Wikipedia:WikiProject Pharmacology/Log/2010-03-08

Standard header for logs from CheMoBot

03:02:24 (2, 4, 4) (EDIT) User:CommonsDelinker (contribs, talk) edited Loratadine (diff, hist)
Changed: 'image' ('Loraradine.svg' -> 'Loratadine.svg', SET 'Loratadin.svg')
04:06:32 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited 1-(2-Pyrimidinyl)piperazine (diff, hist)
Changed: 'image' ('pyrimidinylpiperazine.png' -> 'Pyrimidinylpiperazine.png')
04:06:33 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited 1-(2-Pyrimidinyl)piperazine (diff, hist)
Changed: 'chemical_formula' ('C8H12N4' -> '')
04:06:34 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited 1-(2-Pyrimidinyl)piperazine (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
04:06:35 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited 1-(2-Pyrimidinyl)piperazine (diff, hist)
Changed: 'C' ('' -> '8')
04:06:36 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited 1-(2-Pyrimidinyl)piperazine (diff, hist)
Changed: 'H' ('' -> '12')
04:06:37 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited 1-(2-Pyrimidinyl)piperazine (diff, hist)
Changed: 'N' ('' -> '4')
04:45:54 (3, 2, 4) (EDIT) User:El3ctr0nika (contribs, talk) edited Dextrorphan (diff, hist)
Added links: http://jpet.aspetjournals.org/cgi/pmidlookup?view=long&pmid=7562497, http://jpet.aspetjournals.org/cgi/pmidlookup?view=long&pmid=7562497, http://jpet.aspetjournals.org/cgi/pmidlookup?view=long&pmid=7562497
04:47:25 (3, 2, 4) (EDIT) User:El3ctr0nika (contribs, talk) edited Dextromethorphan (diff, hist)
Added links: http://jpet.aspetjournals.org/cgi/pmidlookup?view=long&pmid=7562497, http://jpet.aspetjournals.org/cgi/pmidlookup?view=long&pmid=7562497, http://jpet.aspetjournals.org/cgi/pmidlookup?view=long&pmid=7562497
05:28:20 (3, 2, 4) (EDIT) User:Editor182 (contribs, talk) edited Dutasteride (diff, hist)
Added links: http://www.drugs.com/avodart.html
06:00:12 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Antrafenine (diff, hist)
Added: 'verifiedrevid' ('' -> '292865671', SET '')
06:00:13 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Antrafenine (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')
06:01:16 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Bifeprunox (diff, hist)
Changed: 'verifiedrevid' ('321994628' -> '330864114', SET '321994628')
07:43:54 (2, 4, 5) (EDIT) User:75.37.26.45 (contribs, talk) edited Atracurium (diff, hist)
Changed: 'metabolism' ('[[Hofmann elimination|Hofmann elimination (retro-Michael addition)]] and [[ester hydrolysis]]' -> '[[Hofmann elimination|Hofmann elimination (retro-Michael addition)]] and [[ester]][[hydrolysis]]', SET '[[Hofmann elimination|Hofmann elimination (retro-Michael addition)]] and [[ester hydrolysis]]')
08:28:05 (2, 4, 5) (EDIT) User:Ssp37097 (contribs, talk) edited Atracurium (diff, hist)
Changed: 'metabolism' ('[[Hofmann elimination|Hofmann elimination (retro-Michael addition)]] and [[ester]][[hydrolysis]]' -> '[[Hofmann elimination|Hofmann elimination (retro-Michael addition)]] and [[ester]] [[hydrolysis]]', SET '[[Hofmann elimination|Hofmann elimination (retro-Michael addition)]] and [[ester hydrolysis]]')
09:01:24 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Ganaxolone (diff, hist)
Changed: 'legal_status' ('Investigational New Drug' -> 'investigational')
09:01:25 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Ganaxolone (diff, hist)
Changed: 'synonyms' ('1-[(3''R'',5''S'',8''R'',9''S'',10''S'',13''S'',14''S'',17''S'')-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[''a'']phenanthren-17-yl]ethanone' -> '')
09:01:25 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Ganaxolone (diff, hist)
Changed: 'IUPAC_name' ('(3Î±,5Î±)-3-hydroxy-5-methylpregnan-20-one' -> '(3Î±,5Î±)-3-hydroxy-5-methylpregnan-20-one; 1-[(3''R'',5''S'',8''R'',9''S'',10''S'',13''S'',14''S'',17''S'')-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[''a'']phenanthren-17-yl]ethanone')
10:15:49 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Retigabine (diff, hist)
Changed: 'legal_status' ('Uncontrolled' -> 'uncontrolled')
10:22:22 (3, 2, 4) (EDIT) User:Jediboyuk (contribs, talk) edited Oxprenolol (diff, hist)
Added links: http://www.ncbi.nlm.nih.gov/pmc/articles/PMC471246/?page=1
10:35:30 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Deramciclane (diff, hist)
Changed: 'pregnancy_AU' ('' -> '')
10:35:30 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Deramciclane (diff, hist)
Changed: 'pregnancy_US' ('' -> '')
10:35:31 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Deramciclane (diff, hist)
Changed: 'legal_AU' ('' -> '')
10:35:31 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Deramciclane (diff, hist)
Changed: 'IUPAC_name' ('N,N-dimethyl-2-([(1R,4R,6S)-1,7,7-trimethyl-6-phenyl-6-bicyclo[2.2.1]heptanyl]oxy)ethanamine' -> '''N'',''N''-dimethyl-2-([(1''R'',4''R'',6''S'')-1,7,7-trimethyl-6-phenyl-6-bicyclo[2.2.1]heptanyl]oxy)ethanamine')
11:16:01 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Losigamone (diff, hist)
Changed: 'PubChem' ('' -> '6918049')
14:36:50 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Dexetimide (diff, hist)
Changed: 'InChI' ('' -> '1/C23H26N2O2/c26-21-11-14-23(22(27)24-21,19-9-5-2-6-10-19)20-12-15-25(16-13-20)17-18-7-3-1-4-8-18/h1-10,20H,11-17H2,(H,24,26,27)')
14:36:50 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Dexetimide (diff, hist)
Changed: 'InChIKey' ('' -> 'LQQIVYSCPWCSSD-UHFFFAOYAB')
14:36:50 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Dexetimide (diff, hist)
Changed: 'smiles' ('' -> 'O=C2NC(=O)CCC2(c1ccccc1)C4CCN(Cc3ccccc3)CC4')
14:36:51 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Dexetimide (diff, hist)
Changed: 'ChemSpiderID' ('' -> '20533')
14:49:09 (3, 2, 4) (EDIT) User:Grossus (contribs, talk) edited Ocrelizumab (diff, hist)
Added links: http://www.reuters.com/article/idUSLDE62705720100308
15:06:56 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Tolevamer (diff, hist)
Changed: 'bioavailability' ('Not significantly absorbed from the gut' -> 'not significantly absorbed from the gut')
15:06:57 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Tolevamer (diff, hist)
Changed: 'metabolism' ('Not metabolised' -> 'not metabolised')
15:06:57 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Tolevamer (diff, hist)
Changed: 'legal_status' ('Investigational' -> 'development terminated')
15:06:57 (5, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Tolevamer (diff, hist)
Changed: 'CAS_number' ('' -> '28210-41-5')
15:24:21 (4, 4, 5) (EDIT) User:Pioru (contribs, talk) edited Felodipine (diff, hist)
Changed: 'molecular_weight' ('383.069 g/mol' -> '384.259 g/mol', SET '383.069 g/mol')
15:25:27 (3, 2, 4) (EDIT) User:64.252.209.191 (contribs, talk) edited Hydrocodone (diff, hist)
Added links: http://www.medpagetoday.com/ProductAlert/Prescriptions/6815
15:34:39 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Felodipine (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
15:34:50 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Technetium_(99mTc)_arcitumomab (diff, hist)
Changed: 'CAS_supplemental' ('' -> '(arcitumomab)')
15:45:06 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Technetium_(99mTc)_arcitumomab (diff, hist)
Added: 'verifiedrevid' ('' -> '348536691', SET '')
15:45:06 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Technetium_(99mTc)_arcitumomab (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')
16:30:15 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Propantheline_bromide (diff, hist)
Added: 'verifiedrevid' ('' -> '300088242', SET '')
16:30:15 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Propantheline_bromide (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')
16:30:35 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Methantheline (diff, hist)
Added: 'verifiedrevid' ('' -> '260154270', SET '')
16:30:36 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Methantheline (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')
16:41:42 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Oxyphenonium_bromide (diff, hist)
Added: 'verifiedrevid' ('' -> '300979549', SET '')
16:41:42 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Oxyphenonium_bromide (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')
16:54:24 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tridihexethyl (diff, hist)
Added: 'verifiedrevid' ('' -> '300766223', SET '')
16:54:24 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tridihexethyl (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')
17:29:46 (3, 2, 4) (EDIT) User:Redblk (contribs, talk) edited Exenatide (diff, hist)
Added links: http://newsroom.lilly.com/releasedetail.cfm?releaseid=420602
18:10:39 (3, 2, 4) (EDIT) User:143.117.157.60 (contribs, talk) edited Cediranib (diff, hist)
Added links: http://www.astrazeneca.com/media/latest-press-releases/2010-new/recoentin-horizon?itemId=8748245
18:21:27 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Cediranib (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
18:21:27 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Cediranib (diff, hist)
Added: 'verifiedrevid' ('' -> '251425352', SET '')
18:21:28 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Cediranib (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')
18:34:35 (3, 2, 4) (EDIT) User:128.218.39.82 (contribs, talk) edited Dihydrotestosterone (diff, hist)
Added links: http://www.americanhairloss.org/women_hair_loss/causes_of_hair_loss.asp
20:12:25 (3, 2, 4) (EDIT) User:Rod57 (contribs, talk) edited Zalutumumab (diff, hist)
Added links: http://www.genengnews.com/news/bnitem.aspx?name=77261239
21:04:23 (2, 4, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Carvedilol (diff, hist)
Added: 'Verifiedrevid' ('' -> '322103957', SET '')
21:04:23 (2, 4, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Carvedilol (diff, hist)
Added: 'Drug_name' ('' -> 'Carvedilol', SET '')
21:04:23 (2, 4, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Carvedilol (diff, hist)
Changed: 'metabolism' ('[[hepatic]] ([[CYP2D6]], [[CYP2C9]])' -> '[[Liver]] ([[CYP2D6]], [[CYP2C9]])', SET '[[hepatic]] ([[CYP2D6]], [[CYP2C9]])')
21:04:24 (2, 4, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Carvedilol (diff, hist)
Changed: 'excretion' ('[[renal]] 16%, [[feces|faecal]] 60%' -> '[[Urine]] (16%), [[Feces]] (60%)', SET '[[renal]] 16%, [[feces|faecal]] 60%')
21:04:24 (2, 4, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Carvedilol (diff, hist)
Added: 'pregnancy_category' ('' -> 'C', SET '')
21:04:25 (2, 4, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Carvedilol (diff, hist)
Added: 'legal_status' ('' -> 'Rx-only', SET '')
21:04:25 (2, 5, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Carvedilol (diff, hist)
Deleted: 'verifiedrevid' ('322103957' -> '', SET '303529607')
21:04:25 (2, 5, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Carvedilol (diff, hist)
Changed: 'drug_name' ('Carvedilol' -> '', SET '')
21:04:25 (2, 5, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Carvedilol (diff, hist)
Changed: 'width' ('220' -> '', SET '')
21:04:26 (2, 5, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Carvedilol (diff, hist)
Deleted: 'pregnancy_AU' ('C' -> '', SET 'C')
21:04:26 (2, 5, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Carvedilol (diff, hist)
Deleted: 'pregnancy_US' ('C' -> '', SET 'C')
21:04:26 (2, 5, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Carvedilol (diff, hist)
Deleted: 'legal_AU' ('S4' -> '', SET 'S4')
21:04:26 (2, 5, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Carvedilol (diff, hist)
Deleted: 'legal_UK' ('POM' -> '', SET 'POM')
21:04:27 (2, 5, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Carvedilol (diff, hist)
Deleted: 'legal_US' ('Rx-only' -> '', SET 'Rx-only')
21:04:27 (4, 5, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Carvedilol (diff, hist)
Changed: 'IUPAC_name' ('(''RS'')-[3-(9''H''-carbazol-4-yloxy)-2-hydroxypropyl][2-(2-methoxyphenoxy)ethyl]amine' -> '(Â±)-[3-(9''H''-carbazol-4-yloxy)-2-hydroxypropyl][2-(2-methoxyphenoxy)ethyl]amine', SET '(''RS'')-[3-(9''H''-carbazol-4-yloxy)-2-hydroxypropyl][2-(2-methoxyphenoxy)ethyl]amine')
21:06:33 (2, 5, 4) (EDIT) User:ChemNerd (contribs, talk) edited Nimodipine (diff, hist)
Deleted: 'image2' ('Nimodipine.gif' -> '', SET 'Nimodipine.gif')
21:06:33 (2, 5, 4) (EDIT) User:ChemNerd (contribs, talk) edited Nimodipine (diff, hist)
Changed: 'width2' ('194' -> '', SET '')
21:07:28 (2, 4, 4) (EDIT) User:ChemNerd (contribs, talk) edited Carprofen (diff, hist)
Added: 'drug_name' ('' -> 'Carprofen', SET '')
21:07:29 (2, 4, 4) (EDIT) User:ChemNerd (contribs, talk) edited Carprofen (diff, hist)
Changed: 'image' ('(Â±)-Carprofen Enantiomers Structural Formulae.png' -> 'Carprofen.svg', SET '(Â±)-Carprofen Enantiomers Structural Formulae.png')
21:15:02 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Carvedilol (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
21:15:02 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Carvedilol (diff, hist)
Changed: 'verifiedrevid' ('' -> '322103957', SET '303529607')
21:15:03 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Carvedilol (diff, hist)
Changed: 'Verifiedrevid' ('322103957' -> '', SET '')
21:15:42 (2, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited Fenethylline (diff, hist)
Changed: 'image' ('(Â±)-Fenethylline Enantiomers Structural Formulae.png' -> 'Fenethylline.svg')
21:15:42 (2, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited Fenethylline (diff, hist)
Changed: 'bioavailability' ('?' -> '')
21:15:43 (2, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited Fenethylline (diff, hist)
Changed: 'metabolism' ('?' -> '')
21:15:43 (2, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited Fenethylline (diff, hist)
Changed: 'elimination_half-life' ('?' -> '')
21:15:43 (2, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited Fenethylline (diff, hist)
Changed: 'excretion' ('?' -> '')
21:15:43 (2, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited Fenethylline (diff, hist)
Changed: 'pregnancy_category' ('?' -> '')
21:18:20 (2, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited Fenethylline (diff, hist)
Changed: 'width' ('300px' -> '200px')
21:30:37 (2, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited Mirtazapine (diff, hist)
Changed: 'image' ('Mirtazapine structure.svg' -> 'Mirtazapin.svg')
21:30:37 (2, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited Mirtazapine (diff, hist)
Changed: 'width' ('280' -> '150')
21:58:14 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Ajmaline (diff, hist)
Changed: 'pregnancy_AU' ('' -> '')
21:58:15 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Ajmaline (diff, hist)
Changed: 'pregnancy_US' ('' -> '')
21:58:15 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Ajmaline (diff, hist)
Changed: 'legal_AU' ('' -> '')
21:58:15 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Ajmaline (diff, hist)
Changed: 'legal_UK' ('' -> '')
21:58:15 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Ajmaline (diff, hist)
Changed: 'legal_US' ('' -> '')
22:04:49 (2, 3, 4) (EDIT) User:JÃ¼ (contribs, talk) edited Gepefrine (diff, hist)
Changed: 'imagename' ('' -> '1 : 1 mixture (racemate) ')
22:04:50 (2, 3, 4) (EDIT) User:JÃ¼ (contribs, talk) edited Gepefrine (diff, hist)
Changed: 'width' ('' -> '200px')
22:05:50 (2, 4, 4) (EDIT) User:JÃ¼ (contribs, talk) edited Fenoldopam (diff, hist)
Added: 'imagename' ('' -> '1 : 1 mixture (racemate) ', SET '')
22:05:50 (2, 4, 4) (EDIT) User:JÃ¼ (contribs, talk) edited Fenoldopam (diff, hist)
Added: 'width' ('' -> '200px', SET '')
22:05:51 (4, 4, 4) (EDIT) User:JÃ¼ (contribs, talk) edited Fenoldopam (diff, hist)
Changed: 'IUPAC_name' ('6-chloro-1-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol' -> '(''RS'')-6-chloro-1-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol', SET '6-chloro-1-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1''H''-3-benzazepine-7,8-diol')
22:06:41 (2, 4, 4) (EDIT) User:JÃ¼ (contribs, talk) edited Oxprenolol (diff, hist)
Added: 'imagename' ('' -> '1 : 1 mixture (racemate) ', SET '')
22:06:41 (2, 4, 4) (EDIT) User:JÃ¼ (contribs, talk) edited Oxprenolol (diff, hist)
Added: 'width' ('' -> '200px', SET '')
22:10:19 (3, 2, 4) (EDIT) User:217.83.106.158 (contribs, talk) edited Besilesomab (diff, hist)
Added links: http://www.ema.europa.eu/pdfs/human/opinion/Scintimun_64930609en.pdf
22:14:00 (3, 2, 4) (EDIT) User:CliffC (contribs, talk) edited Oseltamivir (diff, hist)
Added links: http://www.forbes.com/feeds/afx/2007/04/05/afx3585482.html, http://www.forbes.com/feeds/afx/2007/04/05/afx3585631.html
23:25:40 (3, 2, 4) (EDIT) User:HazyM (contribs, talk) edited Buprenorphine (diff, hist)
Added links: http://druginfo.nlm.nih.gov/drugportal/dpdirect.jsp?name=Buprenorphine