Wikipedia:WikiProject Pharmacology/Log/2009-12-26
Standard header for logs from CheMoBot
15:38:14 (3, 2, 4) (EDIT) User:Anypodetos (contribs, talk) edited Eritoran (diff, hist)
Added links: http://www.medinewsdirect.com/?p=303, http://www.pharmazeutische-zeitung.de/index.php?id=4546, http://www.ncbi.nlm.nih.gov/sites/entrez?Db=gene&Cmd=ShowDetailView&TermToSearch=709918:44:03 (4, 4, 4) (EDIT) User:Anypodetos (contribs, talk) edited Diclofenac (diff, hist)
Changed: 'ATC_prefix' ('M01' -> 'D11', SET 'M01')18:44:03 (4, 4, 4) (EDIT) User:Anypodetos (contribs, talk) edited Diclofenac (diff, hist)
Changed: 'ATC_suffix' ('AB05' -> 'AX18', SET 'AB05')18:44:03 (4, 4, 4) (EDIT) User:Anypodetos (contribs, talk) edited Diclofenac (diff, hist)
Changed: 'ATC_supplemental' ('{{ATC|M02|AA15}},{{ATC|S01|BC03}}' -> ',{{ATC|M01|AB05}},{{ATC|M02|AA15}},{{ATC|S01|BC03}}', SET '{{ATC|M02|AA15}},{{ATC|S01|BC03}}')18:48:26 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Tacrolimus (diff, hist)
Changed: 'IUPAC_name' ('3S-[3R<sup>*</sup>[E(1S<sup>*</sup>,3S<sup>*</sup>,4S<sup>*</sup>)]<br>,4S<sup>*</sup>,5R<sup>*</sup>,8S<sup>*</sup>,9E,12R<sup>*</sup>,14R<sup>*</sup>,15S<sup>*</sup>,16R<sup>*</sup>,18S<sup>*</sup>,19S<sup>*</sup>,26aR<sup>*</sup>]]<br>-5,6,8,11,12,13,14,15,16,17,18,19,24,25,26,26a<br>-hexadecahydro-5, 19-dihydroxy<br>-3-[2-(4-hydroxy-3-methoxycyclohexyl)<br>-1-methylethenyl]-14,16-dimethoxy<br>-4,10,12,18-tetramethyl-8-(2-propenyl)<br>-15,19-epoxy-3H-pyrido[2,1-c] [1,4] oxaazacyclotricosine-1,7,20,21(4H,23H)<br>-tetrone, monohydrate| image = Tacrolimus-Armistead-2D-skeletal.png| width = 250px| image2 = Tacrolimus-3D-sticks.png| width2 = 250px| CAS_number = 104987-11-3| ChemSpiderID = 4976056| ATC_prefix = L04 | ATC_suffix = AD02| ATC_supplemental={{ATC|D11|AX14}}| PubChem = 656830| DrugBank = APRD00276| C=44 | H=69 | N=1 | O=12| molecular_weight = 804.018 g/mol | smiles = C=CC[C@@H]1C=C(C)C[C@H](C)C[C@H](OC)[C@H]2O[C@](O)([C@H](C)C[C@@H]2OC)C(=O) C(=O)N2CCCC[C@H]2C(=O)O[C@H](\C(=C\[C@@H]2CC[C@@H](O)[C@H](OC)C2)/C)[C@H](C )[C@@H](O)CC1=O| bioavailability = 20%, less after eating food rich in fat| protein_bound =75-99%| metabolism = Hepatic [[CYP3A4]]| elimination_half-life = 11.3 hours (range 3.5-40.6 hours)| excretion = Mostly faecal| pregnancy_category = C| legal_status = | routes_of_administration = Topical, oral, [[Intravenous' -> '3S-[3R<sup>*</sup>[E(1S<sup>*</sup>,3S<sup>*</sup>,4S<sup>*</sup>)]<br>,4S<sup>*</sup>,5R<sup>*</sup>,8S<sup>*</sup>,9E,12R<sup>*</sup>,14R<sup>*</sup>,15S<sup>*</sup>,16R<sup>*</sup>,18S<sup>*</sup>,19S<sup>*</sup>,26aR<sup>*</sup>]]<br>-5,6,8,11,12,13,14,15,16,17,18,19,24,25,26,26a<br>-hexadecahydro-5, 19-dihydroxy<br>-3-[2-(4-hydroxy-3-methoxycyclohexyl)<br>-1-methylethenyl]-14,16-dimethoxy<br>-4,10,12,18-tetramethyl-8-(2-propenyl)<br>-15,19-epoxy-3H-pyrido[2,1-c] [1,4] oxaazacyclotricosine-1,7,20,21(4H,23H)<br>-tetrone, monohydrate| image = Tacrolimus-Armistead-2D-skeletal.png| width = 250px| image2 = Tacrolimus-3D-sticks.png| width2 = 250px| CAS_number = 10498- 18:52:22 (3, 2, 4) (EDIT) User:Flyingonempty (contribs, talk) edited Oxycodone (diff, hist)
Added links: http://en.wikipedia.org/skins-1.5/common/images/button_headline.png 18:54:37 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Diclofenac (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')18:59:13 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Pimecrolimus (diff, hist)
Changed: 'ATC_suffix' ('AX15' -> 'AH02')19:03:50 (4, 4, 4) (EDIT) User:Anypodetos (contribs, talk) edited Cromoglicic_acid (diff, hist)
Changed: 'ATC_prefix' ('R03' -> 'A07', SET 'R03')19:03:50 (4, 4, 4) (EDIT) User:Anypodetos (contribs, talk) edited Cromoglicic_acid (diff, hist)
Changed: 'ATC_suffix' ('BC01' -> 'EB01', SET 'BC01')19:03:51 (4, 4, 4) (EDIT) User:Anypodetos (contribs, talk) edited Cromoglicic_acid (diff, hist)
Changed: 'ATC_supplemental' ('{{ATC|R01|AC01}}{{ATC|A07|EB01}}{{ATC|D11|AX17}}' -> '{{ATC|D11|AH03}}{{ATC|R01|AC01}}{{ATC|R03|BC01}}{{ATC|S01|GX01}}', SET '{{ATC|R01|AC01}}{{ATC|A07|EB01}}{{ATC|D11|AX17}}')19:10:23 (4, 4, 4) (EDIT) User:Anypodetos (contribs, talk) edited Bazedoxifene (diff, hist)
Changed: 'ATC_suffix' ('XC <!-- XC02 isn't in use yet - no FDA approval -->' -> 'XC02', SET 'XC <!-- XC02 isn't in use yet - no FDA approval -->')19:14:18 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Dapoxetine (diff, hist)
Changed: 'ATC_prefix' ('none' -> 'G04')19:14:18 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Dapoxetine (diff, hist)
Changed: 'ATC_suffix' ('' -> 'BX14')19:14:58 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Silodosin (diff, hist)
Changed: 'ATC_prefix' ('none' -> 'G04')19:14:58 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Silodosin (diff, hist)
Changed: 'ATC_suffix' ('' -> 'CA04')19:16:25 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Cromoglicic_acid (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')19:20:35 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Bazedoxifene (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')20:08:35 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Bendamustine (diff, hist)
Changed: 'ATC_prefix' ('none' -> 'L01')20:08:35 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Bendamustine (diff, hist)
Changed: 'ATC_suffix' ('' -> 'AA09')20:11:26 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Pralatrexate (diff, hist)
Changed: 'ATC_prefix' ('none' -> 'L01')20:11:26 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Pralatrexate (diff, hist)
Changed: 'ATC_suffix' ('' -> 'BA05')20:13:44 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Vinflunine (diff, hist)
Changed: 'ATC_prefix' ('none' -> 'L01')20:13:44 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Vinflunine (diff, hist)
Changed: 'ATC_suffix' ('' -> 'CA05')20:17:41 (4, 4, 4) (EDIT) User:Anypodetos (contribs, talk) edited Everolimus (diff, hist)
Changed: 'ATC_prefix' ('L04' -> 'L01', SET 'L04')20:17:41 (4, 4, 4) (EDIT) User:Anypodetos (contribs, talk) edited Everolimus (diff, hist)
Changed: 'ATC_suffix' ('AA18' -> 'XE10', SET 'AA18')20:17:41 (4, 4, 4) (EDIT) User:Anypodetos (contribs, talk) edited Everolimus (diff, hist)
Added: 'ATC_supplemental' ('' -> '{{ATC|L04|AA18}}', SET '')20:28:10 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Everolimus (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')21:42:35 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Eperisone (diff, hist)
Changed: 'IUPAC_name' ('1-(4-ethylphenyl)-2-methyl-3-(1-piperidyl)propan-1-one' -> '(''2RS'')-1-(4-ethylphenyl)-2-methyl-3-(1-piperidyl)propan-1-one')21:42:36 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Eperisone (diff, hist)
Changed: 'ATC_prefix' ('none' -> 'M03')21:42:36 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Eperisone (diff, hist)
Changed: 'ATC_suffix' ('' -> 'BX09')21:59:43 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Carisbamate (diff, hist)
Changed: 'ATC_prefix' ('none' -> 'N03')21:59:44 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Carisbamate (diff, hist)
Changed: 'ATC_suffix' ('' -> 'AX19')22:05:55 (4, 4, 4) (EDIT) User:Anypodetos (contribs, talk) edited Flurbiprofen (diff, hist)
Changed: 'ATC_supplemental' ('{{ATC|M02|AA19}},{{ATC|S01|BC04}}' -> ',{{ATC|M02|AA19}},{{ATC|R02|AX01}},{{ATC|S01|BC04}}', SET '{{ATC|M02|AA19}},{{ATC|S01|BC04}}')22:12:04 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Dexmethylphenidate (diff, hist)
Changed: 'ATC_suffix' ('BA04' -> 'BA11')22:16:16 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Flurbiprofen (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')22:16:16 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Flurbiprofen (diff, hist)
Added: 'verifiedrevid' ('' -> '311432002', SET '')22:16:17 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Flurbiprofen (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')22:20:36 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Meptazinol (diff, hist)
Changed: 'imagename' ('<!-- else may use drug_name -->' -> '1 : 1 mixture (racemate)<br />')22:20:36 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Meptazinol (diff, hist)
Changed: 'synonyms' ('Meptid' -> '')22:20:36 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Meptazinol (diff, hist)
Changed: 'metabolism' ('The peak analgesic effect is seen within 30-60 minutes and lasts about 3-4 hours.' -> 'The peak analgesic effect is seen within 30â60 minutes and lasts about 3â4 hours.')22:20:36 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Meptazinol (diff, hist)
Changed: 'elimination_half-life' ('Half-Life (1.4-4 hours).' -> 'Half-Life (1.4â4 hours).')22:20:36 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Meptazinol (diff, hist)
Changed: 'ATC_suffix' ('AX04' -> 'AX05')22:38:04 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Tapentadol (diff, hist)
Changed: 'ATC_prefix' ('none' -> 'N02')22:38:04 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Tapentadol (diff, hist)
Changed: 'ATC_suffix' ('' -> 'AX06')22:53:32 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Asenapine (diff, hist)
Changed: 'ATC_prefix' ('none' -> 'N05')22:53:32 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Asenapine (diff, hist)
Changed: 'ATC_suffix' ('' -> 'AH05')23:24:47 (4, 4, 4) (EDIT) User:Anypodetos (contribs, talk) edited Bromfenac (diff, hist)
Changed: 'ATC_prefix' ('none' -> 'S01', SET 'none')23:24:48 (4, 4, 4) (EDIT) User:Anypodetos (contribs, talk) edited Bromfenac (diff, hist)
Added: 'ATC_suffix' ('' -> 'BC11', SET '')23:35:10 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Bromfenac (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')