
11:03:20 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Piquindone (diff, hist)
Changed: 'image' ('Piquindone-structure.png' -> 'Piquindone.png')
12:42:35 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Naphyrone (diff, hist)
Changed: 'legal_status' ('' -> 'Uncontrolled')
12:42:36 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Naphyrone (diff, hist)
Changed: 'pregnancy_AU' ('' -> '')
12:42:36 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Naphyrone (diff, hist)
Changed: 'pregnancy_US' ('' -> '')
12:42:36 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Naphyrone (diff, hist)
Changed: 'legal_AU' ('' -> '')
12:42:36 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Naphyrone (diff, hist)
Changed: 'legal_CA' ('' -> '')
12:42:37 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Naphyrone (diff, hist)
Changed: 'legal_UK' ('' -> '')
12:42:37 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Naphyrone (diff, hist)
Changed: 'legal_US' ('' -> '')
12:42:37 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Naphyrone (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
12:42:37 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Naphyrone (diff, hist)
Changed: 'ChemSpiderID' ('' -> '9418039')
13:28:10 (3, 2, 4) (EDIT) User:Scientizzle (contribs, talk) edited Vicodin (diff, hist)
Added links: http://www.rxlist.com/vicodin-drug.htm
13:41:39 (3, 2, 4) (EDIT) User:HazyM (contribs, talk) edited Ciclosporin (diff, hist)
Added links: http://druginfo.nlm.nih.gov/drugportal/dpdirect.jsp?name=Ciclosporine
14:39:34 (2, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'realboxname' ('drugbox' -> '')
14:39:35 (2, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'boxname' ('drugbox' -> '')
14:39:36 (2, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'width' ('250' -> '')
14:39:36 (2, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'image' ('Esomeprazol-Strukturformel.png' -> '')
14:39:36 (2, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'S' ('1' -> '')
14:39:36 (2, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'bioavailability' ('50 to 90%' -> '')
14:39:37 (2, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'metabolism' ('[[Liver|Hepatic]] ([[CYP2C19]], [[CYP3A4]])' -> '')
14:39:38 (2, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'elimination_half-life' ('1â1.5 hours' -> '')
14:39:39 (2, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'excretion' ('80% [[Kidney|Renal]] 20% [[Feces|Faecal]]' -> '')
14:39:40 (2, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'pregnancy_US' ('B' -> '')
14:39:41 (2, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'pregnancy_AU' ('B3' -> '')
14:39:41 (2, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'legal_AU' ('S4' -> '')
14:39:42 (2, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'legal_UK' ('POM' -> '')
14:39:42 (2, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'legal_US' ('Rx-only' -> '')
14:39:42 (4, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'IUPAC_name' ('(''S'')-5-methoxy-2-[(4-methoxy-3,5-dimethylpyridin-2-yl) methylsulfinyl]-3''H''-benzoimidazole' -> '')
14:39:43 (4, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'molecular_weight' ('345.417 g/mol' -> '')
14:39:44 (4, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'DrugBank' ('APRD00363' -> '')
14:39:45 (4, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'ATC_prefix' ('A02' -> '')
14:39:45 (4, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'ATC_suffix' ('BC05' -> '')
14:39:45 (4, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'smiles' ('COc1ccc2nc([nH]c2c1)S(=O)Cc1ncc(C)c(OC)c1C' -> '')
14:39:46 (4, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'C' ('17' -> '')
14:39:47 (4, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'H' ('19' -> '')
14:39:48 (4, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'N' ('3' -> '')
14:39:48 (4, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'O' ('3' -> '')
14:39:48 (4, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'PubChem' ('4594' -> '')
14:39:49 (4, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'ChemSpiderID' ('7843322' -> '')
14:39:50 (5, 3, 5) (EDIT) User:64.125.157.6 (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'CAS_number' ('119141-88-7' -> '')
14:40:01 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'realboxname' ('' -> 'drugbox')
14:40:02 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'boxname' ('' -> 'drugbox')
14:40:03 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'width' ('' -> '250')
14:40:04 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'image' ('' -> 'Esomeprazol-Strukturformel.png')
14:40:04 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'S' ('' -> '1')
14:40:04 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'bioavailability' ('' -> '50 to 90%')
14:40:04 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'metabolism' ('' -> '[[Liver|Hepatic]] ([[CYP2C19]], [[CYP3A4]])')
14:40:05 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'elimination_half-life' ('' -> '1â1.5 hours')
14:40:06 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'excretion' ('' -> '80% [[Kidney|Renal]] 20% [[Feces|Faecal]]')
14:40:07 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'pregnancy_US' ('' -> 'B')
14:40:07 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'pregnancy_AU' ('' -> 'B3')
14:40:07 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'legal_AU' ('' -> 'S4')
14:40:07 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'legal_UK' ('' -> 'POM')
14:40:08 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'legal_US' ('' -> 'Rx-only')
14:40:08 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'error' ('empty' -> '')
14:40:09 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'IUPAC_name' ('' -> '(''S'')-5-methoxy-2-[(4-methoxy-3,5-dimethylpyridin-2-yl) methylsulfinyl]-3''H''-benzoimidazole')
14:40:10 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'molecular_weight' ('' -> '345.417 g/mol')
14:40:10 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'DrugBank' ('' -> 'APRD00363')
14:40:11 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'ATC_prefix' ('' -> 'A02')
14:40:11 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'ATC_suffix' ('' -> 'BC05')
14:40:11 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'smiles' ('' -> 'COc1ccc2nc([nH]c2c1)S(=O)Cc1ncc(C)c(OC)c1C')
14:40:12 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'C' ('' -> '17')
14:40:12 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'H' ('' -> '19')
14:40:12 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'N' ('' -> '3')
14:40:12 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'O' ('' -> '3')
14:40:13 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'PubChem' ('' -> '4594')
14:40:13 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'ChemSpiderID' ('' -> '7843322')
14:40:14 (6, 6, 6) (EDIT) User:Immunize (contribs, talk) edited Esomeprazole (diff, hist)
Changed: 'CAS_number' ('' -> '119141-88-7')
15:24:30 (2, 4, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Phendimetrazine (diff, hist)
Changed: 'metabolism' ('hepatic' -> 'Hepatic', SET 'hepatic')
15:24:30 (4, 4, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Phendimetrazine (diff, hist)
Added: 'DrugBank' ('' -> 'DB01579', SET '')
15:24:31 (4, 4, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Phendimetrazine (diff, hist)
Added: 'smiles' ('' -> 'O2C(c1ccccc1)C(N(C)CC2)C', SET '')
15:24:31 (4, 4, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Phendimetrazine (diff, hist)
Added: 'ChemSpiderID' ('' -> '11950', SET '')
16:48:32 (3, 2, 4) (EDIT) User:Literaturegeek (contribs, talk) edited Diazepam (diff, hist)
Added links: [https://doi.org/10.1007%2Fs00109-009-0454-3 DOI.org]
19:06:46 (3, 2, 4) (EDIT) User:Boston2austin (contribs, talk) edited Natalizumab (diff, hist)
Added links: http://www.webmd.com/multiple-sclerosis/news/20080801/ms-drug-tysabri-tied-to-brain-infection
20:01:14 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited 5-IAI (diff, hist)
Changed: 'pregnancy_category' ('' -> '?')
20:06:22 (3, 2, 4) (EDIT) User:El3ctr0nika (contribs, talk) edited MMAI (diff, hist)
Added links: http://www.thrivechem.com/latest-research-chemicals-2-c.asp
21:45:14 (3, 2, 4) (EDIT) User:Amandaaaaa123 (contribs, talk) edited Paracetamol (diff, hist)
Added links: http://www.medicinenet.com/acetaminophen/article.htm
21:53:47 (3, 2, 4) (EDIT) User:76.3.209.118 (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Added links: http://rrlobbychat.tk/
23:00:14 (2, 3, 5) (EDIT) User:Yid (contribs, talk) edited Acadesine (diff, hist)
Changed: 'image' ('Acadesine.png' -> 'Acadesine structure.png')
23:01:27 (3, 2, 4) (EDIT) User:Off2riorob (contribs, talk) edited Methamphetamine (diff, hist)
Added links: http://jpet.aspetjournals.org/cgi/content/full/287/1/107
23:23:12 (3, 2, 4) (EDIT) User:Kirsten.Thompson (contribs, talk) edited Monobenzone (diff, hist)
Added links: http://www.whiterskin.info/skin-bleaching-with-monobenzone/comment-page-1/